Compare commits

..

159 Commits
v0.8.4 ... 4326

Author SHA1 Message Date
autofix-ci[bot]
2168b9da89 [autofix.ci] apply automated fixes (attempt 2/3) 2025-09-24 22:07:52 +00:00
autofix-ci[bot]
6f4d14f454 [autofix.ci] apply automated fixes 2025-09-24 21:36:10 +00:00
Greg Johnston
9f5800c01e fix: correctly poll all out-of-order streaming chunks (closes #4326) 2025-09-24 17:00:34 -04:00
dependabot[bot]
d0295009cf chore(deps): bump tj-actions/changed-files from 46 to 47 (#4297)
Bumps [tj-actions/changed-files](https://github.com/tj-actions/changed-files) from 46 to 47.
- [Release notes](https://github.com/tj-actions/changed-files/releases)
- [Changelog](https://github.com/tj-actions/changed-files/blob/main/HISTORY.md)
- [Commits](https://github.com/tj-actions/changed-files/compare/v46...v47)

---
updated-dependencies:
- dependency-name: tj-actions/changed-files
  dependency-version: '47'
  dependency-type: direct:production
  update-type: version-update:semver-major
...

Signed-off-by: dependabot[bot] <support@github.com>
Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com>
2025-09-20 11:40:53 -04:00
dependabot[bot]
3e8b5c9805 chore(deps): bump actions/setup-node from 4 to 5 (#4283)
Bumps [actions/setup-node](https://github.com/actions/setup-node) from 4 to 5.
- [Release notes](https://github.com/actions/setup-node/releases)
- [Commits](https://github.com/actions/setup-node/compare/v4...v5)

---
updated-dependencies:
- dependency-name: actions/setup-node
  dependency-version: '5'
  dependency-type: direct:production
  update-type: version-update:semver-major
...

Signed-off-by: dependabot[bot] <support@github.com>
Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com>
2025-09-20 11:40:41 -04:00
Greg Johnston
924efa8ac1 feat: minimal support for subsecond and an example (#4307) 2025-09-20 11:40:28 -04:00
Ægir Örn Símonarson
44bc4fbc31 Locking dependencies in cargo-leptos install example (#4295)
This limits dependencies errors on install
2025-09-19 11:35:51 -04:00
Greg Johnston
646cfc12ed leptos v0.8.9 2025-09-18 15:49:46 -04:00
Greg Johnston
62977a68b0 fix: support const generic static strs on nightly versions with conflicting feature names (closes #4300) (#4301) 2025-09-18 09:09:36 -04:00
Adam Doyle
e9ee90c78f chore: add referrerpolicy attribute to a element (#4299) 2025-09-18 09:05:27 -04:00
Greg Johnston
73e728f145 Merge pull request #4294 from leptos-rs/4285
fix: prevent double-rebuild and correctly navigate multiple times to same lazy route (closes #4285)
2025-09-17 10:05:49 -04:00
Greg Johnston
6f047a2271 test: add regression test for #4296 2025-09-16 16:22:42 -04:00
Greg Johnston
7c942b8b47 chore: correct name for test 2025-09-16 16:07:00 -04:00
Greg Johnston
d4bf6d9cb6 test: add regression test for #4285 2025-09-15 21:05:12 -04:00
Greg Johnston
9deb96ea01 fix: provide correct URL/query/params to preloaders (closes #4296) 2025-09-15 19:46:52 -04:00
Greg Johnston
d1899cde1c during SSR, don't dispose of preload owners until whole request is done 2025-09-15 18:54:11 -04:00
Greg Johnston
ee731d7a3a fix: create individual owners for each preload 2025-09-12 18:51:46 -04:00
Greg Johnston
59cbcfa0fb fix: prevent infinite rebuild loop 2025-09-12 18:00:13 -04:00
Greg Johnston
0939cf63ad Revert "fix: prevent double-rebuild and correctly navigate multiple times to same lazy route (closes #4285)"
This reverts commit d37512bebd.
2025-09-12 17:59:14 -04:00
Greg Johnston
d37512bebd fix: prevent double-rebuild and correctly navigate multiple times to same lazy route (closes #4285) 2025-09-12 17:20:52 -04:00
Greg Johnston
7dd44919cf docs: document some missing features (#4281) 2025-09-10 09:53:35 -07:00
Raffaele Fontana
3eaabf85ea docs: fix broken link in suspense (#4276) 2025-09-03 08:34:08 -04:00
Greg Johnston
d60c632c90 fix: correctly propagate visibility on lazy functions (closes #4256) (#4259) 2025-09-03 08:33:38 -04:00
Greg Johnston
f5ad4f4b88 fix: clear old attributes when replacing a Vec<AnyAttribute> (closes #4268) (#4270) 2025-09-01 07:41:54 -04:00
zakstucke
f3a053f99b feat: standardize ScopedFuture::new_untracked like untrack() and untrack_with_diagnostics() (#4269) 2025-08-31 12:30:16 -04:00
Greg Johnston
06573cbca1 Merge pull request #4272 from leptos-rs/4271
fix: revert changes to raw text parsing (closes #4271)
2025-08-30 11:25:13 -04:00
autofix-ci[bot]
9f4d826533 [autofix.ci] apply automated fixes 2025-08-30 11:25:00 +00:00
Greg Johnston
a305ae7227 chore: update leptos_macro version 2025-08-30 06:53:42 -04:00
Greg Johnston
65557c5723 leptos_macro-v0.8.8 2025-08-30 06:47:57 -04:00
Greg Johnston
a529f87ee2 Revert "fix: correctly parse unquoted text with punctuation in stable (closes #4137) (#4238)"
This reverts commit 99c3d8f9e9.
2025-08-30 06:46:36 -04:00
zakstucke
c0ca97e42f feat: impl From<RwSignal/ReadSignal/Memo> for ArcSignal (#4258) 2025-08-29 16:09:41 -04:00
dependabot[bot]
9a4e93ab07 chore(deps): bump the rust-dependencies group across 1 directory with 33 updates (#4262)
Bumps the rust-dependencies group with 32 updates in the / directory:

| Package | From | To |
| --- | --- | --- |
| [serde_json](https://github.com/serde-rs/json) | `1.0.142` | `1.0.143` |
| [typed-builder](https://github.com/idanarye/rust-typed-builder) | `0.21.0` | `0.21.2` |
| [thiserror](https://github.com/dtolnay/thiserror) | `2.0.12` | `2.0.16` |
| [indexmap](https://github.com/indexmap-rs/indexmap) | `2.10.0` | `2.11.0` |
| [cfg-if](https://github.com/rust-lang/cfg-if) | `1.0.1` | `1.0.3` |
| [proc-macro2](https://github.com/dtolnay/proc-macro2) | `1.0.96` | `1.0.101` |
| [syn](https://github.com/dtolnay/syn) | `2.0.104` | `2.0.106` |
| [async-trait](https://github.com/dtolnay/async-trait) | `0.1.88` | `0.1.89` |
| [anyhow](https://github.com/dtolnay/anyhow) | `1.0.98` | `1.0.99` |
| [prettyplease](https://github.com/dtolnay/prettyplease) | `0.2.36` | `0.2.37` |
| [inventory](https://github.com/dtolnay/inventory) | `0.3.20` | `0.3.21` |
| [config](https://github.com/rust-cli/config-rs) | `0.15.13` | `0.15.14` |
| [regex](https://github.com/rust-lang/regex) | `1.11.1` | `1.11.2` |
| [tempfile](https://github.com/Stebalien/tempfile) | `3.20.0` | `3.21.0` |
| [percent-encoding](https://github.com/servo/rust-url) | `2.3.1` | `2.3.2` |
| [hyper](https://github.com/hyperium/hyper) | `1.6.0` | `1.7.0` |
| [reqwest](https://github.com/seanmonstar/reqwest) | `0.12.22` | `0.12.23` |
| [actix-http](https://github.com/actix/actix-web) | `3.11.0` | `3.11.1` |
| [bitflags](https://github.com/bitflags/bitflags) | `2.9.1` | `2.9.3` |
| [brotli](https://github.com/dropbox/rust-brotli) | `8.0.1` | `8.0.2` |
| [cc](https://github.com/rust-lang/cc-rs) | `1.2.32` | `1.2.34` |
| [form_urlencoded](https://github.com/servo/rust-url) | `1.2.1` | `1.2.2` |
| [idna](https://github.com/servo/rust-url) | `1.0.3` | `1.1.0` |
| [io-uring](https://github.com/tokio-rs/io-uring) | `0.7.9` | `0.7.10` |
| [jobserver](https://github.com/rust-lang/jobserver-rs) | `0.1.33` | `0.1.34` |
| [regex-automata](https://github.com/rust-lang/regex) | `0.4.9` | `0.4.10` |
| [regex-lite](https://github.com/rust-lang/regex) | `0.1.6` | `0.1.7` |
| [regex-syntax](https://github.com/rust-lang/regex) | `0.8.5` | `0.8.6` |
| [scc](https://github.com/wvwwvwwv/scalable-concurrent-containers) | `2.3.4` | `2.4.0` |
| [tinyvec](https://github.com/Lokathor/tinyvec) | `1.9.0` | `1.10.0` |
| [winapi-util](https://github.com/BurntSushi/winapi-util) | `0.1.9` | `0.1.10` |
| [winnow](https://github.com/winnow-rs/winnow) | `0.7.12` | `0.7.13` |



Updates `serde_json` from 1.0.142 to 1.0.143
- [Release notes](https://github.com/serde-rs/json/releases)
- [Commits](https://github.com/serde-rs/json/compare/v1.0.142...v1.0.143)

Updates `typed-builder` from 0.21.0 to 0.21.2
- [Release notes](https://github.com/idanarye/rust-typed-builder/releases)
- [Changelog](https://github.com/idanarye/rust-typed-builder/blob/master/CHANGELOG.md)
- [Commits](https://github.com/idanarye/rust-typed-builder/compare/v0.21.0...v0.21.2)

Updates `thiserror` from 2.0.12 to 2.0.16
- [Release notes](https://github.com/dtolnay/thiserror/releases)
- [Commits](https://github.com/dtolnay/thiserror/compare/2.0.12...2.0.16)

Updates `indexmap` from 2.10.0 to 2.11.0
- [Changelog](https://github.com/indexmap-rs/indexmap/blob/main/RELEASES.md)
- [Commits](https://github.com/indexmap-rs/indexmap/compare/2.10.0...2.11.0)

Updates `cfg-if` from 1.0.1 to 1.0.3
- [Release notes](https://github.com/rust-lang/cfg-if/releases)
- [Changelog](https://github.com/rust-lang/cfg-if/blob/main/CHANGELOG.md)
- [Commits](https://github.com/rust-lang/cfg-if/compare/v1.0.1...v1.0.3)

Updates `proc-macro2` from 1.0.96 to 1.0.101
- [Release notes](https://github.com/dtolnay/proc-macro2/releases)
- [Commits](https://github.com/dtolnay/proc-macro2/compare/1.0.96...1.0.101)

Updates `syn` from 2.0.104 to 2.0.106
- [Release notes](https://github.com/dtolnay/syn/releases)
- [Commits](https://github.com/dtolnay/syn/compare/2.0.104...2.0.106)

Updates `async-trait` from 0.1.88 to 0.1.89
- [Release notes](https://github.com/dtolnay/async-trait/releases)
- [Commits](https://github.com/dtolnay/async-trait/compare/0.1.88...0.1.89)

Updates `typed-builder-macro` from 0.21.0 to 0.21.2
- [Release notes](https://github.com/idanarye/rust-typed-builder/releases)
- [Changelog](https://github.com/idanarye/rust-typed-builder/blob/master/CHANGELOG.md)
- [Commits](https://github.com/idanarye/rust-typed-builder/compare/v0.21.0...v0.21.2)

Updates `anyhow` from 1.0.98 to 1.0.99
- [Release notes](https://github.com/dtolnay/anyhow/releases)
- [Commits](https://github.com/dtolnay/anyhow/compare/1.0.98...1.0.99)

Updates `prettyplease` from 0.2.36 to 0.2.37
- [Release notes](https://github.com/dtolnay/prettyplease/releases)
- [Commits](https://github.com/dtolnay/prettyplease/compare/0.2.36...0.2.37)

Updates `inventory` from 0.3.20 to 0.3.21
- [Release notes](https://github.com/dtolnay/inventory/releases)
- [Commits](https://github.com/dtolnay/inventory/compare/0.3.20...0.3.21)

Updates `config` from 0.15.13 to 0.15.14
- [Changelog](https://github.com/rust-cli/config-rs/blob/main/CHANGELOG.md)
- [Commits](https://github.com/rust-cli/config-rs/compare/v0.15.13...v0.15.14)

Updates `regex` from 1.11.1 to 1.11.2
- [Release notes](https://github.com/rust-lang/regex/releases)
- [Changelog](https://github.com/rust-lang/regex/blob/master/CHANGELOG.md)
- [Commits](https://github.com/rust-lang/regex/compare/1.11.1...1.11.2)

Updates `tempfile` from 3.20.0 to 3.21.0
- [Changelog](https://github.com/Stebalien/tempfile/blob/master/CHANGELOG.md)
- [Commits](https://github.com/Stebalien/tempfile/commits)

Updates `percent-encoding` from 2.3.1 to 2.3.2
- [Release notes](https://github.com/servo/rust-url/releases)
- [Commits](https://github.com/servo/rust-url/commits)

Updates `hyper` from 1.6.0 to 1.7.0
- [Release notes](https://github.com/hyperium/hyper/releases)
- [Changelog](https://github.com/hyperium/hyper/blob/master/CHANGELOG.md)
- [Commits](https://github.com/hyperium/hyper/compare/v1.6.0...v1.7.0)

Updates `reqwest` from 0.12.22 to 0.12.23
- [Release notes](https://github.com/seanmonstar/reqwest/releases)
- [Changelog](https://github.com/seanmonstar/reqwest/blob/master/CHANGELOG.md)
- [Commits](https://github.com/seanmonstar/reqwest/compare/v0.12.22...v0.12.23)

Updates `actix-http` from 3.11.0 to 3.11.1
- [Release notes](https://github.com/actix/actix-web/releases)
- [Changelog](https://github.com/actix/actix-web/blob/master/CHANGES.md)
- [Commits](https://github.com/actix/actix-web/compare/http-v3.11.0...http-v3.11.1)

Updates `bitflags` from 2.9.1 to 2.9.3
- [Release notes](https://github.com/bitflags/bitflags/releases)
- [Changelog](https://github.com/bitflags/bitflags/blob/main/CHANGELOG.md)
- [Commits](https://github.com/bitflags/bitflags/compare/2.9.1...2.9.3)

Updates `brotli` from 8.0.1 to 8.0.2
- [Release notes](https://github.com/dropbox/rust-brotli/releases)
- [Commits](https://github.com/dropbox/rust-brotli/commits/8.0.2)

Updates `cc` from 1.2.32 to 1.2.34
- [Release notes](https://github.com/rust-lang/cc-rs/releases)
- [Changelog](https://github.com/rust-lang/cc-rs/blob/main/CHANGELOG.md)
- [Commits](https://github.com/rust-lang/cc-rs/compare/cc-v1.2.32...cc-v1.2.34)

Updates `form_urlencoded` from 1.2.1 to 1.2.2
- [Release notes](https://github.com/servo/rust-url/releases)
- [Commits](https://github.com/servo/rust-url/compare/v1.2.1...v1.2.2)

Updates `idna` from 1.0.3 to 1.1.0
- [Release notes](https://github.com/servo/rust-url/releases)
- [Commits](https://github.com/servo/rust-url/commits)

Updates `io-uring` from 0.7.9 to 0.7.10
- [Commits](https://github.com/tokio-rs/io-uring/commits)

Updates `jobserver` from 0.1.33 to 0.1.34
- [Commits](https://github.com/rust-lang/jobserver-rs/compare/0.1.33...0.1.34)

Updates `regex-automata` from 0.4.9 to 0.4.10
- [Release notes](https://github.com/rust-lang/regex/releases)
- [Changelog](https://github.com/rust-lang/regex/blob/master/CHANGELOG.md)
- [Commits](https://github.com/rust-lang/regex/compare/regex-automata-0.4.9...regex-automata-0.4.10)

Updates `regex-lite` from 0.1.6 to 0.1.7
- [Release notes](https://github.com/rust-lang/regex/releases)
- [Changelog](https://github.com/rust-lang/regex/blob/master/CHANGELOG.md)
- [Commits](https://github.com/rust-lang/regex/compare/regex-lite-0.1.6...regex-lite-0.1.7)

Updates `regex-syntax` from 0.8.5 to 0.8.6
- [Release notes](https://github.com/rust-lang/regex/releases)
- [Changelog](https://github.com/rust-lang/regex/blob/master/CHANGELOG.md)
- [Commits](https://github.com/rust-lang/regex/compare/regex-syntax-0.8.5...regex-syntax-0.8.6)

Updates `scc` from 2.3.4 to 2.4.0
- [Changelog](https://github.com/wvwwvwwv/scalable-concurrent-containers/blob/main/CHANGELOG.md)
- [Commits](https://github.com/wvwwvwwv/scalable-concurrent-containers/commits)

Updates `tinyvec` from 1.9.0 to 1.10.0
- [Changelog](https://github.com/Lokathor/tinyvec/blob/main/CHANGELOG.md)
- [Commits](https://github.com/Lokathor/tinyvec/compare/v1.9.0...v1.10.0)

Updates `winapi-util` from 0.1.9 to 0.1.10
- [Commits](https://github.com/BurntSushi/winapi-util/compare/0.1.9...0.1.10)

Updates `winnow` from 0.7.12 to 0.7.13
- [Changelog](https://github.com/winnow-rs/winnow/blob/main/CHANGELOG.md)
- [Commits](https://github.com/winnow-rs/winnow/compare/v0.7.12...v0.7.13)

---
updated-dependencies:
- dependency-name: serde_json
  dependency-version: 1.0.143
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: typed-builder
  dependency-version: 0.21.2
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: thiserror
  dependency-version: 2.0.16
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: indexmap
  dependency-version: 2.11.0
  dependency-type: direct:production
  update-type: version-update:semver-minor
  dependency-group: rust-dependencies
- dependency-name: cfg-if
  dependency-version: 1.0.3
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: proc-macro2
  dependency-version: 1.0.101
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: syn
  dependency-version: 2.0.106
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: async-trait
  dependency-version: 0.1.89
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: typed-builder-macro
  dependency-version: 0.21.2
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: anyhow
  dependency-version: 1.0.99
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: prettyplease
  dependency-version: 0.2.37
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: inventory
  dependency-version: 0.3.21
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: config
  dependency-version: 0.15.14
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: regex
  dependency-version: 1.11.2
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: tempfile
  dependency-version: 3.21.0
  dependency-type: direct:production
  update-type: version-update:semver-minor
  dependency-group: rust-dependencies
- dependency-name: percent-encoding
  dependency-version: 2.3.2
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: hyper
  dependency-version: 1.7.0
  dependency-type: direct:production
  update-type: version-update:semver-minor
  dependency-group: rust-dependencies
- dependency-name: reqwest
  dependency-version: 0.12.23
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: actix-http
  dependency-version: 3.11.1
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: bitflags
  dependency-version: 2.9.3
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: brotli
  dependency-version: 8.0.2
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: cc
  dependency-version: 1.2.34
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: form_urlencoded
  dependency-version: 1.2.2
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: idna
  dependency-version: 1.1.0
  dependency-type: indirect
  update-type: version-update:semver-minor
  dependency-group: rust-dependencies
- dependency-name: io-uring
  dependency-version: 0.7.10
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: jobserver
  dependency-version: 0.1.34
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: regex-automata
  dependency-version: 0.4.10
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: regex-lite
  dependency-version: 0.1.7
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: regex-syntax
  dependency-version: 0.8.6
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: scc
  dependency-version: 2.4.0
  dependency-type: indirect
  update-type: version-update:semver-minor
  dependency-group: rust-dependencies
- dependency-name: tinyvec
  dependency-version: 1.10.0
  dependency-type: indirect
  update-type: version-update:semver-minor
  dependency-group: rust-dependencies
- dependency-name: winapi-util
  dependency-version: 0.1.10
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: winnow
  dependency-version: 0.7.13
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
...

Signed-off-by: dependabot[bot] <support@github.com>
Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com>
2025-08-29 16:08:39 -04:00
zakstucke
bee2b5ea1c feat: impl From<View<C>> for ViewFn where View<C>: Clone (#4266) 2025-08-29 16:02:00 -04:00
Spencer Ferris
3b058e77f1 fix: set Content-Type header for server function errors (closes #4209) (#4215) 2025-08-29 08:56:26 -04:00
zakstucke
7adb11ec49 Preserve owner in Actions and event listeners (#4267)
* Preserve Owner for Action's, allowing context retrieval

* Preserve owner for event listeners, allowing context retrieval

* CI

* Refactor

---------

Co-authored-by: Zak Stucke <zakstucke@hotmail.c.uk>
2025-08-29 11:50:33 +12:00
Greg Johnston
1af5f66ee6 fix: when navigating, only add new URL to history stack if it's different from current URL (closes #4251) (#4252) 2025-08-26 21:08:00 -04:00
Gabriel Lopes Veiga
956f1836ec fix: use wss for live reload if on https (#4257) 2025-08-26 21:07:28 -04:00
Greg Johnston
b54f80f529 chore: publish new patch releases for changed packages 2025-08-26 17:13:21 -04:00
Greg Johnston
a48a2994ee Merge pull request #4255 from leptos-rs/4254
Revert recent broken changes
2025-08-26 17:09:01 -04:00
Greg Johnston
aedcd5148c Revert "feat: add default "auto" live reload protocol option (#4224)"
This reverts commit a97eceacf1.
2025-08-26 13:25:49 -04:00
Greg Johnston
9160d8aaa6 Revert "made <Show> accept signals in addition to closures (#4236)"
This reverts commit db9f323f8d.
2025-08-26 13:24:44 -04:00
Greg Johnston
274fe07dae Merge remote-tracking branch 'origin' 2025-08-26 13:23:17 -04:00
Greg Johnston
7add26fc41 docs: correctly document additional serialization features for leptos_server (#4250) 2025-08-25 20:46:40 -04:00
Greg Johnston
d9213850f7 chore: publish new patch releases for changed packages 2025-08-25 20:40:32 -04:00
Marc-Stefan Cassola
db9f323f8d made <Show> accept signals in addition to closures (#4236) 2025-08-25 14:50:20 -07:00
Greg Johnston
1d0f668dc3 Merge pull request #4235 from leptos-rs/4217
Special-case `value` property to support quirky `<select>` behavior
2025-08-25 09:05:29 -04:00
Gabriel Lopes Veiga
a97eceacf1 feat: add default "auto" live reload protocol option (#4224)
* feat: add default "auto" live reload protocol option

* fix: make "auto" live reload protocol option last
2025-08-23 17:29:22 -07:00
Greg Johnston
3d6ea6d285 Merge pull request #4242 from leptos-rs/4239
Fixes for two server function issues
2025-08-22 21:00:54 -04:00
Greg Johnston
99c3d8f9e9 fix: correctly parse unquoted text with punctuation in stable (closes #4137) (#4238) 2025-08-22 21:00:39 -04:00
Greg Johnston
a394eb211f fix: transposed Accept/Content-Type headers in server function requests (closes #4240) 2025-08-22 16:32:42 -04:00
Greg Johnston
ceb7dd8ae5 fix: parse body rather than query string for PatchUrl and PutUrl (closes #4239) 2025-08-22 16:20:21 -04:00
Greg Johnston
f50adc00bc chore: rename changed method to avoid breaking user code that called set_property 2025-08-21 19:47:02 -04:00
Greg Johnston
1340deee96 chore: typo in name of feature test 2025-08-21 19:20:41 -04:00
Greg Johnston
8da3011a7f fix: special-case value prop so that it waits for children, if any, before being set (closes #4217) 2025-08-20 22:07:32 -04:00
Greg Johnston
959677f018 chore: move queue_microtask implementation into tachys 2025-08-20 22:06:38 -04:00
Greg Johnston
03529b3992 chore: add regression test for #4005 2025-08-20 21:19:35 -04:00
Greg Johnston
8bfd0ce143 chore: add regression test for #4217 2025-08-20 21:11:16 -04:00
Marc-Stefan Cassola
47199bbbf3 <ShowLet> component similar to <Show> but for Option (#4227)
* added the <Map> component

* chore: rustfmt

* removed support for `Result` from `<Map>` and added possibility to use
both closures and signals in the `value` prop.
2025-08-20 11:24:31 -07:00
Greg Johnston
9ed7e9de61 chore: remove lockfiles accidentally included in repo (#4234) 2025-08-20 10:34:42 -04:00
yescallop
26ecbf4df5 fix: allow non_snake_case and dead_code lints to run within component functions (#3198)
* fix: allow `non_snake_case` and `dead_code` lints to run within component functions

* Fixed component type name

* Update lib.rs

* [autofix.ci] apply automated fixes

---------

Co-authored-by: Rakshith Ravi <rakshith.ravi@gmx.com>
Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com>
2025-08-17 10:45:33 -07:00
dependabot[bot]
b3885c7be4 chore(deps): bump actions/checkout from 4 to 5 (#4221)
Bumps [actions/checkout](https://github.com/actions/checkout) from 4 to 5.
- [Release notes](https://github.com/actions/checkout/releases)
- [Changelog](https://github.com/actions/checkout/blob/main/CHANGELOG.md)
- [Commits](https://github.com/actions/checkout/compare/v4...v5)

---
updated-dependencies:
- dependency-name: actions/checkout
  dependency-version: '5'
  dependency-type: direct:production
  update-type: version-update:semver-major
...

Signed-off-by: dependabot[bot] <support@github.com>
Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com>
2025-08-14 11:39:37 -07:00
dependabot[bot]
436e5aa141 chore(deps): bump the rust-dependencies group with 32 updates (#4222)
Bumps the rust-dependencies group with 32 updates:

| Package | From | To |
| --- | --- | --- |
| [serde_json](https://github.com/serde-rs/json) | `1.0.141` | `1.0.142` |
| [trybuild](https://github.com/dtolnay/trybuild) | `1.0.106` | `1.0.110` |
| [tokio](https://github.com/tokio-rs/tokio) | `1.46.1` | `1.47.1` |
| [proc-macro2](https://github.com/dtolnay/proc-macro2) | `1.0.95` | `1.0.96` |
| [prettyplease](https://github.com/dtolnay/prettyplease) | `0.2.35` | `0.2.36` |
| [camino](https://github.com/camino-rs/camino) | `1.1.10` | `1.1.11` |
| [rkyv](https://github.com/rkyv/rkyv) | `0.8.10` | `0.8.11` |
| [uuid](https://github.com/uuid-rs/uuid) | `1.17.0` | `1.18.0` |
| [futures-lite](https://github.com/smol-rs/futures-lite) | `2.6.0` | `2.6.1` |
| [const-str](https://github.com/Nugine/const-str) | `0.6.3` | `0.6.4` |
| [postcard](https://github.com/jamesmunns/postcard) | `1.1.2` | `1.1.3` |
| [rustversion](https://github.com/dtolnay/rustversion) | `1.0.21` | `1.0.22` |
| [async-lock](https://github.com/smol-rs/async-lock) | `3.4.0` | `3.4.1` |
| [cc](https://github.com/rust-lang/cc-rs) | `1.2.30` | `1.2.32` |
| [cfg-expr](https://github.com/EmbarkStudios/cfg-expr) | `0.20.1` | `0.20.2` |
| [derive-where](https://github.com/ModProg/derive-where) | `1.5.0` | `1.6.0` |
| [event-listener](https://github.com/smol-rs/event-listener) | `5.4.0` | `5.4.1` |
| [glob](https://github.com/rust-lang/glob) | `0.3.2` | `0.3.3` |
| [hyper-util](https://github.com/hyperium/hyper-util) | `0.1.15` | `0.1.16` |
| [io-uring](https://github.com/tokio-rs/io-uring) | `0.7.8` | `0.7.9` |
| [libc](https://github.com/rust-lang/libc) | `0.2.174` | `0.2.175` |
| [munge](https://github.com/djkoloski/munge) | `0.4.5` | `0.4.6` |
| [munge_macro](https://github.com/djkoloski/munge) | `0.4.5` | `0.4.6` |
| redox_syscall | `0.5.15` | `0.5.17` |
| [rkyv_derive](https://github.com/rkyv/rkyv) | `0.8.10` | `0.8.11` |
| [rustc-demangle](https://github.com/rust-lang/rustc-demangle) | `0.1.25` | `0.1.26` |
| [rustls](https://github.com/rustls/rustls) | `0.23.29` | `0.23.31` |
| [signal-hook-registry](https://github.com/vorner/signal-hook) | `1.4.5` | `1.4.6` |
| [slab](https://github.com/tokio-rs/slab) | `0.4.10` | `0.4.11` |
| [tokio-util](https://github.com/tokio-rs/tokio) | `0.7.15` | `0.7.16` |
| [toml_parser](https://github.com/toml-rs/toml) | `1.0.1` | `1.0.2` |
| [zerovec](https://github.com/unicode-org/icu4x) | `0.11.2` | `0.11.4` |


Updates `serde_json` from 1.0.141 to 1.0.142
- [Release notes](https://github.com/serde-rs/json/releases)
- [Commits](https://github.com/serde-rs/json/compare/v1.0.141...v1.0.142)

Updates `trybuild` from 1.0.106 to 1.0.110
- [Release notes](https://github.com/dtolnay/trybuild/releases)
- [Commits](https://github.com/dtolnay/trybuild/compare/1.0.106...1.0.110)

Updates `tokio` from 1.46.1 to 1.47.1
- [Release notes](https://github.com/tokio-rs/tokio/releases)
- [Commits](https://github.com/tokio-rs/tokio/compare/tokio-1.46.1...tokio-1.47.1)

Updates `proc-macro2` from 1.0.95 to 1.0.96
- [Release notes](https://github.com/dtolnay/proc-macro2/releases)
- [Commits](https://github.com/dtolnay/proc-macro2/compare/1.0.95...1.0.96)

Updates `prettyplease` from 0.2.35 to 0.2.36
- [Release notes](https://github.com/dtolnay/prettyplease/releases)
- [Commits](https://github.com/dtolnay/prettyplease/compare/0.2.35...0.2.36)

Updates `camino` from 1.1.10 to 1.1.11
- [Release notes](https://github.com/camino-rs/camino/releases)
- [Changelog](https://github.com/camino-rs/camino/blob/main/CHANGELOG.md)
- [Commits](https://github.com/camino-rs/camino/compare/camino-1.1.10...camino-1.1.11)

Updates `rkyv` from 0.8.10 to 0.8.11
- [Release notes](https://github.com/rkyv/rkyv/releases)
- [Commits](https://github.com/rkyv/rkyv/commits)

Updates `uuid` from 1.17.0 to 1.18.0
- [Release notes](https://github.com/uuid-rs/uuid/releases)
- [Commits](https://github.com/uuid-rs/uuid/compare/v1.17.0...v1.18.0)

Updates `futures-lite` from 2.6.0 to 2.6.1
- [Release notes](https://github.com/smol-rs/futures-lite/releases)
- [Changelog](https://github.com/smol-rs/futures-lite/blob/master/CHANGELOG.md)
- [Commits](https://github.com/smol-rs/futures-lite/compare/v2.6.0...v2.6.1)

Updates `const-str` from 0.6.3 to 0.6.4
- [Release notes](https://github.com/Nugine/const-str/releases)
- [Commits](https://github.com/Nugine/const-str/compare/v0.6.3...v0.6.4)

Updates `postcard` from 1.1.2 to 1.1.3
- [Release notes](https://github.com/jamesmunns/postcard/releases)
- [Commits](https://github.com/jamesmunns/postcard/compare/postcard/v1.1.2...postcard/v1.1.3)

Updates `rustversion` from 1.0.21 to 1.0.22
- [Release notes](https://github.com/dtolnay/rustversion/releases)
- [Commits](https://github.com/dtolnay/rustversion/compare/1.0.21...1.0.22)

Updates `async-lock` from 3.4.0 to 3.4.1
- [Release notes](https://github.com/smol-rs/async-lock/releases)
- [Changelog](https://github.com/smol-rs/async-lock/blob/master/CHANGELOG.md)
- [Commits](https://github.com/smol-rs/async-lock/compare/v3.4.0...v3.4.1)

Updates `cc` from 1.2.30 to 1.2.32
- [Release notes](https://github.com/rust-lang/cc-rs/releases)
- [Changelog](https://github.com/rust-lang/cc-rs/blob/main/CHANGELOG.md)
- [Commits](https://github.com/rust-lang/cc-rs/compare/cc-v1.2.30...cc-v1.2.32)

Updates `cfg-expr` from 0.20.1 to 0.20.2
- [Release notes](https://github.com/EmbarkStudios/cfg-expr/releases)
- [Changelog](https://github.com/EmbarkStudios/cfg-expr/blob/main/CHANGELOG.md)
- [Commits](https://github.com/EmbarkStudios/cfg-expr/compare/0.20.1...0.20.2)

Updates `derive-where` from 1.5.0 to 1.6.0
- [Release notes](https://github.com/ModProg/derive-where/releases)
- [Changelog](https://github.com/ModProg/derive-where/blob/main/CHANGELOG.md)
- [Commits](https://github.com/ModProg/derive-where/compare/v1.5.0...v1.6.0)

Updates `event-listener` from 5.4.0 to 5.4.1
- [Release notes](https://github.com/smol-rs/event-listener/releases)
- [Changelog](https://github.com/smol-rs/event-listener/blob/master/CHANGELOG.md)
- [Commits](https://github.com/smol-rs/event-listener/compare/v5.4.0...v5.4.1)

Updates `glob` from 0.3.2 to 0.3.3
- [Release notes](https://github.com/rust-lang/glob/releases)
- [Changelog](https://github.com/rust-lang/glob/blob/master/CHANGELOG.md)
- [Commits](https://github.com/rust-lang/glob/compare/v0.3.2...v0.3.3)

Updates `hyper-util` from 0.1.15 to 0.1.16
- [Release notes](https://github.com/hyperium/hyper-util/releases)
- [Changelog](https://github.com/hyperium/hyper-util/blob/master/CHANGELOG.md)
- [Commits](https://github.com/hyperium/hyper-util/compare/v0.1.15...v0.1.16)

Updates `io-uring` from 0.7.8 to 0.7.9
- [Commits](https://github.com/tokio-rs/io-uring/commits)

Updates `libc` from 0.2.174 to 0.2.175
- [Release notes](https://github.com/rust-lang/libc/releases)
- [Changelog](https://github.com/rust-lang/libc/blob/0.2.175/CHANGELOG.md)
- [Commits](https://github.com/rust-lang/libc/compare/0.2.174...0.2.175)

Updates `munge` from 0.4.5 to 0.4.6
- [Release notes](https://github.com/djkoloski/munge/releases)
- [Commits](https://github.com/djkoloski/munge/commits)

Updates `munge_macro` from 0.4.5 to 0.4.6
- [Release notes](https://github.com/djkoloski/munge/releases)
- [Commits](https://github.com/djkoloski/munge/commits)

Updates `redox_syscall` from 0.5.15 to 0.5.17

Updates `rkyv_derive` from 0.8.10 to 0.8.11
- [Release notes](https://github.com/rkyv/rkyv/releases)
- [Commits](https://github.com/rkyv/rkyv/commits)

Updates `rustc-demangle` from 0.1.25 to 0.1.26
- [Release notes](https://github.com/rust-lang/rustc-demangle/releases)
- [Changelog](https://github.com/rust-lang/rustc-demangle/blob/main/CHANGELOG.md)
- [Commits](https://github.com/rust-lang/rustc-demangle/commits/rustc-demangle-v0.1.26)

Updates `rustls` from 0.23.29 to 0.23.31
- [Release notes](https://github.com/rustls/rustls/releases)
- [Changelog](https://github.com/rustls/rustls/blob/main/CHANGELOG.md)
- [Commits](https://github.com/rustls/rustls/compare/v/0.23.29...v/0.23.31)

Updates `signal-hook-registry` from 1.4.5 to 1.4.6
- [Changelog](https://github.com/vorner/signal-hook/blob/master/CHANGELOG.md)
- [Commits](https://github.com/vorner/signal-hook/compare/registry-v1.4.5...registry-v1.4.6)

Updates `slab` from 0.4.10 to 0.4.11
- [Release notes](https://github.com/tokio-rs/slab/releases)
- [Changelog](https://github.com/tokio-rs/slab/blob/master/CHANGELOG.md)
- [Commits](https://github.com/tokio-rs/slab/compare/v0.4.10...v0.4.11)

Updates `tokio-util` from 0.7.15 to 0.7.16
- [Release notes](https://github.com/tokio-rs/tokio/releases)
- [Commits](https://github.com/tokio-rs/tokio/compare/tokio-util-0.7.15...tokio-util-0.7.16)

Updates `toml_parser` from 1.0.1 to 1.0.2
- [Commits](https://github.com/toml-rs/toml/compare/toml_parser-v1.0.1...toml_parser-v1.0.2)

Updates `zerovec` from 0.11.2 to 0.11.4
- [Release notes](https://github.com/unicode-org/icu4x/releases)
- [Changelog](https://github.com/unicode-org/icu4x/blob/main/CHANGELOG.md)
- [Commits](https://github.com/unicode-org/icu4x/commits/ind/zerovec@0.11.4)

---
updated-dependencies:
- dependency-name: serde_json
  dependency-version: 1.0.142
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: trybuild
  dependency-version: 1.0.110
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: tokio
  dependency-version: 1.47.1
  dependency-type: direct:production
  update-type: version-update:semver-minor
  dependency-group: rust-dependencies
- dependency-name: proc-macro2
  dependency-version: 1.0.96
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: prettyplease
  dependency-version: 0.2.36
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: camino
  dependency-version: 1.1.11
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: rkyv
  dependency-version: 0.8.11
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: uuid
  dependency-version: 1.18.0
  dependency-type: direct:production
  update-type: version-update:semver-minor
  dependency-group: rust-dependencies
- dependency-name: futures-lite
  dependency-version: 2.6.1
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: const-str
  dependency-version: 0.6.4
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: postcard
  dependency-version: 1.1.3
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: rustversion
  dependency-version: 1.0.22
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: async-lock
  dependency-version: 3.4.1
  dependency-type: direct:production
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: cc
  dependency-version: 1.2.32
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: cfg-expr
  dependency-version: 0.20.2
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: derive-where
  dependency-version: 1.6.0
  dependency-type: indirect
  update-type: version-update:semver-minor
  dependency-group: rust-dependencies
- dependency-name: event-listener
  dependency-version: 5.4.1
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: glob
  dependency-version: 0.3.3
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: hyper-util
  dependency-version: 0.1.16
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: io-uring
  dependency-version: 0.7.9
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: libc
  dependency-version: 0.2.175
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: munge
  dependency-version: 0.4.6
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: munge_macro
  dependency-version: 0.4.6
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: redox_syscall
  dependency-version: 0.5.17
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: rkyv_derive
  dependency-version: 0.8.11
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: rustc-demangle
  dependency-version: 0.1.26
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: rustls
  dependency-version: 0.23.31
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: signal-hook-registry
  dependency-version: 1.4.6
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: slab
  dependency-version: 0.4.11
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: tokio-util
  dependency-version: 0.7.16
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: toml_parser
  dependency-version: 1.0.2
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
- dependency-name: zerovec
  dependency-version: 0.11.4
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
...

Signed-off-by: dependabot[bot] <support@github.com>
Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com>
2025-08-14 11:39:20 -07:00
Greg Johnston
05cafa8b06 fix: support islands routing in 404 routes (#4218) 2025-08-11 21:46:10 -04:00
Greg Johnston
9e3c0cc402 fix: pass hydrate_async through OwnedView properly (closes #4219) (#4220) 2025-08-11 21:06:02 -04:00
Gabriel Lopes Veiga
30141293f6 feat: implement IntoProperty for Oco (#4174) 2025-08-09 15:34:51 -04:00
Saber Haj Rabiee
8f623a2d5b feat: improving the bump script (#4187) 2025-08-09 15:31:50 -04:00
Greg Johnston
f2fe791f6b perf: use a set instead of Vec<_> to optimize large subscriber sets (see #4138) (#4201) 2025-08-09 15:31:05 -04:00
Greg Johnston
30dbb7ccc8 fix: ensure task::spawn maintains reactive ownership (closes #4203) (#4206) 2025-08-09 15:30:23 -04:00
Aleksander Heintz
b986fe11dc make is_server and is_browser public (#4204) 2025-08-05 17:10:10 -07:00
mskorkowski
e2e28ef180 fix: allowing deriving Patch for a struct with generic argument (closes #4163) (#4175) 2025-08-03 08:28:42 -04:00
Adam Doyle
a5e0053bab chore: add name attribute to details element (#4190) 2025-08-03 08:24:54 -04:00
Greg Johnston
6c04a1cd76 fix: only continue navigating to most recent page (closes #4195) (#4198) 2025-08-03 08:24:19 -04:00
Raffaele Fontana
87fb947465 docs: fix typo (#4202) 2025-08-01 11:12:42 -04:00
mskorkowski
5ba818132a feat: add command and commandfor attributes for button (closes #4193) (#4194) 2025-07-31 16:45:38 -04:00
Greg Johnston
30b917cfc3 v0.8.6 2025-07-27 08:59:22 -04:00
Greg Johnston
6cd731cbb1 Merge pull request #4186 from leptos-rs/4184
A few pieces of lazy island clean-up
2025-07-27 08:50:22 -04:00
Greg Johnston
f1b6b79e27 Enhancing members’ versioning (#4172)
* fix: decouple versioning for members

* feat: handy script to bump changed member crates from the last released tag
2025-07-27 08:50:08 -04:00
Greg Johnston
623ee08f82 chore: this does not need to be async 2025-07-27 08:34:59 -04:00
Greg Johnston
877849a5dd chore: new wasm_split version 2025-07-27 08:30:51 -04:00
Greg Johnston
fb59da90c2 fix: support file hashing when using lazy loading (#4182) 2025-07-26 15:46:31 -04:00
Greg Johnston
d33f5c9e77 feat: allow lazy server functions (#4169) 2025-07-24 07:30:05 -04:00
dependabot[bot]
deb8e96eb0 chore(deps): bump redox_syscall in the rust-dependencies group (#4171)
Bumps the rust-dependencies group with 1 update: redox_syscall.


Updates `redox_syscall` from 0.5.14 to 0.5.15

---
updated-dependencies:
- dependency-name: redox_syscall
  dependency-version: 0.5.15
  dependency-type: indirect
  update-type: version-update:semver-patch
  dependency-group: rust-dependencies
...

Signed-off-by: dependabot[bot] <support@github.com>
Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com>
2025-07-22 12:33:31 -04:00
Greg Johnston
181e4d0566 chore: bump wasm-split version numbers (#4170) 2025-07-22 12:31:46 -04:00
Saber Haj Rabiee
525379a9b3 fix(CI): remove autofix CI timeout (#4173) 2025-07-22 12:31:04 -04:00
Saber Haj Rabiee
783a233167 feat: handy script to bump changed member crates from the last released tag 2025-07-21 22:44:40 -07:00
Saber Haj Rabiee
8079956d1b fix: decouple versioning for members 2025-07-21 22:43:58 -07:00
Greg Johnston
f5d3fbb091 0.8.5 2025-07-21 09:04:16 -04:00
Greg Johnston
fbe7cdc482 docs: update documentation for #[lazy] and #[lazy_route] 2025-07-21 08:53:38 -04:00
Greg Johnston
14884bc8ac Merge pull request #3988 from leptos-rs/wasm-splitting-support
feat: wasm-splitting library support for future cargo-leptos integration
2025-07-21 07:17:29 -04:00
Greg Johnston
2c93e1a185 fix: avoid name conflict between lazy route struct type and split view function 2025-07-20 19:59:10 -04:00
Greg Johnston
64b8c3dfd5 fix: use dummy macro output to improve rust-analyzer experience for #[lazy_route] 2025-07-20 19:58:41 -04:00
martin frances
5f2d511553 chore: bump oco_ref version number (#4168) 2025-07-20 18:44:09 -04:00
Greg Johnston
d7cdc6c489 chore: fix Cargo.lock 2025-07-20 13:12:03 -04:00
Greg Johnston
ebb33b6f41 Merge remote-tracking branch 'origin' into wasm-splitting-support 2025-07-20 13:09:26 -04:00
Greg Johnston
809c0b532c chore: cargo update 2025-07-20 13:07:47 -04:00
Greg Johnston
b13f2420fb chore: change name of wasm_split due to namesquatting 2025-07-20 12:54:30 -04:00
Greg Johnston
77de264615 chore: publish wasm_split and wasm_split_macros 2025-07-20 12:54:14 -04:00
Greg Johnston
37cb102d53 fix: wait for preloaded route data as part of route transition 2025-07-19 13:46:30 -04:00
Greg Johnston
897e6ecc26 example: lazy routes in hackernews_axum 2025-07-19 08:53:02 -04:00
Greg Johnston
0c67f7d389 fix: properly support concurrent loading without breaking changes to ChooseView 2025-07-19 08:53:02 -04:00
Greg Johnston
232b603a25 feat: support both sync and async lazy functions 2025-07-19 08:53:02 -04:00
autofix-ci[bot]
10c13bbca2 [autofix.ci] apply automated fixes 2025-07-18 13:01:09 +00:00
Greg Johnston
e545b7c48a chore: remove unnecessary lifetime 2025-07-18 08:31:30 -04:00
Greg Johnston
839eb9ac1c fix: correctly handle preloads when they do or don't exist 2025-07-18 08:30:02 -04:00
Greg Johnston
ae9324e555 fix: use crossorigin rather than nonce for <link rel="modulepreload"> 2025-07-18 08:29:34 -04:00
Greg Johnston
f7c4a664d2 chore(ci): add new wasm-splitting crates to CI 2025-07-17 19:11:11 -04:00
Greg Johnston
d446474456 chore: clippy 2025-07-17 19:10:03 -04:00
Greg Johnston
d7bc6715a6 chore: clippy 2025-07-17 19:09:32 -04:00
Greg Johnston
4c95cddca8 chore: cargo fmt 2025-07-17 14:19:52 -04:00
Greg Johnston
437d61bed7 chore: allow non-snake-case name on LazyRoute::view() 2025-07-17 14:17:14 -04:00
Greg Johnston
3fdbae4314 Merge remote-tracking branch 'origin' into wasm-splitting-support 2025-07-17 14:07:29 -04:00
Greg Johnston
7559b27361 feat: support preloading split WASM files from a manifest 2025-07-17 14:06:20 -04:00
Greg Johnston
b9bb14cfdc chore: clippy 2025-07-17 14:06:05 -04:00
Greg Johnston
c7a319db15 nested concurrent lazy routes 2025-07-17 11:21:05 -04:00
Greg Johnston
0d18da720b fix: rename arguments for lazy routes 2025-07-17 09:27:31 -04:00
Greg Johnston
12f5676bd1 fix/change: proper concurrent data loading for routes 2025-07-17 09:27:18 -04:00
Greg Johnston
0fa8155adc fix: correct async hydration for elements 2025-07-17 09:26:55 -04:00
Greg Johnston
f8fa6de987 preload lazy routes without creating data twice 2025-07-17 08:09:05 -04:00
Greg Johnston
81b37a3867 create a separate preload function for lazy functions 2025-07-17 08:08:56 -04:00
Greg Johnston
efb1e945d9 hydrate lazy islands in correct order 2025-07-17 06:51:51 -04:00
Greg Johnston
17b9bec79a update test results 2025-07-16 18:01:19 -04:00
Greg Johnston
acd69daedb clippy 2025-07-16 17:40:45 -04:00
Greg Johnston
b8a3129396 support hot-reloading on stable 2025-07-16 17:34:05 -04:00
Greg Johnston
783b4c4b04 Merge remote-tracking branch 'origin' into wasm-splitting-support 2025-07-16 17:25:34 -04:00
Greg Johnston
eede2e9e6c unnecessary unsafe that had no safety comment in the POC! 2025-07-16 17:23:42 -04:00
Greg Johnston
31d51ea94f clippy 2025-07-16 17:23:32 -04:00
Greg Johnston
01fbd82edf use more recent nightly in CI 2025-07-16 17:20:34 -04:00
Greg Johnston
b276e703a8 unblock hot reloading on stable now that proc-macro spans are stabilized 2025-07-16 17:20:15 -04:00
Greg Johnston
d2409a22a7 update MSRV to allow deduplicating lazy function names 2025-07-16 17:19:46 -04:00
Greg Johnston
f6cd784088 clippy 2025-07-16 17:18:01 -04:00
Greg Johnston
eb9ebc870f regression tests for #4157 and for https://github.com/leptos-rs/cargo-leptos/issues/546 2025-07-16 07:47:30 -04:00
Greg Johnston
b746c2ac4e feat: deduplicate lazy function names with a hash (closes #4157) 2025-07-16 07:46:40 -04:00
Greg Johnston
4c1e7dc8c1 add README 2025-07-15 20:43:29 -04:00
Greg Johnston
f1fa4635c7 clippy 2025-07-15 09:37:50 -04:00
Greg Johnston
46c8a11eae infrastructure for testing with --split 2025-07-15 09:37:45 -04:00
Greg Johnston
6b72ce3c16 Merge remote-tracking branch 'origin' into wasm-splitting-support 2025-07-15 09:10:50 -04:00
Greg Johnston
299a4c161f clean up dependencies (see #3987) 2025-07-12 14:11:27 -04:00
Greg Johnston
b0ee946412 clean up example 2025-07-12 14:08:00 -04:00
Greg Johnston
b505892568 add lazy-routing example 2025-07-12 14:00:19 -04:00
Greg Johnston
b63cfa7935 support for lazy hydration 2025-07-12 13:22:12 -04:00
Greg Johnston
01a939e1e4 weird 2025-07-11 11:03:49 -04:00
Greg Johnston
995bc60c74 missing import 2025-07-11 11:00:57 -04:00
Greg Johnston
4c4869d33c support custom names for split functions 2025-07-11 10:59:06 -04:00
Greg Johnston
0ca8d32805 fix lazy_route 2025-07-11 10:53:30 -04:00
Greg Johnston
0d853fdb74 re-export lazy route macro 2025-07-11 10:37:18 -04:00
Greg Johnston
853f049d9f Merge remote-tracking branch 'origin' into wasm-splitting-support 2025-07-11 10:37:00 -04:00
autofix-ci[bot]
84136cafa5 [autofix.ci] apply automated fixes 2025-07-10 16:36:07 +00:00
Greg Johnston
bb3f1deb1f Merge remote-tracking branch 'origin' into wasm-splitting-support 2025-07-10 12:15:45 -04:00
Greg Johnston
5d9df592d5 fix: don't assume classList is unchanged when rebuilding a class effect for the first time (#3983 part two) 2025-05-21 21:53:50 -04:00
Greg Johnston
323de496f3 fix: don't use Arc::ptr_eq for string comparison (closes #3983) 2025-05-21 21:53:50 -04:00
Álvaro Mondéjar Rubio
c8df5b75ef fix: forward missing lint attributes passed to #[component] macro (#3989) 2025-05-21 21:53:50 -04:00
Dennis Waldherr
89cbf86595 docs: provide error message if file hashing is enabled but no hash file is present (#3990)
Co-authored-by: Dennis Waldherr <bytekeeper@mailbox.org>
2025-05-21 21:53:50 -04:00
mskorkowski
b78a6655f3 fix: smooshed static segments no longer matches the path #3968 (#3973)
* fix: smooshed static segments no longer matches the path #3968

* [autofix.ci] apply automated fixes

---------

Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com>
2025-05-21 21:53:50 -04:00
Greg Johnston
b5797ffe6a fix: meta tags not properly rendered inside synchronously-available Suspend (closes #3976) (#3991) 2025-05-21 21:53:50 -04:00
Greg Johnston
775e2eabed feat: #[island(lazy)] 2025-05-21 21:53:50 -04:00
autofix-ci[bot]
37405ec778 [autofix.ci] apply automated fixes 2025-05-21 20:32:35 +00:00
Greg Johnston
54890af875 add wasm-split workplace dependencies 2025-05-21 16:12:50 -04:00
Greg Johnston
5479ece865 Merge branch 'main' into wasm-splitting-support 2025-05-17 15:03:28 -04:00
Greg Johnston
f0b7e7445b feat: wasm-splitting library support for future cargo-leptos integration 2025-05-17 15:00:38 -04:00
167 changed files with 5236 additions and 943 deletions

View File

@@ -17,17 +17,10 @@ env:
jobs:
autofix:
runs-on: ubuntu-latest
timeout-minutes: 30
steps:
- uses: actions/checkout@v4
- uses: actions/checkout@v5
- uses: actions-rust-lang/setup-rust-toolchain@v1
with:
{
toolchain: "nightly-2025-07-16",
components: "rustfmt, clippy",
target: "wasm32-unknown-unknown",
rustflags: "",
}
with: {toolchain: "nightly-2025-07-16", components: "rustfmt, clippy", target: "wasm32-unknown-unknown", rustflags: ""}
- name: Install Glib
run: |
sudo apt-get update

View File

@@ -63,6 +63,6 @@ jobs:
sudo apt-get update
sudo apt-get install -y libglib2.0-dev
- name: Checkout
uses: actions/checkout@v4
uses: actions/checkout@v5
- name: Semver Checks
uses: obi1kenobi/cargo-semver-checks-action@v2

View File

@@ -19,12 +19,12 @@ jobs:
matrix: ${{ steps.set-example-changed.outputs.matrix }}
steps:
- name: Checkout
uses: actions/checkout@v4
uses: actions/checkout@v5
with:
fetch-depth: 0
- name: Get example files that changed
id: changed-files
uses: tj-actions/changed-files@v46
uses: tj-actions/changed-files@v47
with:
files: |
examples/**

View File

@@ -17,7 +17,7 @@ jobs:
EXCLUDED_EXAMPLES: cargo-make
steps:
- name: Checkout
uses: actions/checkout@v4
uses: actions/checkout@v5
- name: Install jq
run: sudo apt-get install jq
- name: Set Matrix

View File

@@ -13,12 +13,12 @@ jobs:
leptos_changed: ${{ steps.set-source-changed.outputs.leptos_changed }}
steps:
- name: Checkout
uses: actions/checkout@v4
uses: actions/checkout@v5
with:
fetch-depth: 0
- name: Get source files that changed
id: changed-source
uses: tj-actions/changed-files@v46
uses: tj-actions/changed-files@v47
with:
files_ignore: |
.*/**/*

View File

@@ -13,7 +13,7 @@ jobs:
matrix: ${{ steps.set-matrix.outputs.matrix }}
steps:
- name: Checkout
uses: actions/checkout@v4
uses: actions/checkout@v5
- name: Install jq
run: sudo apt-get install jq
- name: Set Matrix

View File

@@ -12,7 +12,7 @@ jobs:
contents: write # To push a branch
pull-requests: write # To create a PR from that branch
steps:
- uses: actions/checkout@v4
- uses: actions/checkout@v5
with:
fetch-depth: 0
- name: Install mdbook

View File

@@ -53,7 +53,7 @@ jobs:
run: |
sudo apt-get update
sudo apt-get install -y libglib2.0-dev
- uses: actions/checkout@v4
- uses: actions/checkout@v5
- name: Setup Rust
uses: dtolnay/rust-toolchain@master
with:
@@ -88,7 +88,7 @@ jobs:
run: trunk --version
- name: Install Node.js
if: contains(inputs.directory, 'examples')
uses: actions/setup-node@v4
uses: actions/setup-node@v5
with:
node-version: 20
- uses: pnpm/action-setup@v4

1026
Cargo.lock generated

File diff suppressed because it is too large Load Diff

View File

@@ -40,7 +40,6 @@ members = [
exclude = ["benchmarks", "examples", "projects"]
[workspace.package]
version = "0.8.4"
edition = "2021"
rust-version = "1.88"
@@ -51,36 +50,39 @@ any_spawner = { path = "./any_spawner/", version = "0.3.0" }
const_str_slice_concat = { path = "./const_str_slice_concat", version = "0.1" }
either_of = { path = "./either_of/", version = "0.1.6" }
hydration_context = { path = "./hydration_context", version = "0.3.0" }
leptos = { path = "./leptos", version = "0.8.4" }
leptos_config = { path = "./leptos_config", version = "0.8.4" }
leptos_dom = { path = "./leptos_dom", version = "0.8.4" }
leptos_hot_reload = { path = "./leptos_hot_reload", version = "0.8.4" }
leptos_integration_utils = { path = "./integrations/utils", version = "0.8.4" }
leptos_macro = { path = "./leptos_macro", version = "0.8.4" }
leptos_router = { path = "./router", version = "0.8.4" }
leptos_router_macro = { path = "./router_macro", version = "0.8.4" }
leptos_server = { path = "./leptos_server", version = "0.8.4" }
leptos_meta = { path = "./meta", version = "0.8.4" }
leptos = { path = "./leptos", version = "0.8.9" }
leptos_config = { path = "./leptos_config", version = "0.8.7" }
leptos_dom = { path = "./leptos_dom", version = "0.8.6" }
leptos_hot_reload = { path = "./leptos_hot_reload", version = "0.8.5" }
leptos_integration_utils = { path = "./integrations/utils", version = "0.8.5" }
leptos_macro = { path = "./leptos_macro", version = "0.8.8" }
leptos_router = { path = "./router", version = "0.8.7" }
leptos_router_macro = { path = "./router_macro", version = "0.8.5" }
leptos_server = { path = "./leptos_server", version = "0.8.5" }
leptos_meta = { path = "./meta", version = "0.8.5" }
next_tuple = { path = "./next_tuple", version = "0.1.0" }
oco_ref = { path = "./oco", version = "0.2.0" }
oco_ref = { path = "./oco", version = "0.2.1" }
or_poisoned = { path = "./or_poisoned", version = "0.1.0" }
reactive_graph = { path = "./reactive_graph", version = "0.2.4" }
reactive_stores = { path = "./reactive_stores", version = "0.2.4" }
reactive_stores_macro = { path = "./reactive_stores_macro", version = "0.2.4" }
server_fn = { path = "./server_fn", version = "0.8.4" }
server_fn_macro = { path = "./server_fn_macro", version = "0.8.4" }
server_fn_macro_default = { path = "./server_fn/server_fn_macro_default", version = "0.8.4" }
tachys = { path = "./tachys", version = "0.2.5" }
reactive_graph = { path = "./reactive_graph", version = "0.2.7" }
reactive_stores = { path = "./reactive_stores", version = "0.2.5" }
reactive_stores_macro = { path = "./reactive_stores_macro", version = "0.2.6" }
server_fn = { path = "./server_fn", version = "0.8.7" }
server_fn_macro = { path = "./server_fn_macro", version = "0.8.7" }
server_fn_macro_default = { path = "./server_fn/server_fn_macro_default", version = "0.8.5" }
tachys = { path = "./tachys", version = "0.2.8" }
wasm_split_helpers = { path = "./wasm_split", version = "0.1.2" }
wasm_split_macros = { path = "./wasm_split_macros", version = "0.1.3" }
# members deps
async-once-cell = { default-features = false, version = "0.5.3" }
itertools = { default-features = false, version = "0.14.0" }
convert_case = { default-features = false, version = "0.8.0" }
serde_json = { default-features = false, version = "1.0.140" }
trybuild = { default-features = false, version = "1.0.106" }
typed-builder = { default-features = false, version = "0.21.0" }
thiserror = { default-features = false, version = "2.0.12" }
serde_json = { default-features = false, version = "1.0.143" }
trybuild = { default-features = false, version = "1.0.110" }
typed-builder = { default-features = false, version = "0.21.2" }
thiserror = { default-features = false, version = "2.0.16" }
wasm-bindgen = { default-features = false, version = "0.2.100" }
indexmap = { default-features = false, version = "2.9.0" }
indexmap = { default-features = false, version = "2.11.0" }
rstml = { default-features = false, version = "0.12.1" }
rustc_version = { default-features = false, version = "0.4.1" }
guardian = { default-features = false, version = "1.3.0" }
@@ -98,17 +100,17 @@ proc-macro-error2 = { default-features = false, version = "2.0.1" }
const_format = { default-features = false, version = "0.2.34" }
gloo-net = { default-features = false, version = "0.6.0" }
url = { default-features = false, version = "2.5.4" }
tokio = { default-features = false, version = "1.46.1" }
tokio = { default-features = false, version = "1.47.1" }
base64 = { default-features = false, version = "0.22.1" }
cfg-if = { default-features = false, version = "1.0.0" }
cfg-if = { default-features = false, version = "1.0.3" }
wasm-bindgen-futures = { default-features = false, version = "0.4.50" }
tower = { default-features = false, version = "0.5.2" }
proc-macro2 = { default-features = false, version = "1.0.95" }
proc-macro2 = { default-features = false, version = "1.0.101" }
serde = { default-features = false, version = "1.0.219" }
parking_lot = { default-features = false, version = "0.12.4" }
axum = { default-features = false, version = "0.8.4" }
serde_qs = { default-features = false, version = "0.15.0" }
syn = { default-features = false, version = "2.0.104" }
syn = { default-features = false, version = "2.0.106" }
xxhash-rust = { default-features = false, version = "0.8.15" }
paste = { default-features = false, version = "1.0.15" }
quote = { default-features = false, version = "1.0.40" }
@@ -120,51 +122,57 @@ tokio-tungstenite = { default-features = false, version = "0.27.0" }
serial_test = { default-features = false, version = "3.2.0" }
erased = { default-features = false, version = "0.1.2" }
glib = { default-features = false, version = "0.20.12" }
async-trait = { default-features = false, version = "0.1.88" }
async-trait = { default-features = false, version = "0.1.89" }
typed-builder-macro = { default-features = false, version = "0.21.0" }
linear-map = { default-features = false, version = "1.2.0" }
anyhow = { default-features = false, version = "1.0.98" }
anyhow = { default-features = false, version = "1.0.99" }
walkdir = { default-features = false, version = "2.5.0" }
actix-ws = { default-features = false, version = "0.3.0" }
tower-http = { default-features = false, version = "0.6.4" }
prettyplease = { default-features = false, version = "0.2.35" }
inventory = { default-features = false, version = "0.3.20" }
config = { default-features = false, version = "0.15.13" }
camino = { default-features = false, version = "1.1.9" }
prettyplease = { default-features = false, version = "0.2.37" }
inventory = { default-features = false, version = "0.3.21" }
config = { default-features = false, version = "0.15.14" }
camino = { default-features = false, version = "1.1.11" }
ciborium = { default-features = false, version = "0.2.2" }
multer = { default-features = false, version = "3.1.0" }
leptos-spin-macro = { default-features = false, version = "0.2.0" }
sledgehammer_utils = { default-features = false, version = "0.3.1" }
sledgehammer_bindgen = { default-features = false, version = "0.6.0" }
wasm-streams = { default-features = false, version = "0.4.2" }
rkyv = { default-features = false, version = "0.8.10" }
rkyv = { default-features = false, version = "0.8.11" }
temp-env = { default-features = false, version = "0.3.6" }
uuid = { default-features = false, version = "1.17.0" }
uuid = { default-features = false, version = "1.18.0" }
bytes = { default-features = false, version = "1.10.1" }
http = { default-features = false, version = "1.3.1" }
regex = { default-features = false, version = "1.11.1" }
regex = { default-features = false, version = "1.11.2" }
drain_filter_polyfill = { default-features = false, version = "0.1.3" }
tempfile = { default-features = false, version = "3.20.0" }
futures-lite = { default-features = false, version = "2.6.0" }
tempfile = { default-features = false, version = "3.21.0" }
futures-lite = { default-features = false, version = "2.6.1" }
log = { default-features = false, version = "0.4.27" }
percent-encoding = { default-features = false, version = "2.3.1" }
percent-encoding = { default-features = false, version = "2.3.2" }
async-executor = { default-features = false, version = "1.13.2" }
const-str = { default-features = false, version = "0.6.3" }
const-str = { default-features = false, version = "0.6.4" }
http-body-util = { default-features = false, version = "0.1.3" }
hyper = { default-features = false, version = "1.6.0" }
postcard = { default-features = false, version = "1.1.1" }
hyper = { default-features = false, version = "1.7.0" }
postcard = { default-features = false, version = "1.1.3" }
rmp-serde = { default-features = false, version = "1.3.0" }
reqwest = { default-features = false, version = "0.12.22" }
reqwest = { default-features = false, version = "0.12.23" }
tower-layer = { default-features = false, version = "0.3.3" }
attribute-derive = { default-features = false, version = "0.10.3" }
insta = { default-features = false, version = "1.43.1" }
codee = { default-features = false, version = "0.3.0" }
actix-http = { default-features = false, version = "3.11.0" }
actix-http = { default-features = false, version = "3.11.1" }
wasm-bindgen-test = { default-features = false, version = "0.3.50" }
rustversion = { default-features = false, version = "1.0.21" }
rustversion = { default-features = false, version = "1.0.22" }
getrandom = { default-features = false, version = "0.3.3" }
actix-files = { default-features = false, version = "0.6.6" }
async-lock = { default-features = false, version = "3.4.0" }
async-lock = { default-features = false, version = "3.4.1" }
base16 = { default-features = false, version = "0.2.1" }
digest = { default-features = false, version = "0.10.7" }
sha2 = { default-features = false, version = "0.10.8" }
subsecond = { default-features = false, git = "https://github.com/dioxuslabs/dioxus" }
dioxus-cli-config = { default-features = false, git = "https://github.com/dioxuslabs/dioxus" }
dioxus-devtools = { default-features = false, git = "https://github.com/dioxuslabs/dioxus" }
[profile.release]
codegen-units = 1

View File

@@ -95,7 +95,7 @@ Here are some resources for learning more about Leptos:
[`cargo-leptos`](https://github.com/leptos-rs/cargo-leptos) is a build tool that's designed to make it easy to build apps that run on both the client and the server, with seamless integration. The best way to get started with a real Leptos project right now is to use `cargo-leptos` and our starter templates for [Actix](https://github.com/leptos-rs/start) or [Axum](https://github.com/leptos-rs/start-axum).
```bash
cargo install cargo-leptos
cargo install cargo-leptos --locked
cargo leptos new --git https://github.com/leptos-rs/start-axum
cd [your project name]
cargo leptos watch

View File

@@ -0,0 +1,11 @@
extend = [
{ path = "./cargo-leptos.toml" },
{ path = "../cargo-make/webdriver.toml" },
]
[tasks.integration-test]
dependencies = [
"install-cargo-leptos",
"start-webdriver",
"cargo-leptos-e2e-split",
]

View File

@@ -11,6 +11,10 @@ args = ["--locked"]
command = "cargo"
args = ["leptos", "end-to-end"]
[tasks.cargo-leptos-e2e-split]
command = "cargo"
args = ["leptos", "end-to-end", "--split"]
[tasks.build]
clear = true
command = "cargo"

View File

@@ -4,7 +4,7 @@ mod routes;
use leptos_meta::{provide_meta_context, Link, Meta, MetaTags, Stylesheet};
use leptos_router::{
components::{FlatRoutes, Route, Router, RoutingProgress},
OptionalParamSegment, ParamSegment, StaticSegment,
Lazy, OptionalParamSegment, ParamSegment, StaticSegment,
};
use routes::{nav::*, stories::*, story::*, users::*};
use std::time::Duration;
@@ -44,8 +44,8 @@ pub fn App() -> impl IntoView {
<Nav />
<main>
<FlatRoutes fallback=|| "Not found.">
<Route path=(StaticSegment("users"), ParamSegment("id")) view=User/>
<Route path=(StaticSegment("stories"), ParamSegment("id")) view=Story/>
<Route path=(StaticSegment("users"), ParamSegment("id")) view={Lazy::<UserRoute>::new()}/>
<Route path=(StaticSegment("stories"), ParamSegment("id")) view={Lazy::<StoryRoute>::new()}/>
<Route path=OptionalParamSegment("stories") view=Stories/>
</FlatRoutes>
</main>

View File

@@ -1,24 +1,38 @@
use crate::api;
use crate::api::{self, Story};
use leptos::{either::Either, prelude::*};
use leptos_meta::Meta;
use leptos_router::{components::A, hooks::use_params_map};
use leptos_router::{
components::A, hooks::use_params_map, lazy_route, LazyRoute,
};
#[component]
pub fn Story() -> impl IntoView {
let params = use_params_map();
let story = Resource::new_blocking(
move || params.read().get("id").unwrap_or_default(),
move |id| async move {
if id.is_empty() {
None
} else {
api::fetch_api::<api::Story>(&api::story(&format!("item/{id}")))
#[derive(Debug)]
pub struct StoryRoute {
story: Resource<Option<Story>>,
}
#[lazy_route]
impl LazyRoute for StoryRoute {
fn data() -> Self {
let params = use_params_map();
let story = Resource::new_blocking(
move || params.read().get("id").unwrap_or_default(),
move |id| async move {
if id.is_empty() {
None
} else {
api::fetch_api::<api::Story>(&api::story(&format!(
"item/{id}"
)))
.await
}
},
);
}
},
);
Self { story }
}
Suspense(SuspenseProps::builder().fallback(|| "Loading...").children(ToChildren::to_children(move || Suspend::new(async move {
fn view(this: Self) -> AnyView {
let StoryRoute { story } = this;
Suspense(SuspenseProps::builder().fallback(|| "Loading...").children(ToChildren::to_children(move || Suspend::new(async move {
match story.await.clone() {
None => Either::Left("Story not found."),
Some(story) => {
@@ -61,7 +75,8 @@ pub fn Story() -> impl IntoView {
})
}
}
}))).build())
}))).build()).into_any()
}
}
#[component]

View File

@@ -1,46 +1,58 @@
use crate::api::{self, User};
use leptos::{either::Either, prelude::*, server::Resource};
use leptos_router::hooks::use_params_map;
use leptos_router::{hooks::use_params_map, lazy_route, LazyRoute};
#[component]
pub fn User() -> impl IntoView {
let params = use_params_map();
let user = Resource::new(
move || params.read().get("id").unwrap_or_default(),
move |id| async move {
if id.is_empty() {
None
} else {
api::fetch_api::<User>(&api::user(&id)).await
}
},
);
view! {
<div class="user-view">
<Suspense fallback=|| view! { "Loading..." }>
{move || Suspend::new(async move { match user.await.clone() {
None => Either::Left(view! { <h1>"User not found."</h1> }),
Some(user) => Either::Right(view! {
<div>
<h1>"User: " {user.id.clone()}</h1>
<ul class="meta">
<li>
<span class="label">"Created: "</span> {user.created}
</li>
<li>
<span class="label">"Karma: "</span> {user.karma}
</li>
<li inner_html={user.about} class="about"></li>
</ul>
<p class="links">
<a href=format!("https://news.ycombinator.com/submitted?id={}", user.id)>"submissions"</a>
" | "
<a href=format!("https://news.ycombinator.com/threads?id={}", user.id)>"comments"</a>
</p>
</div>
})
}})}
</Suspense>
</div>
#[derive(Debug)]
pub struct UserRoute {
user: Resource<Option<User>>,
}
#[lazy_route]
impl LazyRoute for UserRoute {
fn data() -> Self {
let params = use_params_map();
let user = Resource::new(
move || params.read().get("id").unwrap_or_default(),
move |id| async move {
if id.is_empty() {
None
} else {
api::fetch_api::<User>(&api::user(&id)).await
}
},
);
UserRoute { user }
}
fn view(this: Self) -> AnyView {
let UserRoute { user } = this;
view! {
<div class="user-view">
<Suspense fallback=|| view! { "Loading..." }>
{move || Suspend::new(async move { match user.await.clone() {
None => Either::Left(view! { <h1>"User not found."</h1> }),
Some(user) => Either::Right(view! {
<div>
<h1>"User: " {user.id.clone()}</h1>
<ul class="meta">
<li>
<span class="label">"Created: "</span> {user.created}
</li>
<li>
<span class="label">"Karma: "</span> {user.karma}
</li>
<li inner_html={user.about} class="about"></li>
</ul>
<p class="links">
<a href=format!("https://news.ycombinator.com/submitted?id={}", user.id)>"submissions"</a>
" | "
<a href=format!("https://news.ycombinator.com/threads?id={}", user.id)>"comments"</a>
</p>
</div>
})
}})}
</Suspense>
</div>
}.into_any()
}
}

View File

@@ -0,0 +1,95 @@
[package]
name = "lazy_routes"
version = "0.1.0"
edition = "2021"
[lib]
crate-type = ["cdylib", "rlib"]
[dependencies]
axum = { version = "0.8.1", optional = true }
console_error_panic_hook = "0.1.7"
console_log = "1.0"
leptos = { path = "../../leptos", features = ["tracing"] }
leptos_meta = { path = "../../meta" }
leptos_axum = { path = "../../integrations/axum", optional = true }
leptos_router = { path = "../../router" }
serde = { version = "1.0", features = ["derive"] }
thiserror = "1.0"
tokio = { version = "1.39", features = [
"rt-multi-thread",
"macros",
"time",
], optional = true }
wasm-bindgen = "0.2.92"
futures = "0.3.31"
serde_json = "1.0.140"
gloo-timers = { version = "0.3", features = ["futures"] }
[features]
hydrate = ["leptos/hydrate"]
ssr = [
"dep:axum",
"dep:tokio",
"leptos/ssr",
"leptos_meta/ssr",
"dep:leptos_axum",
"leptos_router/ssr",
]
[profile.release]
panic = "abort"
[profile.wasm-release]
inherits = "release"
opt-level = 'z'
lto = true
codegen-units = 1
panic = "abort"
[package.metadata.cargo-all-features]
denylist = ["axum", "tower", "tower-http", "tokio", "sqlx", "leptos_axum"]
skip_feature_sets = [["ssr", "hydrate"]]
[package.metadata.leptos]
# The name used by wasm-bindgen/cargo-leptos for the JS/WASM bundle. Defaults to the crate name
output-name = "regression"
# The site root folder is where cargo-leptos generate all output. WARNING: all content of this folder will be erased on a rebuild. Use it in your server setup.
site-root = "target/site"
# The site-root relative folder where all compiled output (JS, WASM and CSS) is written
# Defaults to pkg
site-pkg-dir = "pkg"
# The IP and port (ex: 127.0.0.1:3000) where the server serves the content. Use it in your server setup.
site-addr = "127.0.0.1:3000"
# The port to use for automatic reload monitoring
reload-port = 3001
# [Optional] Command to use when running end2end tests. It will run in the end2end dir.
# [Windows] for non-WSL use "npx.cmd playwright test"
# This binary name can be checked in Powershell with Get-Command npx
end2end-cmd = "cargo make test-ui"
end2end-dir = "e2e"
# The browserlist query used for optimizing the CSS.
browserquery = "defaults"
# Set by cargo-leptos watch when building with that tool. Controls whether autoreload JS will be included in the head
watch = false
# The environment Leptos will run in, usually either "DEV" or "PROD"
env = "DEV"
# The features to use when compiling the bin target
#
# Optional. Can be over-ridden with the command line parameter --bin-features
bin-features = ["ssr"]
# If the --no-default-features flag should be used when compiling the bin target
#
# Optional. Defaults to false.
bin-default-features = false
# The features to use when compiling the lib target
#
# Optional. Can be over-ridden with the command line parameter --lib-features
lib-features = ["hydrate"]
# If the --no-default-features flag should be used when compiling the lib target
#
# Optional. Defaults to false.
lib-default-features = false

View File

@@ -0,0 +1,21 @@
MIT License
Copyright (c) 2025 Leptos
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in all
copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
SOFTWARE.

View File

@@ -0,0 +1,8 @@
extend = [
{ path = "../cargo-make/main.toml" },
{ path = "../cargo-make/cargo-leptos-split-webdriver-test.toml" },
]
[env]
CLIENT_PROCESS_NAME = "regression"

View File

@@ -0,0 +1,8 @@
# Regression Tests
This example functions as a catch-all for all current and future regression
test cases that typically happens at integration.
## Quick Start
Run `cargo leptos watch` to run this example.

Binary file not shown.

After

Width:  |  Height:  |  Size: 15 KiB

View File

@@ -0,0 +1,18 @@
[package]
name = "lazy_routes_e2e"
version = "0.1.0"
edition = "2021"
[dev-dependencies]
anyhow = "1.0"
async-trait = "0.1.81"
cucumber = "0.21.1"
fantoccini = "0.21.1"
pretty_assertions = "1.4"
serde_json = "1.0"
tokio = { version = "1.39", features = ["macros", "rt-multi-thread", "time"] }
url = "2.5"
[[test]]
name = "app_suite"
harness = false # Allow Cucumber to print output instead of libtest

View File

@@ -0,0 +1,20 @@
extend = { path = "../../cargo-make/main.toml" }
[tasks.test]
env = { RUN_AUTOMATICALLY = false }
condition = { env_true = ["RUN_AUTOMATICALLY"] }
[tasks.ci]
[tasks.test-ui]
command = "cargo"
args = [
"test",
"--test",
"app_suite",
"--",
"--retry",
"2",
"--fail-fast",
"${@}",
]

View File

@@ -0,0 +1,30 @@
# Lazy Routes
This example demonstrates how to split the WASM bundle that is sent to the client into multiple binaries, which can be lazy-loaded, either independently or in a way that's integrated into the router.
Without code splitting, the entire application is compiled to a monolithic WASM binary, the size of which grows in proportion to the complexity of the application. This means that the time to interactive (TTI) for any page is proportional to the size of the entire application, not only that page.
Code splitting allows you to lazy-load some functions, by splitting off the WASM binary code for certain functions into separate files, which can be downloaded as needed. This minimizes initial TTI for any page, and then amortizes the cost of loading the binary over the lifetime of the application session.
In many cases, this can be done with minimal or no cost.
Lazy loading can be used in two ways, each of which is shown in the example.
## `#[lazy]` macro
`#[lazy]` is an attribute macro that can be used to annotate an `async fn` in order to split its code out into a separate file that will be loaded on demand, when compiled with `cargo leptos --split`.
This has some limitations (for example, it must return concrete types) but can be used for most functions.
## `LazyRoute`
`LazyRoute` is a specialized application of `#[lazy]` that allows you to define an entire route/page of your application as being lazy-loaded.
Creating a lazy route requires you to split the route into two parts:
1. `data()`: A synchronous method that should be used to start loading any async data used by the page, for example by creating a `Resource`
2. `view()`: An async (because lazy-loaded) method that renders the view.
The purpose of splitting these into two parts is to avoid a “waterfall,” in which the browser first waits for a lazy-loaded WASM chunk that defines the page, _then_ makes a second request to the server to load the relevant data. Instead, a `LazyRoute` will begin loading resources created in the `data` method while lazy-loading the component body in the `view`, then render the route.
This means that in many cases, the data loading “hides” the cost of the lazy-loading; i.e., the page needs to wait for the data to load, so the fact that it is waiting concurrently for the lazy-loaded view means that the lazy loading does not cost anything additional in terms of page load time.

View File

@@ -0,0 +1,33 @@
@basic
Feature: Check that each page hydrates correctly
Scenario: Page A is rendered correctly.
Given I see the app
Then I see the page is View A
Scenario: Page A hydrates and allows navigating to page B.
Given I see the app
When I select the link B
Then I see the navigating indicator
When I wait for a second
Then I see the page is View B
Scenario: Page B is rendered correctly.
When I open the app at /b
Then I see the page is View B
Scenario: Page B hydrates and allows navigating to page C.
When I open the app at /b
When I select the link C
Then I see the navigating indicator
When I wait for a second
Then I see the page is View C
Scenario: Page C is rendered correctly.
When I open the app at /c
Then I see the page is View C
Scenario: Page C hydrates and allows navigating to page A.
When I open the app at /c
When I select the link A
Then I see the page is View A

View File

@@ -0,0 +1,15 @@
@duplicate_names
Feature: Lazy functions can share the same name
Scenario: Two functions with the same name both work.
Given I see the app
Then I see the page is View A
When I click the button First
When I wait for a second
Then I see the result is {"a":"First Value","b":1}
When I click the button Second
When I wait for a second
Then I see the result is {"a":"Second Value","b":2}
When I click the button Third
When I wait for a second
Then I see the result is Third value.

View File

@@ -0,0 +1,9 @@
@shared_chunks
Feature: Shared code splitting works correctly
Scenario: Two functions using same serde code both work.
Given I see the app
Then I see the page is View A
When I click the button First
When I wait for a second
Then I see the result is {"a":"First Value","b":1}

View File

@@ -0,0 +1,30 @@
mod fixtures;
use anyhow::Result;
use cucumber::World;
use fixtures::world::AppWorld;
use std::{ffi::OsStr, fs::read_dir};
#[tokio::main]
async fn main() -> Result<()> {
// Normally the below is done, but it's now gotten to the point of
// having a sufficient number of tests where the resource contention
// of the concurrently running browsers will cause failures on CI.
// AppWorld::cucumber()
// .fail_on_skipped()
// .run_and_exit("./features")
// .await;
// Mitigate the issue by manually stepping through each feature,
// rather than letting cucumber glob them and dispatch all at once.
for entry in read_dir("./features")? {
let path = entry?.path();
if path.extension() == Some(OsStr::new("feature")) {
AppWorld::cucumber()
.fail_on_skipped()
.run_and_exit(path)
.await;
}
}
Ok(())
}

View File

@@ -0,0 +1,23 @@
use super::{find, world::HOST};
use anyhow::Result;
use fantoccini::Client;
use std::result::Result::Ok;
pub async fn goto_path(client: &Client, path: &str) -> Result<()> {
let url = format!("{}{}", HOST, path);
client.goto(&url).await?;
Ok(())
}
pub async fn click_link(client: &Client, text: &str) -> Result<()> {
let link = find::link_with_text(&client, &text).await?;
link.click().await?;
Ok(())
}
pub async fn click_button(client: &Client, id: &str) -> Result<()> {
let btn = find::element_by_id(&client, &id).await?;
btn.click().await?;
Ok(())
}

View File

@@ -0,0 +1,29 @@
use crate::fixtures::find;
use anyhow::{Ok, Result};
use fantoccini::Client;
use pretty_assertions::assert_eq;
pub async fn page_name_is(client: &Client, expected_text: &str) -> Result<()> {
let actual = find::text_at_id(client, "page").await?;
assert_eq!(&actual, expected_text);
Ok(())
}
pub async fn result_is(client: &Client, expected_text: &str) -> Result<()> {
let actual = find::text_at_id(client, "result").await?;
assert_eq!(&actual, expected_text);
Ok(())
}
pub async fn navigating_appears(client: &Client) -> Result<()> {
let actual = find::text_at_id(client, "navigating").await?;
assert_eq!(&actual, "Navigating...");
Ok(())
}
pub async fn element_exists(client: &Client, id: &str) -> Result<()> {
find::element_by_id(client, id)
.await
.expect(&format!("could not find element with id `{id}`"));
Ok(())
}

View File

@@ -0,0 +1,23 @@
use anyhow::{Ok, Result};
use fantoccini::{elements::Element, Client, Locator};
pub async fn text_at_id(client: &Client, id: &str) -> Result<String> {
let element = element_by_id(client, id)
.await
.expect(format!("no such element with id `{}`", id).as_str());
let text = element.text().await?;
Ok(text)
}
pub async fn link_with_text(client: &Client, text: &str) -> Result<Element> {
let link = client
.wait()
.for_element(Locator::LinkText(text))
.await
.expect(format!("Link not found by `{}`", text).as_str());
Ok(link)
}
pub async fn element_by_id(client: &Client, id: &str) -> Result<Element> {
Ok(client.wait().for_element(Locator::Id(id)).await?)
}

View File

@@ -0,0 +1,4 @@
pub mod action;
pub mod check;
pub mod find;
pub mod world;

View File

@@ -0,0 +1,68 @@
use crate::fixtures::{action, world::AppWorld};
use anyhow::{Ok, Result};
use cucumber::{gherkin::Step, given, when};
#[given("I see the app")]
#[when("I open the app")]
async fn i_open_the_app(world: &mut AppWorld) -> Result<()> {
let client = &world.client;
action::goto_path(client, "").await?;
Ok(())
}
#[when(regex = "^I open the app at (.*)$")]
async fn i_open_the_app_at(world: &mut AppWorld, url: String) -> Result<()> {
let client = &world.client;
action::goto_path(client, &url).await?;
Ok(())
}
#[when(regex = "^I select the link (.*)$")]
async fn i_select_the_link(world: &mut AppWorld, text: String) -> Result<()> {
let client = &world.client;
action::click_link(client, &text).await?;
Ok(())
}
#[when(regex = "^I click the button (.*)$")]
async fn i_click_the_button(world: &mut AppWorld, id: String) -> Result<()> {
let client = &world.client;
action::click_button(client, &id).await?;
Ok(())
}
#[when(expr = "I select the following links")]
async fn i_select_the_following_links(
world: &mut AppWorld,
step: &Step,
) -> Result<()> {
let client = &world.client;
if let Some(table) = step.table.as_ref() {
for row in table.rows.iter() {
action::click_link(client, &row[0]).await?;
}
}
Ok(())
}
#[when("I wait for a second")]
async fn i_wait_for_a_second(world: &mut AppWorld) -> Result<()> {
tokio::time::sleep(std::time::Duration::from_secs(1)).await;
Ok(())
}
#[given(regex = "^I (refresh|reload) the (browser|page)$")]
#[when(regex = "^I (refresh|reload) the (browser|page)$")]
async fn i_refresh_the_browser(world: &mut AppWorld) -> Result<()> {
let client = &world.client;
client.refresh().await?;
Ok(())
}

View File

@@ -0,0 +1,31 @@
use crate::fixtures::{check, world::AppWorld};
use anyhow::{Ok, Result};
use cucumber::then;
#[then(regex = r"^I see the navigating indicator")]
async fn i_see_the_nav(world: &mut AppWorld) -> Result<()> {
let client = &world.client;
check::navigating_appears(client).await?;
Ok(())
}
#[then(regex = r"^I see the page is (.*)$")]
async fn i_see_the_page_is(world: &mut AppWorld, text: String) -> Result<()> {
let client = &world.client;
check::page_name_is(client, &text).await?;
Ok(())
}
#[then(regex = r"^I see the result is (.*)$")]
async fn i_see_the_result_is(world: &mut AppWorld, text: String) -> Result<()> {
let client = &world.client;
check::result_is(client, &text).await?;
Ok(())
}
#[then(regex = r"^I see the navbar$")]
async fn i_see_the_navbar(world: &mut AppWorld) -> Result<()> {
let client = &world.client;
check::element_exists(client, "nav").await?;
Ok(())
}

View File

@@ -0,0 +1,39 @@
pub mod action_steps;
pub mod check_steps;
use anyhow::Result;
use cucumber::World;
use fantoccini::{
error::NewSessionError, wd::Capabilities, Client, ClientBuilder,
};
pub const HOST: &str = "http://127.0.0.1:3000";
#[derive(Debug, World)]
#[world(init = Self::new)]
pub struct AppWorld {
pub client: Client,
}
impl AppWorld {
async fn new() -> Result<Self, anyhow::Error> {
let webdriver_client = build_client().await?;
Ok(Self {
client: webdriver_client,
})
}
}
async fn build_client() -> Result<Client, NewSessionError> {
let mut cap = Capabilities::new();
let arg = serde_json::from_str("{\"args\": [\"-headless\"]}").unwrap();
cap.insert("goog:chromeOptions".to_string(), arg);
let client = ClientBuilder::native()
.capabilities(cap)
.connect("http://localhost:4444")
.await?;
Ok(client)
}

View File

@@ -0,0 +1,355 @@
use leptos::{prelude::*, task::spawn_local};
use leptos_router::{
components::{Outlet, ParentRoute, Route, Router, Routes},
lazy_route, Lazy, LazyRoute, StaticSegment,
};
use serde::{Deserialize, Serialize};
pub fn shell(options: LeptosOptions) -> impl IntoView {
view! {
<!DOCTYPE html>
<html lang="en">
<head>
<meta charset="utf-8"/>
<meta name="viewport" content="width=device-width, initial-scale=1"/>
<AutoReload options=options.clone()/>
<HydrationScripts options/>
</head>
<body>
<App/>
</body>
</html>
}
}
#[component]
pub fn App() -> impl IntoView {
let count = RwSignal::new(0);
provide_context(count);
let (is_routing, set_is_routing) = signal(false);
view! {
<nav id="nav" style="width: 100%">
<a href="/">"A"</a> " | "
<a href="/b">"B"</a> " | "
<a href="/c">"C"</a> " | "
<a href="/d">"D"</a>
<span style="float: right" id="navigating">
{move || is_routing.get().then_some("Navigating...")}
</span>
</nav>
<Router set_is_routing>
<Routes fallback=|| "Not found.">
<Route path=StaticSegment("") view=ViewA/>
<Route path=StaticSegment("b") view=ViewB/>
<Route path=StaticSegment("c") view={Lazy::<ViewC>::new()}/>
// you can nest lazy routes, and there data and views will all load concurrently
<ParentRoute path=StaticSegment("d") view={Lazy::<ViewD>::new()}>
<Route path=StaticSegment("") view={Lazy::<ViewE>::new()}/>
</ParentRoute>
</Routes>
</Router>
}
}
// View A: A plain old synchronous route, just like they all currently work. The WASM binary code
// for this is shipped as part of the main bundle. Any data-loading code (like resources that run
// in the body of the component) will be shipped as part of the main bundle.
#[component]
pub fn ViewA() -> impl IntoView {
leptos::logging::log!("View A");
let result = RwSignal::new("Click a button to see the result".to_string());
view! {
<p id="page">"View A"</p>
<pre id="result">{result}</pre>
<button id="First" on:click=move |_| spawn_local(async move { result.set(first_value().await); })>"First"</button>
<button id="Second" on:click=move |_| spawn_local(async move { result.set(second_value().await); })>"Second"</button>
// test to make sure duplicate names in different scopes can be used
<button id="Third" on:click=move |_| {
#[lazy]
pub fn second_value() -> String {
"Third value.".to_string()
}
spawn_local(async move {
result.set(second_value().await);
});
}>"Third"</button>
}
}
// View B: lazy-loaded route with lazy-loaded data
#[derive(Debug, Clone, Deserialize)]
pub struct Comment {
#[serde(rename = "postId")]
post_id: usize,
id: usize,
name: String,
email: String,
body: String,
}
#[lazy]
fn deserialize_comments(data: &str) -> Vec<Comment> {
serde_json::from_str(data).unwrap()
}
#[component]
pub fn ViewB() -> impl IntoView {
let data = LocalResource::new(|| async move {
let preload = deserialize_comments("[]");
let (_, data) = futures::future::join(preload, async {
gloo_timers::future::TimeoutFuture::new(500).await;
r#"
[
{
"postId": 1,
"id": 1,
"name": "id labore ex et quam laborum",
"email": "Eliseo@gardner.biz",
"body": "laudantium enim quasi est quidem magnam voluptate ipsam eos\ntempora quo necessitatibus\ndolor quam autem quasi\nreiciendis et nam sapiente accusantium"
},
{
"postId": 1,
"id": 2,
"name": "quo vero reiciendis velit similique earum",
"email": "Jayne_Kuhic@sydney.com",
"body": "est natus enim nihil est dolore omnis voluptatem numquam\net omnis occaecati quod ullam at\nvoluptatem error expedita pariatur\nnihil sint nostrum voluptatem reiciendis et"
},
{
"postId": 1,
"id": 3,
"name": "odio adipisci rerum aut animi",
"email": "Nikita@garfield.biz",
"body": "quia molestiae reprehenderit quasi aspernatur\naut expedita occaecati aliquam eveniet laudantium\nomnis quibusdam delectus saepe quia accusamus maiores nam est\ncum et ducimus et vero voluptates excepturi deleniti ratione"
}
]
"#
})
.await;
deserialize_comments(data).await
});
view! {
<p id="page">"View B"</p>
<Suspense fallback=|| view! { <p id="loading">"Loading..."</p> }>
<ul>
{move || Suspend::new(async move {
let items = data.await;
items.into_iter()
.map(|comment| view! {
<li id=format!("{}-{}", comment.post_id, comment.id)>
<strong>{comment.name}</strong> " (by " {comment.email} ")"<br/>
{comment.body}
</li>
})
.collect_view()
})}
</ul>
</Suspense>
}
.into_any()
}
#[derive(Debug, Clone, Deserialize)]
pub struct Album {
#[serde(rename = "userId")]
user_id: usize,
id: usize,
title: String,
}
// View C: a lazy view, and some data, loaded in parallel when we navigate to /c.
#[derive(Clone)]
pub struct ViewC {
data: LocalResource<Vec<Album>>,
}
// Lazy-loaded routes need to implement the LazyRoute trait. They define a "route data" struct,
// which is created with `::data()`, and then a separate view function which is lazily loaded.
//
// This is important because it allows us to concurrently 1) load the route data, and 2) lazily
// load the component, rather than creating a "waterfall" where we can't start loading the route
// data until we've received the view.
//
// The `#[lazy_route]` macro makes `view` into a lazy-loaded inner function, replacing `self` with
// `this`.
#[lazy_route]
impl LazyRoute for ViewC {
fn data() -> Self {
// the data method itself is synchronous: it typically creates things like Resources,
// which are created synchronously but spawn an async data-loading task
// if you want further code-splitting, however, you can create a lazy function to load the data!
#[lazy]
async fn lazy_data() -> Vec<Album> {
gloo_timers::future::TimeoutFuture::new(250).await;
vec![
Album {
user_id: 1,
id: 1,
title: "quidem molestiae enim".into(),
},
Album {
user_id: 1,
id: 2,
title: "sunt qui excepturi placeat culpa".into(),
},
Album {
user_id: 1,
id: 3,
title: "omnis laborum odio".into(),
},
]
}
Self {
data: LocalResource::new(lazy_data),
}
}
fn view(this: Self) -> AnyView {
let albums = move || {
Suspend::new(async move {
this.data
.await
.into_iter()
.map(|album| {
view! {
<li id=format!("{}-{}", album.user_id, album.id)>
{album.title}
</li>
}
})
.collect::<Vec<_>>()
})
};
view! {
<p id="page">"View C"</p>
<hr/>
<Suspense fallback=|| view! { <p id="loading">"Loading..."</p> }>
<ul>{albums}</ul>
</Suspense>
}
.into_any()
}
}
// When two functions have shared code, that shared code will be split out automatically
// into an additional file. For example, the shared serde code here will be split into a single file,
// and then loaded lazily once when the first of the two functions is called
#[lazy]
pub fn first_value() -> String {
#[derive(Serialize)]
struct FirstValue {
a: String,
b: i32,
}
serde_json::to_string(&FirstValue {
a: "First Value".into(),
b: 1,
})
.unwrap()
}
#[lazy]
pub fn second_value() -> String {
#[derive(Serialize)]
struct SecondValue {
a: String,
b: i32,
}
serde_json::to_string(&SecondValue {
a: "Second Value".into(),
b: 2,
})
.unwrap()
}
struct ViewD {
data: Resource<Result<Vec<i32>, ServerFnError>>,
}
#[lazy_route]
impl LazyRoute for ViewD {
fn data() -> Self {
Self {
data: Resource::new(|| (), |_| d_data()),
}
}
fn view(this: Self) -> AnyView {
let items = move || {
Suspend::new(async move {
this.data
.await
.unwrap_or_default()
.into_iter()
.map(|item| view! { <li>{item}</li> })
.collect::<Vec<_>>()
})
};
view! {
<p id="page">"View D"</p>
<hr/>
<Suspense fallback=|| view! { <p id="loading">"Loading..."</p> }>
<ul>{items}</ul>
</Suspense>
<Outlet/>
}
.into_any()
}
}
// Server functions can be made lazy by combining the two macros,
// with `#[server]` coming first, then `#[lazy]`
#[server]
#[lazy]
async fn d_data() -> Result<Vec<i32>, ServerFnError> {
tokio::time::sleep(std::time::Duration::from_millis(250)).await;
Ok(vec![1, 1, 2, 3, 5, 8, 13])
}
struct ViewE {
data: Resource<Result<Vec<String>, ServerFnError>>,
}
#[lazy_route]
impl LazyRoute for ViewE {
fn data() -> Self {
Self {
data: Resource::new(|| (), |_| e_data()),
}
}
fn view(this: Self) -> AnyView {
let items = move || {
Suspend::new(async move {
this.data
.await
.unwrap_or_default()
.into_iter()
.map(|item| view! { <li>{item}</li> })
.collect::<Vec<_>>()
})
};
view! {
<p id="page">"View E"</p>
<hr/>
<Suspense fallback=|| view! { <p id="loading">"Loading..."</p> }>
<ul>{items}</ul>
</Suspense>
}
.into_any()
}
}
#[server]
async fn e_data() -> Result<Vec<String>, ServerFnError> {
tokio::time::sleep(std::time::Duration::from_millis(250)).await;
Ok(vec!["foo".into(), "bar".into(), "baz".into()])
}

View File

@@ -0,0 +1,9 @@
pub mod app;
#[cfg(feature = "hydrate")]
#[wasm_bindgen::prelude::wasm_bindgen]
pub fn hydrate() {
use app::*;
console_error_panic_hook::set_once();
leptos::mount::hydrate_lazy(App);
}

View File

@@ -0,0 +1,37 @@
#[cfg(feature = "ssr")]
#[tokio::main]
async fn main() {
use axum::Router;
use lazy_routes::app::{shell, App};
use leptos::prelude::*;
use leptos_axum::{generate_route_list, LeptosRoutes};
let conf = get_configuration(None).unwrap();
let addr = conf.leptos_options.site_addr;
let leptos_options = conf.leptos_options;
// Generate the list of routes in your Leptos App
let routes = generate_route_list(App);
let app = Router::new()
.leptos_routes(&leptos_options, routes, {
let leptos_options = leptos_options.clone();
move || shell(leptos_options.clone())
})
.fallback(leptos_axum::file_and_error_handler(shell))
.with_state(leptos_options);
// run our app with hyper
// `axum::Server` is a re-export of `hyper::Server`
println!("listening on http://{}", &addr);
let listener = tokio::net::TcpListener::bind(&addr).await.unwrap();
axum::serve(listener, app.into_make_service())
.await
.unwrap();
}
#[cfg(not(feature = "ssr"))]
pub fn main() {
// no client-side main function
// unless we want this to work with e.g., Trunk for pure client-side testing
// see lib.rs for hydration function instead
}

View File

@@ -0,0 +1,3 @@
body {
font-family: sans-serif;
}

View File

@@ -0,0 +1,7 @@
@check_issue_4005
Feature: Check that issue 4005 does not reappear
Scenario: The second item is selected.
Given I see the app
And I can access regression test 4005
Then I see the value of select is 2

View File

@@ -0,0 +1,9 @@
@check_issue_4217
Feature: Check that issue 4217 does not reappear
Scenario: All items are selected.
Given I see the app
And I can access regression test 4217
Then I see option1 is selected
And I see option2 is selected
And I see option3 is selected

View File

@@ -0,0 +1,9 @@
@check_issue_4285
Feature: Check that issue 4285 does not reappear
Scenario: Navigating several times to same lazy route does not cause issues.
Given I see the app
And I can access regression test 4285
And I can access regression test 4285
And I can access regression test 4285
Then I see the result is the string 42

View File

@@ -0,0 +1,18 @@
@check_issue_4296
Feature: Check that issue 4296 does not reappear
Scenario: Query param signals created in LazyRoute::data() are reactive in ::view().
Given I see the app
And I can access regression test 4296
Then I see the result is the string None
When I select the link abc
Then I see the result is the string Some("abc")
When I select the link def
Then I see the result is the string Some("def")
Scenario: Loading page with query signal works as well.
Given I see the app
And I can access regression test 4296
When I select the link abc
When I reload the page
Then I see the result is the string Some("abc")

View File

@@ -18,3 +18,28 @@ pub async fn element_exists(client: &Client, id: &str) -> Result<()> {
.expect(&format!("could not find element with id `{id}`"));
Ok(())
}
pub async fn select_option_is_selected(
client: &Client,
id: &str,
) -> Result<()> {
let el = find::element_by_id(client, id)
.await
.expect(&format!("could not find element with id `{id}`"));
let selected = el.prop("selected").await?;
assert_eq!(selected.as_deref(), Some("true"));
Ok(())
}
pub async fn element_value_is(
client: &Client,
id: &str,
expected: &str,
) -> Result<()> {
let el = find::element_by_id(client, id)
.await
.expect(&format!("could not find element with id `{id}`"));
let value = el.prop("value").await?;
assert_eq!(value.as_deref(), Some(expected));
Ok(())
}

View File

@@ -25,3 +25,21 @@ async fn i_see_the_navbar(world: &mut AppWorld) -> Result<()> {
check::element_exists(client, "nav").await?;
Ok(())
}
#[then(regex = r"^I see ([\d\w]+) is selected$")]
async fn i_see_the_select(world: &mut AppWorld, id: String) -> Result<()> {
let client = &world.client;
check::select_option_is_selected(client, &id).await?;
Ok(())
}
#[then(regex = r"^I see the value of (\w+) is (.*)$")]
async fn i_see_the_value(
world: &mut AppWorld,
id: String,
value: String,
) -> Result<()> {
let client = &world.client;
check::element_value_is(client, &id, &value).await?;
Ok(())
}

View File

@@ -1,4 +1,8 @@
use crate::{issue_4088::Routes4088, pr_4015::Routes4015, pr_4091::Routes4091};
use crate::{
issue_4005::Routes4005, issue_4088::Routes4088, issue_4217::Routes4217,
issue_4285::Routes4285, issue_4296::Routes4296, pr_4015::Routes4015,
pr_4091::Routes4091,
};
use leptos::prelude::*;
use leptos_meta::{MetaTags, *};
use leptos_router::{
@@ -28,15 +32,21 @@ pub fn shell(options: LeptosOptions) -> impl IntoView {
pub fn App() -> impl IntoView {
provide_meta_context();
let fallback = || view! { "Page not found." }.into_view();
let (_, set_is_routing) = signal(false);
view! {
<Stylesheet id="leptos" href="/pkg/regression.css"/>
<Router>
<Router set_is_routing>
<main>
<Routes fallback>
<Route path=path!("") view=HomePage/>
<Routes4091/>
<Routes4015/>
<Routes4088/>
<Routes4217/>
<Routes4005/>
<Routes4285/>
<Routes4296/>
</Routes>
</main>
</Router>
@@ -59,6 +69,10 @@ fn HomePage() -> impl IntoView {
<li><a href="/4091/">"4091"</a></li>
<li><a href="/4015/">"4015"</a></li>
<li><a href="/4088/">"4088"</a></li>
<li><a href="/4217/">"4217"</a></li>
<li><a href="/4005/">"4005"</a></li>
<li><a href="/4285/">"4285"</a></li>
<li><a href="/4296/">"4296"</a></li>
</ul>
</nav>
}

View File

@@ -0,0 +1,24 @@
use leptos::prelude::*;
#[allow(unused_imports)]
use leptos_router::{
components::Route, path, MatchNestedRoutes, NavigateOptions,
};
#[component]
pub fn Routes4005() -> impl MatchNestedRoutes + Clone {
view! {
<Route path=path!("4005") view=Issue4005/>
}
.into_inner()
}
#[component]
fn Issue4005() -> impl IntoView {
view! {
<select id="select" prop:value="2">
<option value="1">"Option 1"</option>
<option value="2">"Option 2"</option>
<option value="3">"Option 3"</option>
</select>
}
}

View File

@@ -0,0 +1,24 @@
use leptos::prelude::*;
#[allow(unused_imports)]
use leptos_router::{
components::Route, path, MatchNestedRoutes, NavigateOptions,
};
#[component]
pub fn Routes4217() -> impl MatchNestedRoutes + Clone {
view! {
<Route path=path!("4217") view=Issue4217/>
}
.into_inner()
}
#[component]
fn Issue4217() -> impl IntoView {
view! {
<select multiple=true>
<option id="option1" value="1" selected>"Option 1"</option>
<option id="option2" value="2" selected>"Option 2"</option>
<option id="option3" value="3" selected>"Option 3"</option>
</select>
}
}

View File

@@ -0,0 +1,49 @@
use leptos::prelude::*;
use leptos_router::LazyRoute;
#[allow(unused_imports)]
use leptos_router::{
components::Route, path, Lazy, MatchNestedRoutes, NavigateOptions,
};
#[component]
pub fn Routes4285() -> impl MatchNestedRoutes + Clone {
view! {
<Route path=path!("4285") view={Lazy::<Issue4285>::new()}/>
}
.into_inner()
}
struct Issue4285 {
data: Resource<Result<i32, ServerFnError>>,
}
impl LazyRoute for Issue4285 {
fn data() -> Self {
Self {
data: Resource::new(|| (), |_| slow_call()),
}
}
async fn view(this: Self) -> AnyView {
let Issue4285 { data } = this;
view! {
<Suspense>
{move || {
Suspend::new(async move {
let data = data.await;
view! {
<p id="result">{data}</p>
}
})
}}
</Suspense>
}
.into_any()
}
}
#[server]
async fn slow_call() -> Result<i32, ServerFnError> {
tokio::time::sleep(std::time::Duration::from_millis(250)).await;
Ok(42)
}

View File

@@ -0,0 +1,36 @@
use leptos::prelude::*;
#[allow(unused_imports)]
use leptos_router::{
components::Route, path, Lazy, MatchNestedRoutes, NavigateOptions,
};
use leptos_router::{hooks::use_query_map, LazyRoute};
#[component]
pub fn Routes4296() -> impl MatchNestedRoutes + Clone {
view! {
<Route path=path!("4296") view={Lazy::<Issue4296>::new()}/>
}
.into_inner()
}
struct Issue4296 {
query: Signal<Option<String>>,
}
impl LazyRoute for Issue4296 {
fn data() -> Self {
let query = use_query_map();
let query = Signal::derive(move || query.read().get("q"));
Self { query }
}
async fn view(this: Self) -> AnyView {
let Issue4296 { query } = this;
view! {
<a href="?q=abc">"abc"</a>
<a href="?q=def">"def"</a>
<p id="result">{move || format!("{:?}", query.get())}</p>
}
.into_any()
}
}

View File

@@ -1,5 +1,9 @@
pub mod app;
mod issue_4005;
mod issue_4088;
mod issue_4217;
mod issue_4285;
mod issue_4296;
mod pr_4015;
mod pr_4091;

View File

@@ -0,0 +1,7 @@
# Generated by Cargo
# will have compiled files and executables
/target
.DS_Store
# These are backup files generated by rustfmt
**/*.rs.bk

View File

@@ -0,0 +1,13 @@
[package]
name = "subsecond_hot_patch"
version = "0.1.0"
authors = ["Greg Johnston <greg.johnston@gmail.com>"]
edition = "2021"
[dependencies]
leptos = { path = "../../leptos", features = ["csr", "subsecond"] }
leptos_router = { path = "../../router" }
[features]
default = ["web"]
web = []

View File

@@ -0,0 +1,21 @@
[application]
[web.app]
# HTML title tag content
title = "ltest"
# include `assets` in web platform
[web.resource]
# Additional CSS style files
style = []
# Additional JavaScript files
script = []
[web.resource.dev]
# Javascript code file
# serve: [dev-server] only
script = []

View File

@@ -0,0 +1 @@
extend = [{ path = "../cargo-make/main.toml" }]

View File

@@ -0,0 +1,31 @@
# Hot Patching with `dx`
This is an experimental example exploring how to combine Leptos with the binary hot-patching provided by Dioxus's `subsecond` library and `dx` cli.
### Serving Your App
This requires installing the Dioxus CLI version 0.7.0. At the time I'm writing this README, that does not yet have a stable release. Once `dioxus-cli` 0.7.0 has been released, you should use the latest stable release. Until then, I'd suggest installing from git:
```sh
cargo install dioxus-cli --git https://github.com/DioxusLabs/dioxus
```
Then you can run the example with `dx serve --hot-patch --platform web`.
### Hot Patching
Changes to the your application should be reflected in your app without a full rebuild and reload.
### Limitatations
Currently we only support hot-patching for reactive view functions. You probably want to use `AnyView` (via `.into_any()`) on any views that will be hot-patched, so they can be rebuilt correctly despite their types changing when the structure of the view tree changes.
If you are using `leptos_router` this actually works quite well, as every routes view is erased to `AnyView` and the router itself is a reactive view function: in other words, changes inside any route should be hot-patched in any case.
Note that any hot-patch will cause all render effects to run again. This means that some client-side state (like the values of signals) will be wiped out.
### Build Tooling
The preference of the Dioxus team is that all hot-patching work that uses their `subsecond` also use `dioxus-cli`. As this demo shows, it's completely possible to use `dioxus-cli` to build and run a Leptos project. We do not plan to build `subsecond` into our own build tooling at this time.
**This is an experiment/POC. It is being published because members of the community have found it useful and have asked for the support to be merged in its current state. Further development and bugfixes are a relatively low priority at this time.**

Binary file not shown.

After

Width:  |  Height:  |  Size: 130 KiB

File diff suppressed because one or more lines are too long

After

Width:  |  Height:  |  Size: 23 KiB

View File

@@ -0,0 +1,46 @@
/* App-wide styling */
body {
background-color: #0f1116;
color: #ffffff;
font-family: 'Segoe UI', Tahoma, Geneva, Verdana, sans-serif;
margin: 20px;
}
#hero {
margin: 0;
display: flex;
flex-direction: column;
justify-content: center;
align-items: center;
}
#links {
width: 400px;
text-align: left;
font-size: x-large;
color: white;
display: flex;
flex-direction: column;
}
#links a {
color: white;
text-decoration: none;
margin-top: 20px;
margin: 10px 0px;
border: white 1px solid;
border-radius: 5px;
padding: 10px;
}
#links a:hover {
background-color: #1f1f1f;
cursor: pointer;
}
#header {
max-width: 1200px;
}

View File

@@ -0,0 +1,44 @@
use leptos::{prelude::*, subsecond::connect_to_hot_patch_messages};
use leptos_router::{
components::{Route, Router, Routes},
path,
};
fn main() {
// connect to DX CLI and patch the WASM binary whenever we receive a message
connect_to_hot_patch_messages();
// wrapping App here in a closure so we can hot-reload it, because we only do that
// for reactive views right now. changing anything will re-run App and update the view
mount_to_body(|| App);
}
#[component]
fn App() -> impl IntoView {
view! {
<nav>
<a href="/">"Home"</a>
<a href="/about">"About"</a>
</nav>
<Router>
<Routes fallback=|| "Not found">
<Route path=path!("/") view=HomePage/>
<Route path=path!("/about") view=About/>
</Routes>
</Router>
}
}
#[component]
fn HomePage() -> impl IntoView {
view! {
<h1>"Home Page"</h1>
}
}
#[component]
fn About() -> impl IntoView {
view! {
<h1>"About"</h1>
}
}

View File

@@ -4,7 +4,7 @@ authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
description = "Actix integrations for the Leptos web framework."
version = { workspace = true }
version = "0.8.5"
rust-version.workspace = true
edition.workspace = true
@@ -22,10 +22,10 @@ leptos_meta = { workspace = true, features = ["nonce"] }
leptos_router = { workspace = true, features = ["ssr"] }
server_fn = { workspace = true, features = ["actix-no-default"] }
tachys = { workspace = true }
serde_json = { workspace = true , default-features = true }
serde_json = { workspace = true, default-features = true }
parking_lot = { workspace = true, default-features = true }
tracing = { optional = true , workspace = true, default-features = true }
tokio = { features = ["rt", "fs"] , workspace = true, default-features = true }
tracing = { optional = true, workspace = true, default-features = true }
tokio = { features = ["rt", "fs"], workspace = true, default-features = true }
send_wrapper = { workspace = true, default-features = true }
dashmap = { workspace = true, default-features = true }

View File

@@ -4,7 +4,7 @@ authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
description = "Axum integrations for the Leptos web framework."
version = { workspace = true }
version = "0.8.6"
rust-version.workspace = true
edition.workspace = true

View File

@@ -1177,7 +1177,7 @@ where
generate_route_list_with_exclusions_and_ssg(app_fn, None).0
}
/// Generates a list of all routes defined in Leptos's Router in your app. We can then use t.clone()his to automatically
/// Generates a list of all routes defined in Leptos's Router in your app. We can then use this to automatically
/// create routes in Axum's Router without having to use wildcard matching or fallbacks. Takes in your root app Element
/// as an argument so it can walk you app tree. This version is tailored to generate Axum compatible paths.
#[cfg_attr(
@@ -2061,10 +2061,12 @@ where
req,
|app, chunks, _supports_ooo| {
Box::pin(async move {
let app = app
.to_html_stream_in_order()
.collect::<String>()
.await;
let app = if cfg!(feature = "islands-router") {
app.to_html_stream_in_order_branching()
} else {
app.to_html_stream_in_order()
};
let app = app.collect::<String>().await;
let chunks = chunks();
Box::pin(once(async move { app }).chain(chunks))
as PinnedStream<String>

View File

@@ -4,7 +4,7 @@ authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
description = "Utilities to help build server integrations for the Leptos web framework."
version = { workspace = true }
version = "0.8.5"
rust-version.workspace = true
edition.workspace = true

View File

@@ -3,12 +3,14 @@
use futures::{stream::once, Stream, StreamExt};
use hydration_context::{SharedContext, SsrSharedContext};
use leptos::{
context::provide_context,
nonce::use_nonce,
prelude::ReadValue,
reactive::owner::{Owner, Sandboxed},
IntoView,
IntoView, PrefetchLazyFn, WasmSplitManifest,
};
use leptos_config::LeptosOptions;
use leptos_meta::ServerMetaContextOutput;
use leptos_meta::{Link, ServerMetaContextOutput};
use std::{future::Future, pin::Pin, sync::Arc};
pub type PinnedStream<T> = Pin<Box<dyn Stream<Item = T> + Send>>;
@@ -41,6 +43,8 @@ pub trait ExtendResponse: Sized {
IV: IntoView + 'static,
{
async move {
let prefetches = PrefetchLazyFn::default();
let (owner, stream) = build_response(
app_fn,
additional_context,
@@ -48,6 +52,8 @@ pub trait ExtendResponse: Sized {
supports_ooo,
);
owner.with(|| provide_context(prefetches.clone()));
let sc = owner.shared_context().unwrap();
let stream = stream.await.ready_chunks(32).map(|n| n.join(""));
@@ -56,6 +62,40 @@ pub trait ExtendResponse: Sized {
pending.await;
}
if !prefetches.0.read_value().is_empty() {
use leptos::prelude::*;
let nonce =
use_nonce().map(|n| n.to_string()).unwrap_or_default();
if let Some(manifest) = use_context::<WasmSplitManifest>() {
let (pkg_path, manifest) = &*manifest.0.read_value();
let prefetches = prefetches.0.read_value();
let all_prefetches = prefetches.iter().flat_map(|key| {
manifest.get(*key).into_iter().flatten()
});
for module in all_prefetches {
// to_html() on leptos_meta components registers them with the meta context,
// rather than returning HTML directly
_ = view! {
<Link
rel="preload"
href=format!("{pkg_path}/{module}.wasm")
as_="fetch"
type_="application/wasm"
crossorigin=nonce.clone()
/>
}
.to_html();
}
_ = view! {
<Link rel="modulepreload" href=format!("{pkg_path}/__wasm_split.js") crossorigin=nonce/>
}
.to_html();
}
}
let mut stream = Box::pin(
meta_context.inject_meta_context(stream).await.then({
let sc = Arc::clone(&sc);

View File

@@ -1,6 +1,6 @@
[package]
name = "leptos"
version = { workspace = true }
version = "0.8.9"
authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
@@ -24,14 +24,14 @@ leptos_hot_reload = { workspace = true }
leptos_macro = { workspace = true }
leptos_server = { workspace = true, features = ["tachys"] }
leptos_config = { workspace = true }
leptos-spin-macro = { optional = true , workspace = true, default-features = true }
leptos-spin-macro = { optional = true, workspace = true, default-features = true }
oco_ref = { workspace = true }
or_poisoned = { workspace = true }
paste = { workspace = true, default-features = true }
rand = { optional = true , workspace = true, default-features = true }
rand = { optional = true, workspace = true, default-features = true }
# NOTE: While not used directly, `getrandom`'s `wasm_js` feature is needed when `rand` is used on WASM to
# avoid a compilation error
getrandom = { optional = true , workspace = true, default-features = true }
getrandom = { optional = true, workspace = true, default-features = true }
reactive_graph = { workspace = true, features = ["serde"] }
rustc-hash = { workspace = true, default-features = true }
tachys = { workspace = true, features = [
@@ -44,7 +44,7 @@ tracing = { optional = true, workspace = true, default-features = true }
typed-builder = { workspace = true, default-features = true }
typed-builder-macro = { workspace = true, default-features = true }
serde = { workspace = true, default-features = true }
serde_json = { optional = true, workspace = true, default-features = true }
serde_json = { workspace = true, default-features = true }
server_fn = { workspace = true, features = ["form-redirects", "browser"] }
web-sys = { features = [
"ShadowRoot",
@@ -52,10 +52,15 @@ web-sys = { features = [
"ShadowRootMode",
], workspace = true, default-features = true }
wasm-bindgen = { workspace = true, default-features = true }
wasm-bindgen-futures = { workspace = true, default-features = true }
serde_qs = { workspace = true, default-features = true }
slotmap = { workspace = true, default-features = true }
futures = { workspace = true, default-features = true }
send_wrapper = { workspace = true, default-features = true }
wasm_split_helpers.workspace = true
subsecond = { workspace = true, default-features = true, optional = true }
dioxus-cli-config = { workspace = true, default-features = true, optional = true }
dioxus-devtools = { workspace = true, default-features = true, optional = true }
[features]
hydration = [
@@ -93,16 +98,29 @@ tracing = [
]
nonce = ["base64", "rand", "dep:getrandom"]
spin = ["leptos-spin-macro"]
islands = ["leptos_macro/islands", "dep:serde_json"]
islands = ["leptos_macro/islands"]
trace-component-props = [
"leptos_macro/trace-component-props",
"leptos_dom/trace-component-props",
]
delegation = ["tachys/delegation"]
islands-router = ["tachys/mark_branches"]
subsecond = [
"reactive_graph/subsecond",
"dep:subsecond",
"dep:dioxus-cli-config",
"dep:dioxus-devtools",
"web-sys/Location",
"web-sys/MessageEvent",
"web-sys/WebSocket",
"web-sys/Window",
]
[dev-dependencies]
tokio = { features = ["rt-multi-thread", "macros"] , workspace = true, default-features = true }
tokio = { features = [
"rt-multi-thread",
"macros",
], workspace = true, default-features = true }
tokio-test = { workspace = true, default-features = true }
any_spawner = { workspace = true, features = ["futures-executor", "tokio"] }

View File

@@ -157,6 +157,14 @@ impl<T: IntoView + 'static, A: Attribute> RenderHtml
self.children.hydrate::<FROM_SERVER>(cursor, position)
}
async fn hydrate_async(
self,
cursor: &leptos::tachys::hydration::Cursor,
position: &leptos::tachys::view::PositionState,
) -> Self::State {
self.children.hydrate_async(cursor, position).await
}
fn into_owned(self) -> Self::Owned {
AttributeInterceptorInner {
children_builder: self.children_builder,

View File

@@ -262,6 +262,16 @@ where
}
}
impl<C> From<View<C>> for ViewFn
where
C: Clone + Send + Sync + 'static,
View<C>: IntoAny,
{
fn from(value: View<C>) -> Self {
Self(Arc::new(move || value.clone().into_any()))
}
}
impl ViewFn {
/// Execute the wrapped function
pub fn run(&self) -> AnyView {
@@ -289,6 +299,16 @@ where
}
}
impl<C> From<View<C>> for ViewFnOnce
where
C: Send + Sync + 'static,
View<C>: IntoAny,
{
fn from(value: View<C>) -> Self {
Self(Box::new(move || value.into_any()))
}
}
impl ViewFnOnce {
/// Execute the wrapped function
pub fn run(self) -> AnyView {

View File

@@ -2,6 +2,7 @@ use crate::{children::TypedChildren, IntoView};
use futures::{channel::oneshot, future::join_all};
use hydration_context::{SerializedDataId, SharedContext};
use leptos_macro::component;
use or_poisoned::OrPoisoned;
use reactive_graph::{
computed::ArcMemo,
effect::RenderEffect,
@@ -10,7 +11,12 @@ use reactive_graph::{
traits::{Get, Update, With, WithUntracked, WriteValue},
};
use rustc_hash::FxHashMap;
use std::{collections::VecDeque, fmt::Debug, mem, sync::Arc};
use std::{
collections::VecDeque,
fmt::Debug,
mem,
sync::{Arc, Mutex},
};
use tachys::{
html::attribute::{any_attribute::AnyAttribute, Attribute},
hydration::Cursor,
@@ -508,6 +514,79 @@ where
)
}
async fn hydrate_async(
self,
cursor: &Cursor,
position: &PositionState,
) -> Self::State {
let mut children = Some(self.children);
let hook = Arc::clone(&self.hook);
let cursor = cursor.to_owned();
let position = position.to_owned();
let fallback_fn = Arc::new(Mutex::new(self.fallback));
let initial = {
let errors_empty = self.errors_empty.clone();
let errors = self.errors.clone();
let fallback_fn = Arc::clone(&fallback_fn);
async move {
let children = children.take().unwrap();
let (children, fallback) = if errors_empty.get() {
(children.hydrate_async(&cursor, &position).await, None)
} else {
let children = children.build();
let fallback =
(fallback_fn.lock().or_poisoned())(errors.clone());
let fallback =
fallback.hydrate_async(&cursor, &position).await;
(children, Some(fallback))
};
ErrorBoundaryViewState { children, fallback }
}
};
RenderEffect::new_with_async_value(
move |prev: Option<
ErrorBoundaryViewState<Chil::State, Fal::State>,
>| {
let _hook = throw_error::set_error_hook(Arc::clone(&hook));
if let Some(mut state) = prev {
match (self.errors_empty.get(), &mut state.fallback) {
// no errors, and was showing fallback
(true, Some(fallback)) => {
fallback.insert_before_this(&mut state.children);
state.fallback.unmount();
state.fallback = None;
}
// yes errors, and was showing children
(false, None) => {
state.fallback = Some(
(fallback_fn.lock().or_poisoned())(
self.errors.clone(),
)
.build(),
);
state
.children
.insert_before_this(&mut state.fallback);
state.children.unmount();
}
// either there were no errors, and we were already showing the children
// or there are errors, but we were already showing the fallback
// in either case, rebuilding doesn't require us to do anything
_ => {}
}
state
} else {
unreachable!()
}
},
initial,
)
.await
}
fn into_owned(self) -> Self::Owned {
self
}

View File

@@ -8,46 +8,49 @@
c();
}
}
function hydrateIslands(rootNode, mod) {
function traverse(node) {
async function hydrateIslands(rootNode, mod) {
async function traverse(node) {
if (node.nodeType === Node.ELEMENT_NODE) {
const tag = node.tagName.toLowerCase();
if(tag === 'leptos-island') {
const children = [];
const id = node.dataset.component || null;
hydrateIsland(node, id, mod);
await hydrateIsland(node, id, mod);
for(const child of node.children) {
traverse(child, children);
await traverse(child, children);
}
} else {
if (tag === 'leptos-children') {
MOST_RECENT_CHILDREN_CB.push(node.$$on_hydrate);
for(const child of node.children) {
traverse(child);
await traverse(child);
};
// un-set the "most recent children"
MOST_RECENT_CHILDREN_CB.pop();
} else {
for(const child of node.children) {
traverse(child);
await traverse(child);
};
}
}
}
}
traverse(rootNode);
await traverse(rootNode);
}
function hydrateIsland(el, id, mod) {
async function hydrateIsland(el, id, mod) {
const islandFn = mod[id];
if (islandFn) {
const children_cb = MOST_RECENT_CHILDREN_CB[MOST_RECENT_CHILDREN_CB.length-1];
if (children_cb) {
children_cb();
}
islandFn(el);
const res = islandFn(el);
if (res && res.then) {
await res;
}
} else {
console.warn(`Could not find WASM function for the island ${id}.`);
}

View File

@@ -1,8 +1,9 @@
#![allow(clippy::needless_lifetimes)]
use crate::prelude::*;
use crate::{prelude::*, WasmSplitManifest};
use leptos_config::LeptosOptions;
use leptos_macro::{component, view};
use std::{path::PathBuf, sync::OnceLock};
/// Inserts auto-reloading code used in `cargo-leptos`.
///
@@ -58,6 +59,29 @@ pub fn HydrationScripts(
#[prop(optional, into)]
root: Option<String>,
) -> impl IntoView {
static SPLIT_MANIFEST: OnceLock<Option<WasmSplitManifest>> =
OnceLock::new();
if let Some(splits) = SPLIT_MANIFEST.get_or_init(|| {
let root = root.clone().unwrap_or_default();
let site_dir = &options.site_root;
let pkg_dir = &options.site_pkg_dir;
let path = PathBuf::from(site_dir.to_string());
let path = path
.join(pkg_dir.to_string())
.join("__wasm_split_manifest.json");
let file = std::fs::read_to_string(path).ok()?;
let manifest = WasmSplitManifest(ArcStoredValue::new((
format!("{root}/{pkg_dir}"),
serde_json::from_str(&file).expect("could not read manifest file"),
)));
Some(manifest)
}) {
provide_context(splits.clone());
}
let mut js_file_name = options.output_name.to_string();
let mut wasm_file_name = options.output_name.to_string();
if options.hash_files {
@@ -112,7 +136,7 @@ pub fn HydrationScripts(
let root = root.unwrap_or_default();
view! {
<link rel="modulepreload" href=format!("{root}/{pkg_path}/{js_file_name}.js") nonce=nonce.clone()/>
<link rel="modulepreload" href=format!("{root}/{pkg_path}/{js_file_name}.js") crossorigin=nonce.clone()/>
<link
rel="preload"
href=format!("{root}/{pkg_path}/{wasm_file_name}.wasm")

View File

@@ -1,3 +1,7 @@
if (window.location.protocol === 'https:') {
protocol = 'wss://';
}
let host = window.location.hostname;
let ws = new WebSocket(`${protocol}${host}:${reload_port}/live_reload`);
ws.onmessage = (ev) => {

View File

@@ -178,6 +178,14 @@ impl<T: RenderHtml> RenderHtml for View<T> {
self.inner.hydrate::<FROM_SERVER>(cursor, position)
}
async fn hydrate_async(
self,
cursor: &Cursor,
position: &PositionState,
) -> Self::State {
self.inner.hydrate_async(cursor, position).await
}
fn into_owned(self) -> Self::Owned {
View {
inner: self.inner.into_owned(),

View File

@@ -1,5 +1,4 @@
#![deny(missing_docs)]
#![forbid(unsafe_code)]
//! # About Leptos
//!
@@ -85,12 +84,22 @@
//! # Feature Flags
//!
//! - **`nightly`**: On `nightly` Rust, enables the function-call syntax for signal getters and setters.
//! Also enables some experimental optimizations that improve the handling of static strings and
//! the performance of the `template! {}` macro.
//! - **`csr`** Client-side rendering: Generate DOM nodes in the browser.
//! - **`ssr`** Server-side rendering: Generate an HTML string (typically on the server).
//! - **`islands`** Activates “islands mode,” in which components are not made interactive on the
//! client unless they use the `#[island]` macro.
//! - **`hydrate`** Hydration: use this to add interactivity to an SSRed Leptos app.
//! - **`rkyv`** In SSR/hydrate mode, uses [`rkyv`](https://docs.rs/rkyv/latest/rkyv/) to serialize resources and send them
//! from the server to the client.
//! - **`nonce`** Adds support for nonces to be added as part of a Content Security Policy.
//! - **`rkyv`** In SSR/hydrate mode, enables using [`rkyv`](https://docs.rs/rkyv/latest/rkyv/) to serialize resources.
//! - **`tracing`** Adds support for [`tracing`](https://docs.rs/tracing/latest/tracing/).
//! - **`trace-component-props`** Adds `tracing` support for component props.
//! - **`delegation`** Uses event delegation rather than the browsers native event handling
//! system. (This improves the performance of creating large numbers of elements simultaneously,
//! in exchange for occasional edge cases in which events behave differently from native browser
//! events.)
//! - **`rustls`** Use `rustls` for server functions.
//!
//! **Important Note:** You must enable one of `csr`, `hydrate`, or `ssr` to tell Leptos
//! which mode your app is operating in. You should only enable one of these per build target,
@@ -215,12 +224,15 @@ pub mod error {
/// Control-flow components like `<Show>`, `<For>`, and `<Await>`.
pub mod control_flow {
pub use crate::{animated_show::*, await_::*, for_loop::*, show::*};
pub use crate::{
animated_show::*, await_::*, for_loop::*, show::*, show_let::*,
};
}
mod animated_show;
mod await_;
mod for_loop;
mod show;
mod show_let;
/// A component that allows rendering a component somewhere else.
pub mod portal;
@@ -293,6 +305,10 @@ pub use tachys::mathml as math;
#[doc(inline)]
pub use tachys::svg;
#[cfg(feature = "subsecond")]
/// Utilities for using binary hot-patching with [`subsecond`].
pub mod subsecond;
/// Utilities for simple isomorphic logging to the console or terminal.
pub mod logging {
pub use leptos_dom::{debug_warn, error, log, warn};
@@ -301,12 +317,17 @@ pub mod logging {
/// Utilities for working with asynchronous tasks.
pub mod task {
use any_spawner::Executor;
use reactive_graph::computed::ScopedFuture;
use std::future::Future;
/// Spawns a thread-safe [`Future`].
///
/// This will be run with the current reactive owner and observer using a [`ScopedFuture`].
#[track_caller]
#[inline(always)]
pub fn spawn(fut: impl Future<Output = ()> + Send + 'static) {
let fut = ScopedFuture::new(fut);
#[cfg(not(target_family = "wasm"))]
Executor::spawn(fut);
@@ -335,7 +356,6 @@ pub mod task {
#[cfg(feature = "islands")]
#[doc(hidden)]
pub use serde;
#[cfg(feature = "islands")]
#[doc(hidden)]
pub use serde_json;
#[cfg(feature = "tracing")]
@@ -343,5 +363,39 @@ pub use serde_json;
pub use tracing;
#[doc(hidden)]
pub use wasm_bindgen;
pub use wasm_split_helpers;
#[doc(hidden)]
pub use web_sys;
#[doc(hidden)]
pub mod __reexports {
pub use send_wrapper;
pub use wasm_bindgen_futures;
}
#[doc(hidden)]
#[derive(Clone, Debug, Default)]
pub struct PrefetchLazyFn(
pub reactive_graph::owner::ArcStoredValue<
std::collections::HashSet<&'static str>,
>,
);
#[doc(hidden)]
pub fn prefetch_lazy_fn_on_server(id: &'static str) {
use crate::context::use_context;
use reactive_graph::traits::WriteValue;
if let Some(prefetches) = use_context::<PrefetchLazyFn>() {
prefetches.0.write_value().insert(id);
}
}
#[doc(hidden)]
#[derive(Clone, Debug, Default)]
pub struct WasmSplitManifest(
pub reactive_graph::owner::ArcStoredValue<(
String,
std::collections::HashMap<String, Vec<String>>,
)>,
);

View File

@@ -29,6 +29,25 @@ where
owner.forget();
}
#[cfg(feature = "hydrate")]
/// Hydrates the app described by the provided function, starting at `<body>`, with support
/// for lazy-loaded routes and components.
pub fn hydrate_lazy<F, N>(f: F)
where
F: FnOnce() -> N + 'static,
N: IntoView,
{
// use wasm-bindgen-futures to drive the reactive system
// we ignore the return value because an Err here just means the wasm-bindgen executor is
// already initialized, which is not an issue
_ = Executor::init_wasm_bindgen();
crate::task::spawn_local(async move {
let owner = hydrate_from_async(body(), f).await;
owner.forget();
})
}
#[cfg(debug_assertions)]
thread_local! {
static FIRST_CALL: Cell<bool> = const { Cell::new(true) };
@@ -83,6 +102,65 @@ where
UnmountHandle { owner, mountable }
}
#[cfg(feature = "hydrate")]
/// Runs the provided closure and mounts the result to the provided element.
pub async fn hydrate_from_async<F, N>(
parent: HtmlElement,
f: F,
) -> UnmountHandle<N::State>
where
F: FnOnce() -> N + 'static,
N: IntoView,
{
use hydration_context::HydrateSharedContext;
use std::sync::Arc;
// use wasm-bindgen-futures to drive the reactive system
// we ignore the return value because an Err here just means the wasm-bindgen executor is
// already initialized, which is not an issue
_ = Executor::init_wasm_bindgen();
#[cfg(debug_assertions)]
{
if !cfg!(feature = "hydrate") && FIRST_CALL.get() {
logging::warn!(
"It seems like you're trying to use Leptos in hydration mode, \
but the `hydrate` feature is not enabled on the `leptos` \
crate. Add `features = [\"hydrate\"]` to your Cargo.toml for \
the crate to work properly.\n\nNote that hydration and \
client-side rendering now use separate functions from \
leptos::mount: you are calling a hydration function."
);
}
FIRST_CALL.set(false);
}
// create a new reactive owner and use it as the root node to run the app
let owner = Owner::new_root(Some(Arc::new(HydrateSharedContext::new())));
let mountable = owner
.with(move || {
use reactive_graph::computed::ScopedFuture;
ScopedFuture::new(async move {
let view = f().into_view();
view.hydrate_async(
&Cursor::new(parent.unchecked_into()),
&PositionState::default(),
)
.await
})
})
.await;
if let Some(sc) = Owner::current_shared_context() {
sc.hydration_complete();
}
// returns a handle that owns the owner
// when this is dropped, it will clean up the reactive system and unmount the view
UnmountHandle { owner, mountable }
}
/// Runs the provided closure and mounts the result to the `<body>`.
pub fn mount_to_body<F, N>(f: F)
where

162
leptos/src/show_let.rs Normal file
View File

@@ -0,0 +1,162 @@
use crate::{children::ViewFn, IntoView};
use leptos_macro::component;
use reactive_graph::traits::Get;
use std::{marker::PhantomData, sync::Arc};
use tachys::either::Either;
/// Like `<Show>` but for `Option`. This is a shortcut for
///
/// ```ignore
/// value.map(|value| {
/// view! { ... }
/// })
/// ```
///
/// If you specify a `fallback` it is equvalent to
///
/// ```ignore
/// value
/// .map(
/// |value| children(value),
/// )
/// .unwrap_or_else(fallback)
/// ```
///
/// ## Example
///
/// ```
/// # use leptos::prelude::*;
/// #
/// # #[component]
/// # pub fn Example() -> impl IntoView {
/// let (opt_value, set_opt_value) = signal(None::<i32>);
///
/// view! {
/// <ShowLet some=opt_value let:value>
/// "We have a value: " {value}
/// </ShowLet>
/// }
/// # }
/// ```
///
/// You can also specify a fallback:
/// ```
/// # use leptos::prelude::*;
/// #
/// # #[component]
/// # pub fn Example() -> impl IntoView {
/// let (opt_value, set_opt_value) = signal(None::<i32>);
///
/// view! {
/// <ShowLet some=opt_value let:value fallback=|| "Got nothing">
/// "We have a value: " {value}
/// </ShowLet>
/// }
/// # }
/// ```
///
/// In addition to signals you can also use a closure that returns an `Option`:
///
/// ```
/// # use leptos::prelude::*;
/// #
/// # #[component]
/// # pub fn Example() -> impl IntoView {
/// let (opt_value, set_opt_value) = signal(None::<i32>);
///
/// view! {
/// <ShowLet some=move || opt_value.get().map(|v| v * 2) let:value>
/// "We have a value: " {value}
/// </ShowLet>
/// }
/// # }
/// ```
#[component]
pub fn ShowLet<T, ChFn, V, M>(
/// The children will be shown whenever `value` is `Some`.
///
/// They take the inner value as an argument. Use `let:` to bind the value to a variable.
children: ChFn,
/// A signal of type `Option` or a closure that returns an `Option`.
/// If the value is `Some`, the children will be shown.
/// Otherwise the fallback will be shown, if present.
some: impl IntoOptionGetter<T, M>,
/// A closure that returns what gets rendered when the value is `None`.
/// By default this is the empty view.
///
/// You can think of it as the closure inside `.unwrap_or_else(|| fallback())`.
#[prop(optional, into)]
fallback: ViewFn,
/// Marker for generic parameters. Ignore this.
#[prop(optional)]
_marker: PhantomData<(T, M)>,
) -> impl IntoView
where
ChFn: Fn(T) -> V + Send + Clone + 'static,
V: IntoView + 'static,
T: 'static,
{
let getter = some.into_option_getter();
move || {
let children = children.clone();
let fallback = fallback.clone();
getter
.run()
.map(move |t| Either::Left(children(t)))
.unwrap_or_else(move || Either::Right(fallback.run()))
}
}
/// Servers as a wrapper for both, an `Option` signal or a closure that returns an `Option`.
pub struct OptionGetter<T>(Arc<dyn Fn() -> Option<T> + Send + Sync + 'static>);
impl<T> Clone for OptionGetter<T> {
fn clone(&self) -> Self {
Self(Arc::clone(&self.0))
}
}
impl<T> OptionGetter<T> {
/// Runs the getter and returns the result.
pub fn run(&self) -> Option<T> {
(self.0)()
}
}
/// Conversion trait for creating an `OptionGetter` from a closure or a signal.
pub trait IntoOptionGetter<T, M> {
/// Converts the given value into an `OptionGetter`.
fn into_option_getter(self) -> OptionGetter<T>;
}
/// Marker type for creating an `OptionGetter` from a closure.
/// Used so that the compiler doesn't complain about double implementations of the trait `IntoOptionGetter`.
pub struct FunctionMarker;
impl<T, F> IntoOptionGetter<T, FunctionMarker> for F
where
F: Fn() -> Option<T> + Send + Sync + 'static,
{
fn into_option_getter(self) -> OptionGetter<T> {
OptionGetter(Arc::new(self))
}
}
/// Marker type for creating an `OptionGetter` from a signal.
/// Used so that the compiler doesn't complain about double implementations of the trait `IntoOptionGetter`.
pub struct SignalMarker;
impl<T, S> IntoOptionGetter<T, SignalMarker> for S
where
S: Get<Value = Option<T>> + Clone + Send + Sync + 'static,
{
fn into_option_getter(self) -> OptionGetter<T> {
let cloned = self.clone();
OptionGetter(Arc::new(move || cloned.get()))
}
}

62
leptos/src/subsecond.rs Normal file
View File

@@ -0,0 +1,62 @@
use dioxus_devtools::DevserverMsg;
use wasm_bindgen::{prelude::Closure, JsCast};
use web_sys::{js_sys::JsString, MessageEvent, WebSocket};
/// Sets up a websocket connect to the `dx` CLI, waiting for incoming hot-patching messages
/// and patching the WASM binary appropriately.
//
// Note: This is a stripped-down version of Dioxus's `make_ws` from `dioxus_web`
// It's essentially copy-pasted here because it's not pub there.
// Would love to just take a dependency on that to be able to use it and deduplicate.
//
// https://github.com/DioxusLabs/dioxus/blob/main/packages/web/src/devtools.rs#L36
pub fn connect_to_hot_patch_messages() {
// Get the location of the devserver, using the current location plus the /_dioxus path
// The idea here being that the devserver is always located on the /_dioxus behind a proxy
let location = web_sys::window().unwrap().location();
let url = format!(
"{protocol}//{host}/_dioxus?build_id={build_id}",
protocol = match location.protocol().unwrap() {
prot if prot == "https:" => "wss:",
_ => "ws:",
},
host = location.host().unwrap(),
build_id = dioxus_cli_config::build_id(),
);
let ws = WebSocket::new(&url).unwrap();
ws.set_onmessage(Some(
Closure::<dyn FnMut(MessageEvent)>::new(move |e: MessageEvent| {
let Ok(text) = e.data().dyn_into::<JsString>() else {
return;
};
// The devserver messages have some &'static strs in them, so we need to leak the source string
let string: String = text.into();
let string = Box::leak(string.into_boxed_str());
if let Ok(DevserverMsg::HotReload(msg)) =
serde_json::from_str::<DevserverMsg>(string)
{
if let Some(jump_table) = msg.jump_table.as_ref().cloned() {
if msg.for_build_id == Some(dioxus_cli_config::build_id()) {
let our_pid = if cfg!(target_family = "wasm") {
None
} else {
Some(std::process::id())
};
if msg.for_pid == our_pid {
unsafe { subsecond::apply_patch(jump_table) }
.unwrap();
}
}
}
}
})
.into_js_value()
.as_ref()
.unchecked_ref(),
));
}

View File

@@ -32,12 +32,12 @@ use tachys::{
};
use throw_error::ErrorHookFuture;
/// If any [`Resource`](leptos_reactive::Resource) is read in the `children` of this
/// If any [`Resource`](crate::prelude::Resource) is read in the `children` of this
/// component, it will show the `fallback` while they are loading. Once all are resolved,
/// it will render the `children`.
///
/// Each time one of the resources is loading again, it will fall back. To keep the current
/// children instead, use [Transition](crate::Transition).
/// children instead, use [Transition](crate::prelude::Transition).
///
/// Note that the `children` will be rendered initially (in order to capture the fact that
/// those resources are read under the suspense), so you cannot assume that resources read

View File

@@ -16,11 +16,11 @@ use reactive_graph::{
use slotmap::{DefaultKey, SlotMap};
use tachys::reactive_graph::OwnedView;
/// If any [`Resource`](leptos_reactive::Resource) is read in the `children` of this
/// If any [`Resource`](crate::prelude::Resource) is read in the `children` of this
/// component, it will show the `fallback` while they are loading. Once all are resolved,
/// it will render the `children`.
///
/// Unlike [`Suspense`](crate::Suspense), this will not fall
/// Unlike [`Suspense`](crate::prelude::Suspense), this will not fall
/// back to the `fallback` state if there are further changes after the initial load.
///
/// Note that the `children` will be rendered initially (in order to capture the fact that

View File

@@ -5,7 +5,7 @@ license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
description = "Configuration for the Leptos web framework."
readme = "../README.md"
version = { workspace = true }
version = "0.8.7"
rust-version.workspace = true
edition.workspace = true
@@ -13,16 +13,24 @@ edition.workspace = true
config = { default-features = false, features = [
"toml",
"convert-case",
] , workspace = true }
], workspace = true }
regex = { workspace = true, default-features = true }
serde = { features = ["derive", "rc"] , workspace = true, default-features = true }
thiserror = { workspace = true , default-features = true }
typed-builder = { workspace = true , default-features = true }
serde = { features = [
"derive",
"rc",
], workspace = true, default-features = true }
thiserror = { workspace = true, default-features = true }
typed-builder = { workspace = true, default-features = true }
[dev-dependencies]
tokio = { features = ["rt", "macros"] , workspace = true, default-features = true }
tokio = { features = [
"rt",
"macros",
], workspace = true, default-features = true }
tempfile = { workspace = true, default-features = true }
temp-env = { features = ["async_closure"] , workspace = true, default-features = true }
temp-env = { features = [
"async_closure",
], workspace = true, default-features = true }
[package.metadata.docs.rs]
rustdoc-args = ["--generate-link-to-definition"]

View File

@@ -1,6 +1,6 @@
[package]
name = "leptos_dom"
version = { workspace = true }
version = "0.8.6"
authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
@@ -14,10 +14,10 @@ reactive_graph = { workspace = true }
or_poisoned = { workspace = true }
js-sys = { workspace = true, default-features = true }
send_wrapper = { workspace = true, default-features = true }
tracing = { optional = true , workspace = true, default-features = true }
wasm-bindgen = { workspace = true , default-features = true }
serde_json = { optional = true , workspace = true, default-features = true }
serde = { optional = true , workspace = true, default-features = true }
tracing = { optional = true, workspace = true, default-features = true }
wasm-bindgen = { workspace = true, default-features = true }
serde_json = { optional = true, workspace = true, default-features = true }
serde = { optional = true, workspace = true, default-features = true }
[dev-dependencies]
leptos = { path = "../leptos" }

View File

@@ -258,15 +258,7 @@ pub fn request_idle_callback_with_handle(
///
/// <div class="warning">The task is called outside of the ownership tree, this means that if you want to access for example the context you need to reestablish the owner.</div>
pub fn queue_microtask(task: impl FnOnce() + 'static) {
use js_sys::{Function, Reflect};
let task = Closure::once_into_js(task);
let window = web_sys::window().expect("window not available");
let queue_microtask =
Reflect::get(&window, &JsValue::from_str("queueMicrotask"))
.expect("queueMicrotask not available");
let queue_microtask = queue_microtask.unchecked_into::<Function>();
_ = queue_microtask.call1(&JsValue::UNDEFINED, &task);
tachys::renderer::dom::queue_microtask(task);
}
/// Handle that is generated by [set_timeout_with_handle] and can be used to clear the timeout.
@@ -471,7 +463,7 @@ pub fn set_interval_with_handle(
#[inline(never)]
fn si(
cb: Box<dyn Fn()>,
cb: Box<dyn FnMut()>,
duration: Duration,
) -> Result<IntervalHandle, JsValue> {
let cb = Closure::wrap(cb).into_js_value();
@@ -593,7 +585,8 @@ impl WindowListenerHandle {
}
}
fn is_server() -> bool {
/// Returns `true` if the current environment is a server.
pub fn is_server() -> bool {
#[cfg(feature = "hydration")]
{
Owner::current_shared_context()
@@ -605,3 +598,8 @@ fn is_server() -> bool {
false
}
}
/// Returns `true` if the current environment is a browser.
pub fn is_browser() -> bool {
!is_server()
}

View File

@@ -1,6 +1,6 @@
[package]
name = "leptos_hot_reload"
version = { workspace = true }
version = "0.8.5"
authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
@@ -11,17 +11,20 @@ edition.workspace = true
[dependencies]
anyhow = { workspace = true, default-features = true }
serde = { features = ["derive"] , workspace = true, default-features = true }
serde = { features = ["derive"], workspace = true, default-features = true }
syn = { features = [
"full",
"parsing",
"extra-traits",
"visit",
"printing",
] , workspace = true, default-features = true }
], workspace = true, default-features = true }
quote = { workspace = true, default-features = true }
rstml = { workspace = true, default-features = true }
proc-macro2 = { features = ["span-locations", "nightly"] , workspace = true, default-features = true }
proc-macro2 = { features = [
"span-locations",
"nightly",
], workspace = true, default-features = true }
parking_lot = { workspace = true, default-features = true }
walkdir = { workspace = true, default-features = true }
camino = { workspace = true, default-features = true }

View File

@@ -1,3 +1,4 @@
console.log("[HOT RELOADING] Connected to server.");
function patch(json) {
try {
const views = JSON.parse(json);

View File

@@ -1,6 +1,6 @@
[package]
name = "leptos_macro"
version = { workspace = true }
version = "0.8.8"
authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
@@ -13,26 +13,28 @@ edition.workspace = true
proc-macro = true
[dependencies]
attribute-derive = { features = ["syn-full"] , workspace = true, default-features = true }
attribute-derive = { features = [
"syn-full",
], workspace = true, default-features = true }
cfg-if = { workspace = true, default-features = true }
html-escape = { workspace = true, default-features = true }
itertools = { workspace = true , default-features = true }
itertools = { workspace = true, default-features = true }
prettyplease = { workspace = true, default-features = true }
proc-macro-error2 = { default-features = false , workspace = true }
proc-macro-error2 = { default-features = false, workspace = true }
proc-macro2 = { workspace = true, default-features = true }
quote = { workspace = true, default-features = true }
syn = { features = ["full"] , workspace = true, default-features = true }
syn = { features = ["full"], workspace = true, default-features = true }
rstml = { workspace = true, default-features = true }
leptos_hot_reload = { workspace = true }
server_fn_macro = { workspace = true }
convert_case = { workspace = true , default-features = true }
uuid = { features = ["v4"] , workspace = true, default-features = true }
tracing = { optional = true , workspace = true, default-features = true }
convert_case = { workspace = true, default-features = true }
uuid = { features = ["v4"], workspace = true, default-features = true }
tracing = { optional = true, workspace = true, default-features = true }
[dev-dependencies]
log = { workspace = true, default-features = true }
typed-builder = { workspace = true, default-features = true }
trybuild = { workspace = true , default-features = true }
trybuild = { workspace = true, default-features = true }
leptos = { path = "../leptos" }
leptos_router = { path = "../router", features = ["ssr"] }
server_fn = { path = "../server_fn", features = ["cbor"] }

View File

@@ -19,6 +19,7 @@ use syn::{
pub struct Model {
is_transparent: bool,
is_lazy: bool,
island: Option<String>,
docs: Docs,
unknown_attrs: UnknownAttrs,
@@ -66,6 +67,7 @@ impl Parse for Model {
Ok(Self {
is_transparent: false,
is_lazy: false,
island: None,
docs,
unknown_attrs,
@@ -140,6 +142,7 @@ impl ToTokens for Model {
fn to_tokens(&self, tokens: &mut TokenStream) {
let Self {
is_transparent,
is_lazy,
island,
docs,
unknown_attrs,
@@ -530,15 +533,41 @@ impl ToTokens for Model {
};
let hydrate_fn_name = hydrate_fn_name.as_ref().unwrap();
quote! {
#[::leptos::wasm_bindgen::prelude::wasm_bindgen(wasm_bindgen = ::leptos::wasm_bindgen)]
#[allow(non_snake_case)]
pub fn #hydrate_fn_name(el: ::leptos::web_sys::HtmlElement) {
#deserialize_island_props
let island = #name(#island_props);
let state = island.hydrate_from_position::<true>(&el, ::leptos::tachys::view::Position::Current);
// TODO better cleanup
std::mem::forget(state);
let hydrate_fn_inner = quote! {
#deserialize_island_props
let island = #name(#island_props);
let state = island.hydrate_from_position::<true>(&el, ::leptos::tachys::view::Position::Current);
// TODO better cleanup
std::mem::forget(state);
};
if *is_lazy {
let outer_name =
Ident::new(&format!("{name}_loader"), name.span());
quote! {
#[::leptos::prelude::lazy]
#[allow(non_snake_case)]
fn #outer_name (el: ::leptos::web_sys::HtmlElement) {
#hydrate_fn_inner
}
#[::leptos::wasm_bindgen::prelude::wasm_bindgen(
wasm_bindgen = ::leptos::wasm_bindgen,
wasm_bindgen_futures = ::leptos::__reexports::wasm_bindgen_futures
)]
#[allow(non_snake_case)]
pub async fn #hydrate_fn_name(el: ::leptos::web_sys::HtmlElement) {
#outer_name(el).await
}
}
} else {
quote! {
#[::leptos::wasm_bindgen::prelude::wasm_bindgen(wasm_bindgen = ::leptos::wasm_bindgen)]
#[allow(non_snake_case)]
pub fn #hydrate_fn_name(el: ::leptos::web_sys::HtmlElement) {
#hydrate_fn_inner
}
}
}
} else {
@@ -610,6 +639,13 @@ impl Model {
self
}
#[allow(clippy::wrong_self_convention)]
pub fn is_lazy(mut self, is_lazy: bool) -> Self {
self.is_lazy = is_lazy;
self
}
#[allow(clippy::wrong_self_convention)]
pub fn with_island(mut self, island: Option<String>) -> Self {
self.island = island;
@@ -1324,7 +1360,10 @@ fn prop_to_doc(
}
pub fn unmodified_fn_name_from_fn_name(ident: &Ident) -> Ident {
Ident::new(&format!("__{ident}"), ident.span())
Ident::new(
&format!("__component_{}", ident.to_string().to_case(Snake)),
ident.span(),
)
}
/// Converts all `impl Trait`s in a function signature to use generic params instead.

View File

@@ -3,30 +3,75 @@ use proc_macro::TokenStream;
use proc_macro2::Ident;
use proc_macro_error2::abort;
use quote::quote;
use syn::{spanned::Spanned, ItemFn};
use std::{
hash::{DefaultHasher, Hash, Hasher},
mem,
};
use syn::{parse_macro_input, ItemFn};
pub fn lazy_impl(
_args: proc_macro::TokenStream,
s: TokenStream,
) -> TokenStream {
let fun = syn::parse::<ItemFn>(s).unwrap_or_else(|e| {
pub fn lazy_impl(args: proc_macro::TokenStream, s: TokenStream) -> TokenStream {
let name = if !args.is_empty() {
Some(parse_macro_input!(args as syn::Ident))
} else {
None
};
let mut fun = syn::parse::<ItemFn>(s).unwrap_or_else(|e| {
abort!(e.span(), "`lazy` can only be used on a function")
});
if fun.sig.asyncness.is_none() {
abort!(
fun.sig.asyncness.span(),
"`lazy` can only be used on an async function"
let was_async = fun.sig.asyncness.is_some();
let converted_name = name.unwrap_or_else(|| {
Ident::new(
&fun.sig.ident.to_string().to_case(Case::Snake),
fun.sig.ident.span(),
)
}
});
let converted_name = Ident::new(
&fun.sig.ident.to_string().to_case(Case::Snake),
fun.sig.ident.span(),
);
let (unique_name, unique_name_str) = {
let span = proc_macro::Span::call_site();
let location = (span.line(), span.start().column(), span.file());
quote! {
#[cfg_attr(feature = "split", wasm_split::wasm_split(#converted_name))]
#fun
let mut hasher = DefaultHasher::new();
location.hash(&mut hasher);
let hash = hasher.finish();
let unique_name_str = format!("{converted_name}_{hash}");
(
Ident::new(&unique_name_str, converted_name.span()),
unique_name_str,
)
};
let is_wasm = cfg!(feature = "csr") || cfg!(feature = "hydrate");
if is_wasm {
quote! {
#[::leptos::wasm_split_helpers::wasm_split(
#unique_name,
::leptos::__reexports::send_wrapper
)]
#fun
}
} else {
if !was_async {
fun.sig.asyncness = Some(Default::default());
}
let statements = &mut fun.block.stmts;
let old_statements = mem::take(statements);
statements.push(
syn::parse(
quote! {
::leptos::prefetch_lazy_fn_on_server(#unique_name_str);
}
.into(),
)
.unwrap(),
);
statements.extend(old_statements);
quote! { #fun }
}
.into()
}

View File

@@ -576,7 +576,7 @@ pub fn component(args: proc_macro::TokenStream, s: TokenStream) -> TokenStream {
false
};
component_macro(s, is_transparent, None)
component_macro(s, is_transparent, false, None)
}
/// Defines a component as an interactive island when you are using the
@@ -653,36 +653,41 @@ pub fn component(args: proc_macro::TokenStream, s: TokenStream) -> TokenStream {
#[proc_macro_error2::proc_macro_error]
#[proc_macro_attribute]
pub fn island(args: proc_macro::TokenStream, s: TokenStream) -> TokenStream {
let is_transparent = if !args.is_empty() {
let transparent = parse_macro_input!(args as syn::Ident);
let (is_transparent, is_lazy) = if !args.is_empty() {
let arg = parse_macro_input!(args as syn::Ident);
if transparent != "transparent" {
if arg != "transparent" && arg != "lazy" {
abort!(
transparent,
"only `transparent` is supported";
help = "try `#[island(transparent)]` or `#[island]`"
arg,
"only `transparent` or `lazy` are supported";
help = "try `#[island(transparent)]`, `#[island(lazy)]`, or `#[island]`"
);
}
true
(arg == "transparent", arg == "lazy")
} else {
false
(false, false)
};
let island_src = s.to_string();
component_macro(s, is_transparent, Some(island_src))
component_macro(s, is_transparent, is_lazy, Some(island_src))
}
fn component_macro(
s: TokenStream,
is_transparent: bool,
is_lazy: bool,
island: Option<String>,
) -> TokenStream {
let mut dummy = syn::parse::<DummyModel>(s.clone());
let parse_result = syn::parse::<component::Model>(s);
if let (Ok(ref mut unexpanded), Ok(model)) = (&mut dummy, parse_result) {
let expanded = model.is_transparent(is_transparent).with_island(island).into_token_stream();
let expanded = model
.is_transparent(is_transparent)
.is_lazy(is_lazy)
.with_island(island)
.into_token_stream();
if !matches!(unexpanded.vis, Visibility::Public(_)) {
unexpanded.vis = Visibility::Public(Pub {
span: unexpanded.vis.span(),
@@ -690,11 +695,12 @@ fn component_macro(
}
unexpanded.sig.ident =
unmodified_fn_name_from_fn_name(&unexpanded.sig.ident);
quote! {
#expanded
#[doc(hidden)]
#[allow(non_snake_case, dead_code, clippy::too_many_arguments, clippy::needless_lifetimes)]
#[allow(clippy::too_many_arguments, clippy::needless_lifetimes)]
#unexpanded
}
} else {
@@ -703,7 +709,7 @@ fn component_macro(
dummy.sig.ident = unmodified_fn_name_from_fn_name(&dummy.sig.ident);
quote! {
#[doc(hidden)]
#[allow(non_snake_case, dead_code, clippy::too_many_arguments, clippy::needless_lifetimes)]
#[allow(clippy::too_many_arguments, clippy::needless_lifetimes)]
#dummy
}
}
@@ -1028,14 +1034,41 @@ pub fn memo(input: TokenStream) -> TokenStream {
memo::memo_impl(input)
}
/// The `#[lazy]` macro marks an `async` function as a function that can be lazy-loaded from a
/// separate (WebAssembly) binary.
/// The `#[lazy]` macro indicates that a function can be lazy-loaded from a separate WebAssembly (WASM) binary.
///
/// The first time the function is called, calling the function will first load that other binary,
/// then call the function. On subsequent call it will be called immediately, but still return
/// then call the function. On subsequent calls it will be called immediately, but still return
/// asynchronously to maintain the same API.
///
/// All parameters and output types should be concrete types, with no generics.
/// `#[lazy]` can be used to annotate synchronous or `async` functions. In both cases, the final function will be
/// `async` and must be called as such.
///
/// All parameters and output types should be concrete types, with no generics or `impl Trait` types.
///
/// This should be used in tandem with a suitable build process, such as `cargo leptos --split`.
///
/// ```rust
/// # use leptos_macro::lazy;
///
/// #[lazy]
/// fn lazy_synchronous_function() -> String {
/// "Hello, lazy world!".to_string()
/// }
///
/// #[lazy]
/// async fn lazy_async_function() -> String {
/// /* do something that requires async work */
/// "Hello, lazy async world!".to_string()
/// }
///
/// async fn use_lazy_functions() {
/// // synchronous function has been converted to async
/// let value1 = lazy_synchronous_function().await;
///
/// // async function is still async
/// let value1 = lazy_async_function().await;
/// }
/// ```
#[proc_macro_attribute]
#[proc_macro_error]
pub fn lazy(args: proc_macro::TokenStream, s: TokenStream) -> TokenStream {

View File

@@ -1,6 +1,6 @@
[package]
name = "leptos_server"
version = { workspace = true }
version = "0.8.5"
authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
@@ -11,11 +11,11 @@ edition.workspace = true
[dependencies]
base64 = { workspace = true, default-features = true }
codee = { features = ["json_serde"] , workspace = true, default-features = true }
codee = { features = ["json_serde"], workspace = true, default-features = true }
hydration_context = { workspace = true }
reactive_graph = { workspace = true, features = ["hydration"] }
server_fn = { workspace = true }
tracing = { optional = true , workspace = true, default-features = true }
tracing = { optional = true, workspace = true, default-features = true }
futures = { workspace = true, default-features = true }
any_spawner = { workspace = true }
@@ -25,9 +25,9 @@ send_wrapper = { workspace = true, default-features = true }
# serialization formats
serde = { workspace = true, default-features = true }
js-sys = { optional = true , workspace = true, default-features = true }
wasm-bindgen = { workspace = true, optional = true , default-features = true }
serde_json = { workspace = true , default-features = true }
js-sys = { optional = true, workspace = true, default-features = true }
wasm-bindgen = { workspace = true, optional = true, default-features = true }
serde_json = { workspace = true, default-features = true }
[features]
ssr = []
@@ -44,7 +44,8 @@ denylist = ["tracing"]
max_combination_size = 2
[package.metadata.docs.rs]
rustdoc-args = ["--generate-link-to-definition"]
rustdoc-args = ["--generate-link-to-definition", "--cfg", "docsrs"]
all-features = true
[lints.rust]
unexpected_cfgs = { level = "warn", check-cfg = ['cfg(leptos_debuginfo)'] }

View File

@@ -386,6 +386,7 @@ T: Send + Sync + 'static,
}
#[cfg(feature = "serde-wasm-bindgen")]
#[cfg_attr(docsrs, doc(cfg(feature = "serde-wasm-bindgen")))]
impl<T> ArcOnceResource<T, JsonSerdeWasmCodec>
where
T: Send + Sync + 'static,
@@ -418,6 +419,7 @@ fut: impl Future<Output = T> + Send + 'static
}
}
#[cfg(feature = "miniserde")]
#[cfg_attr(docsrs, doc(cfg(feature = "miniserde")))]
impl<T> ArcOnceResource<T, MiniserdeCodec>
where
T: Send + Sync + 'static,
@@ -451,6 +453,7 @@ where
}
#[cfg(feature = "serde-lite")]
#[cfg_attr(docsrs, doc(cfg(feature = "serde-lite")))]
impl<T> ArcOnceResource<T, SerdeLite<JsonSerdeCodec>>
where
T: Send + Sync + 'static,
@@ -484,6 +487,7 @@ fut: impl Future<Output = T> + Send + 'static
}
#[cfg(feature = "rkyv")]
#[cfg_attr(docsrs, doc(cfg(feature = "rkyv")))]
impl<T> ArcOnceResource<T, RkyvCodec>
where
T: Send + Sync + 'static,
@@ -748,6 +752,7 @@ T: Send + Sync + 'static,
}
#[cfg(feature = "serde-wasm-bindgen")]
#[cfg_attr(docsrs, doc(cfg(feature = "serde-wasm-bindgen")))]
impl<T> OnceResource<T, JsonSerdeWasmCodec>
where
T: Send + Sync + 'static,
@@ -780,6 +785,7 @@ fut: impl Future<Output = T> + Send + 'static
}
}
#[cfg(feature = "miniserde")]
#[cfg_attr(docsrs, doc(cfg(feature = "miniserde")))]
impl<T> OnceResource<T, MiniserdeCodec>
where
T: Send + Sync + 'static,
@@ -813,6 +819,7 @@ where
}
#[cfg(feature = "serde-lite")]
#[cfg_attr(docsrs, doc(cfg(feature = "serde-lite")))]
impl<T> OnceResource<T, SerdeLite<JsonSerdeCodec>>
where
T: Send + Sync + 'static,
@@ -846,6 +853,7 @@ fut: impl Future<Output = T> + Send + 'static
}
#[cfg(feature = "rkyv")]
#[cfg_attr(docsrs, doc(cfg(feature = "rkyv")))]
impl<T> OnceResource<T, RkyvCodec>
where
T: Send + Sync + 'static,

View File

@@ -709,6 +709,7 @@ where
}
#[cfg(feature = "rkyv")]
#[cfg_attr(docsrs, doc(cfg(feature = "rkyv")))]
impl<T> ArcResource<T, RkyvCodec>
where
RkyvCodec: Encoder<T> + Decoder<T>,
@@ -1048,6 +1049,7 @@ where
}
#[cfg(feature = "serde-wasm-bindgen")]
#[cfg_attr(docsrs, doc(cfg(feature = "serde-wasm-bindgen")))]
impl<T> Resource<T, JsonSerdeWasmCodec>
where
JsonSerdeWasmCodec: Encoder<T> + Decoder<T>,
@@ -1105,6 +1107,7 @@ where
}
#[cfg(feature = "miniserde")]
#[cfg_attr(docsrs, doc(cfg(feature = "miniserde")))]
impl<T> Resource<T, MiniserdeCodec>
where
MiniserdeCodec: Encoder<T> + Decoder<T>,
@@ -1164,6 +1167,7 @@ where
}
#[cfg(feature = "serde-lite")]
#[cfg_attr(docsrs, doc(cfg(feature = "serde-lite")))]
impl<T> Resource<T, SerdeLite<JsonSerdeCodec>>
where
SerdeLite<JsonSerdeCodec>: Encoder<T> + Decoder<T>,
@@ -1222,6 +1226,7 @@ where
}
#[cfg(feature = "rkyv")]
#[cfg_attr(docsrs, doc(cfg(feature = "rkyv")))]
impl<T> Resource<T, RkyvCodec>
where
RkyvCodec: Encoder<T> + Decoder<T>,

View File

@@ -80,6 +80,7 @@ where
}
#[cfg(feature = "serde-lite")]
#[cfg_attr(docsrs, doc(cfg(feature = "serde-lite")))]
impl<T> SharedValue<T, SerdeLite<JsonSerdeCodec>>
where
SerdeLite<JsonSerdeCodec>: Encoder<T> + Decoder<T>,
@@ -102,6 +103,7 @@ where
}
#[cfg(feature = "serde-wasm-bindgen")]
#[cfg_attr(docsrs, doc(cfg(feature = "serde-wasm-bindgen")))]
impl<T> SharedValue<T, JsonSerdeWasmCodec>
where
JsonSerdeWasmCodec: Encoder<T> + Decoder<T>,
@@ -124,6 +126,7 @@ where
}
#[cfg(feature = "miniserde")]
#[cfg_attr(docsrs, doc(cfg(feature = "miniserde")))]
impl<T> SharedValue<T, MiniserdeCodec>
where
MiniserdeCodec: Encoder<T> + Decoder<T>,
@@ -146,6 +149,7 @@ where
}
#[cfg(feature = "rkyv")]
#[cfg_attr(docsrs, doc(cfg(feature = "rkyv")))]
impl<T> SharedValue<T, RkyvCodec>
where
RkyvCodec: Encoder<T> + Decoder<T>,

View File

@@ -1,6 +1,6 @@
[package]
name = "leptos_meta"
version = "0.8.4"
version = "0.8.5"
authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"

View File

@@ -1,6 +1,6 @@
[package]
name = "oco_ref"
version = "0.2.0"
version = "0.2.1"
authors = ["Danik Vitek", "Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
@@ -10,7 +10,7 @@ edition.workspace = true
[dependencies]
serde = { workspace = true, default-features = true }
thiserror = { workspace = true , default-features = true }
thiserror = { workspace = true, default-features = true }
[dev-dependencies]
serde_json = { workspace = true , default-features = true }
serde_json = { workspace = true, default-features = true }

View File

@@ -1,6 +1,6 @@
[package]
name = "reactive_graph"
version = "0.2.4"
version = "0.2.7"
authors = ["Greg Johnston"]
license = "MIT"
readme = "../README.md"
@@ -27,6 +27,8 @@ async-lock = { workspace = true, default-features = true }
send_wrapper = { features = [
"futures",
], workspace = true, default-features = true }
subsecond = { workspace = true, default-features = true, optional = true }
indexmap = { workspace = true, default-features = true }
[target.'cfg(all(target_arch = "wasm32", target_os = "unknown"))'.dependencies]
web-sys = { version = "0.3.77", features = ["console"] }
@@ -50,6 +52,7 @@ hydration = ["dep:hydration_context"]
effects = [
] # whether to run effects: should be disabled for something like server rendering
sandboxed-arenas = []
subsecond = ["dep:subsecond"]
[package.metadata.docs.rs]
all-features = true

View File

@@ -1,7 +1,8 @@
use crate::{
computed::{ArcMemo, Memo},
computed::{ArcMemo, Memo, ScopedFuture},
diagnostics::is_suppressing_resource_load,
owner::{ArcStoredValue, ArenaItem},
graph::untrack,
owner::{ArcStoredValue, ArenaItem, Owner},
send_wrapper_ext::SendOption,
signal::{ArcMappedSignal, ArcRwSignal, MappedSignal, RwSignal},
traits::{DefinedAt, Dispose, Get, GetUntracked, GetValue, Update, Write},
@@ -199,13 +200,18 @@ where
I: Send + Sync,
O: Send + Sync,
{
let owner = Owner::current().unwrap_or_default();
ArcAction {
in_flight: ArcRwSignal::new(0),
input: ArcRwSignal::new(SendOption::new(None)),
value: ArcRwSignal::new(SendOption::new(value)),
version: Default::default(),
dispatched: Default::default(),
action_fn: Arc::new(move |input| Box::pin(action_fn(input))),
action_fn: Arc::new(move |input| {
Box::pin(owner.with(|| {
ScopedFuture::new_untracked(untrack(|| action_fn(input)))
}))
}),
#[cfg(any(debug_assertions, leptos_debuginfo))]
defined_at: Location::caller(),
}
@@ -370,6 +376,7 @@ where
F: Fn(&I) -> Fu + 'static,
Fu: Future<Output = O> + 'static,
{
let owner = Owner::current().unwrap_or_default();
let action_fn = SendWrapper::new(action_fn);
ArcAction {
in_flight: ArcRwSignal::new(0),
@@ -378,7 +385,9 @@ where
version: Default::default(),
dispatched: Default::default(),
action_fn: Arc::new(move |input| {
Box::pin(SendWrapper::new(action_fn(input)))
Box::pin(SendWrapper::new(owner.with(|| {
ScopedFuture::new_untracked(untrack(|| action_fn(input)))
})))
}),
#[cfg(any(debug_assertions, leptos_debuginfo))]
defined_at: Location::caller(),

View File

@@ -521,9 +521,10 @@ impl<T: 'static> ArcAsyncDerived<T> {
{
let fun = move || {
let fut = fun();
let fut = ScopedFuture::new_untracked(async move {
SendOption::new(Some(fut.await))
});
let fut =
ScopedFuture::new_untracked_with_diagnostics(async move {
SendOption::new(Some(fut.await))
});
#[cfg(feature = "sandboxed-arenas")]
let fut = Sandboxed::new(fut);
fut

View File

@@ -54,11 +54,55 @@ impl<Fut> ScopedFuture<Fut> {
fut,
}
}
#[doc(hidden)]
#[track_caller]
pub fn new_untracked_with_diagnostics(
fut: Fut,
) -> ScopedFutureUntrackedWithDiagnostics<Fut> {
let owner = Owner::current().unwrap_or_default();
ScopedFutureUntrackedWithDiagnostics {
owner,
observer: None,
fut,
}
}
}
impl<Fut: Future> Future for ScopedFuture<Fut> {
type Output = Fut::Output;
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.project();
this.owner.with(|| {
#[cfg(debug_assertions)]
let _maybe_guard = if this.observer.is_none() {
Some(crate::diagnostics::SpecialNonReactiveZone::enter())
} else {
None
};
this.observer.with_observer(|| this.fut.poll(cx))
})
}
}
pin_project! {
/// A [`Future`] wrapper that sets the [`Owner`] and [`Observer`] before polling the inner
/// `Future`, output of [`ScopedFuture::new_untracked_with_diagnostics`].
///
/// In leptos 0.9 this will be replaced with `ScopedFuture` itself.
#[derive(Clone)]
pub struct ScopedFutureUntrackedWithDiagnostics<Fut> {
owner: Owner,
observer: Option<AnySubscriber>,
#[pin]
fut: Fut,
}
}
impl<Fut: Future> Future for ScopedFutureUntrackedWithDiagnostics<Fut> {
type Output = Fut::Output;
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.project();
this.owner

View File

@@ -9,9 +9,13 @@ use crate::{
};
use futures::StreamExt;
use or_poisoned::OrPoisoned;
#[cfg(feature = "subsecond")]
use std::sync::Mutex;
use std::{
fmt::Debug,
future::{Future, IntoFuture},
mem,
pin::Pin,
sync::{Arc, RwLock, Weak},
};
@@ -47,13 +51,39 @@ impl<T> Debug for RenderEffect<T> {
}
}
#[cfg(feature = "subsecond")]
type CurrentHotPtr = Box<dyn Fn() -> Option<subsecond::HotFnPtr> + Send + Sync>;
impl<T> RenderEffect<T>
where
T: 'static,
{
/// Creates a new render effect, which immediately runs `fun`.
pub fn new(fun: impl FnMut(Option<T>) -> T + 'static) -> Self {
Self::new_with_value_erased(Box::new(fun), None)
#[cfg(feature = "subsecond")]
let (hot_fn_ptr, fun) = {
let fun = Arc::new(Mutex::new(subsecond::HotFn::current(fun)));
(
{
let fun = Arc::downgrade(&fun);
let wrapped = send_wrapper::SendWrapper::new(move || {
fun.upgrade()
.map(|n| n.lock().or_poisoned().ptr_address())
});
// it's not redundant, it's due to the SendWrapper deref
#[allow(clippy::redundant_closure)]
Box::new(move || wrapped())
},
move |prev| fun.lock().or_poisoned().call((prev,)),
)
};
Self::new_with_value_erased(
Box::new(fun),
None,
#[cfg(feature = "subsecond")]
hot_fn_ptr,
)
}
/// Creates a new render effect with an initial value.
@@ -61,12 +91,57 @@ where
fun: impl FnMut(Option<T>) -> T + 'static,
initial_value: Option<T>,
) -> Self {
Self::new_with_value_erased(Box::new(fun), initial_value)
#[cfg(feature = "subsecond")]
let (hot_fn_ptr, fun) = {
let fun = Arc::new(Mutex::new(subsecond::HotFn::current(fun)));
(
{
let fun = Arc::downgrade(&fun);
let wrapped = send_wrapper::SendWrapper::new(move || {
fun.upgrade()
.map(|n| n.lock().or_poisoned().ptr_address())
});
// it's not redundant, it's due to the SendWrapper deref
#[allow(clippy::redundant_closure)]
Box::new(move || wrapped())
},
move |prev| fun.lock().or_poisoned().call((prev,)),
)
};
Self::new_with_value_erased(
Box::new(fun),
initial_value,
#[cfg(feature = "subsecond")]
hot_fn_ptr,
)
}
/// Creates a new render effect, which immediately runs `fun`.
pub async fn new_with_async_value(
fun: impl FnMut(Option<T>) -> T + 'static,
value: impl IntoFuture<Output = T> + 'static,
) -> Self {
#[cfg(feature = "subsecond")]
let mut fun = subsecond::HotFn::current(fun);
#[cfg(feature = "subsecond")]
let fun = move |prev| fun.call((prev,));
Self::new_with_async_value_erased(
Box::new(fun),
Box::pin(value.into_future()),
)
.await
}
fn new_with_value_erased(
mut fun: Box<dyn FnMut(Option<T>) -> T + 'static>,
#[allow(unused_mut)] mut fun: Box<dyn FnMut(Option<T>) -> T + 'static>,
initial_value: Option<T>,
// this argument can be used to invalidate individual effects in the future
// in present experiments, I have found that it is not actually granular enough to make a difference
#[allow(unused)]
#[cfg(feature = "subsecond")]
hot_fn_ptr: CurrentHotPtr,
) -> Self {
// codegen optimisation:
fn prep() -> (Owner, Arc<RwLock<EffectInner>>, crate::channel::Receiver)
@@ -90,12 +165,56 @@ where
let _ = initial_value;
let _ = owner;
let _ = &mut rx;
let _ = &mut fun;
let _ = fun;
}
#[cfg(feature = "effects")]
{
let subscriber = inner.to_any_subscriber();
#[cfg(all(feature = "subsecond", debug_assertions))]
let mut fun = {
use crate::graph::ReactiveNode;
use rustc_hash::FxHashMap;
use std::sync::{Arc, LazyLock, Mutex};
use subsecond::HotFnPtr;
static HOT_RELOAD_SUBSCRIBERS: LazyLock<
Mutex<FxHashMap<AnySubscriber, (HotFnPtr, CurrentHotPtr)>>,
> = LazyLock::new(|| {
subsecond::register_handler(Arc::new(|| {
HOT_RELOAD_SUBSCRIBERS.lock().or_poisoned().retain(
|subscriber, (prev_ptr, hot_fn_ptr)| {
match hot_fn_ptr() {
None => false,
Some(curr_hot_ptr) => {
if curr_hot_ptr != *prev_ptr {
crate::log_warning(format_args!(
"{prev_ptr:?} <> \
{curr_hot_ptr:?}",
));
*prev_ptr = curr_hot_ptr;
subscriber.mark_dirty();
}
true
}
}
},
);
}));
Default::default()
});
let mut fun = subsecond::HotFn::current(fun);
let initial_ptr = hot_fn_ptr().unwrap();
HOT_RELOAD_SUBSCRIBERS
.lock()
.or_poisoned()
.insert(subscriber.clone(), (initial_ptr, hot_fn_ptr));
move |prev| fun.call((prev,))
};
*value.write().or_poisoned() = Some(
owner.with(|| subscriber.with_observer(|| fun(initial_value))),
);
@@ -127,6 +246,73 @@ where
RenderEffect { value, inner }
}
async fn new_with_async_value_erased(
mut fun: Box<dyn FnMut(Option<T>) -> T + 'static>,
initial_value: Pin<Box<dyn Future<Output = T>>>,
) -> Self {
// codegen optimisation:
fn prep() -> (Owner, Arc<RwLock<EffectInner>>, crate::channel::Receiver)
{
let (observer, rx) = channel();
let owner = Owner::new();
let inner = Arc::new(RwLock::new(EffectInner {
dirty: false,
observer,
sources: SourceSet::new(),
}));
(owner, inner, rx)
}
let (owner, inner, mut rx) = prep();
let value = Arc::new(RwLock::new(None::<T>));
#[cfg(not(feature = "effects"))]
{
drop(initial_value);
let _ = owner;
let _ = &mut rx;
let _ = &mut fun;
}
#[cfg(feature = "effects")]
{
use crate::computed::ScopedFuture;
let subscriber = inner.to_any_subscriber();
let initial = subscriber
.with_observer(|| ScopedFuture::new(initial_value))
.await;
*value.write().or_poisoned() = Some(initial);
any_spawner::Executor::spawn_local({
let value = Arc::clone(&value);
async move {
while rx.next().await.is_some() {
if !owner.paused()
&& subscriber.with_observer(|| {
subscriber.update_if_necessary()
})
{
subscriber.clear_sources(&subscriber);
let old_value =
mem::take(&mut *value.write().or_poisoned());
let new_value = owner.with_cleanup(|| {
subscriber.with_observer(|| fun(old_value))
});
*value.write().or_poisoned() = Some(new_value);
}
}
}
});
}
RenderEffect { value, inner }
}
/// Mutably accesses the current value.
pub fn with_value_mut<U>(
&self,
@@ -149,6 +335,11 @@ where
pub fn new_isomorphic(
fun: impl FnMut(Option<T>) -> T + Send + Sync + 'static,
) -> Self {
#[cfg(feature = "subsecond")]
let mut fun = subsecond::HotFn::current(fun);
#[cfg(feature = "subsecond")]
let fun = move |prev| fun.call((prev,));
fn erased<T: Send + Sync + 'static>(
mut fun: Box<dyn FnMut(Option<T>) -> T + Send + Sync + 'static>,
) -> RenderEffect<T> {

View File

@@ -6,11 +6,14 @@
//! a linear search is not significantly more expensive than a hash and lookup.
use super::{AnySource, AnySubscriber, Source};
use core::slice;
use std::{mem, vec::IntoIter};
use indexmap::IndexSet;
use rustc_hash::FxHasher;
use std::{hash::BuildHasherDefault, mem};
type FxIndexSet<T> = IndexSet<T, BuildHasherDefault<FxHasher>>;
#[derive(Default, Clone, Debug)]
pub struct SourceSet(Vec<AnySource>);
pub struct SourceSet(FxIndexSet<AnySource>);
impl SourceSet {
pub fn new() -> Self {
@@ -18,16 +21,14 @@ impl SourceSet {
}
pub fn insert(&mut self, source: AnySource) {
self.0.push(source);
self.0.insert(source);
}
pub fn remove(&mut self, source: &AnySource) {
if let Some(pos) = self.0.iter().position(|s| s == source) {
self.0.remove(pos);
}
self.0.shift_remove(source);
}
pub fn take(&mut self) -> Vec<AnySource> {
pub fn take(&mut self) -> FxIndexSet<AnySource> {
mem::take(&mut self.0)
}
@@ -44,7 +45,7 @@ impl SourceSet {
impl IntoIterator for SourceSet {
type Item = AnySource;
type IntoIter = IntoIter<AnySource>;
type IntoIter = <FxIndexSet<AnySource> as IntoIterator>::IntoIter;
fn into_iter(self) -> Self::IntoIter {
self.0.into_iter()
@@ -53,40 +54,36 @@ impl IntoIterator for SourceSet {
impl<'a> IntoIterator for &'a SourceSet {
type Item = &'a AnySource;
type IntoIter = slice::Iter<'a, AnySource>;
type IntoIter = <&'a FxIndexSet<AnySource> as IntoIterator>::IntoIter;
fn into_iter(self) -> Self::IntoIter {
self.0.iter()
}
}
#[derive(Debug, Default, Clone)]
pub struct SubscriberSet(Vec<AnySubscriber>);
pub struct SubscriberSet(FxIndexSet<AnySubscriber>);
impl SubscriberSet {
pub fn new() -> Self {
Self(Vec::with_capacity(2))
Self(FxIndexSet::with_capacity_and_hasher(2, Default::default()))
}
pub fn subscribe(&mut self, subscriber: AnySubscriber) {
if !self.0.contains(&subscriber) {
self.0.push(subscriber);
}
self.0.insert(subscriber);
}
pub fn unsubscribe(&mut self, subscriber: &AnySubscriber) {
if let Some(pos) = self.0.iter().position(|s| s == subscriber) {
// note: do not use `.swap_remove()` here.
// using `.remove()` is slower because it shifts other items
// but it maintains the order of the subscribers, which is important
// to correctness when you're using this to drive something like a UI,
// which can have nested effects, where the inner one assumes the outer
// has already run (for example, an outer effect that checks .is_some(),
// and an inner effect that unwraps)
self.0.remove(pos);
}
// note: do not use `.swap_remove()` here.
// using `.remove()` is slower because it shifts other items
// but it maintains the order of the subscribers, which is important
// to correctness when you're using this to drive something like a UI,
// which can have nested effects, where the inner one assumes the outer
// has already run (for example, an outer effect that checks .is_some(),
// and an inner effect that unwraps)
self.0.shift_remove(subscriber);
}
pub fn take(&mut self) -> Vec<AnySubscriber> {
pub fn take(&mut self) -> FxIndexSet<AnySubscriber> {
mem::take(&mut self.0)
}
@@ -97,7 +94,7 @@ impl SubscriberSet {
impl IntoIterator for SubscriberSet {
type Item = AnySubscriber;
type IntoIter = IntoIter<AnySubscriber>;
type IntoIter = <FxIndexSet<AnySubscriber> as IntoIterator>::IntoIter;
fn into_iter(self) -> Self::IntoIter {
self.0.into_iter()
@@ -106,7 +103,7 @@ impl IntoIterator for SubscriberSet {
impl<'a> IntoIterator for &'a SubscriberSet {
type Item = &'a AnySubscriber;
type IntoIter = slice::Iter<'a, AnySubscriber>;
type IntoIter = <&'a FxIndexSet<AnySubscriber> as IntoIterator>::IntoIter;
fn into_iter(self) -> Self::IntoIter {
self.0.iter()

Some files were not shown because too many files have changed in this diff Show More