Compare commits

..

1 Commits

Author SHA1 Message Date
Greg Johnston
bd4140b7a3 fix: schedule ActionForm submit handler to run after user submit handlers (closes #3872) 2025-07-03 13:25:14 -04:00
204 changed files with 1341 additions and 6229 deletions

View File

@@ -17,10 +17,11 @@ env:
jobs:
autofix:
runs-on: ubuntu-latest
timeout-minutes: 30
steps:
- uses: actions/checkout@v5
- uses: actions/checkout@v4
- uses: actions-rust-lang/setup-rust-toolchain@v1
with: {toolchain: "nightly-2025-07-16", components: "rustfmt, clippy", target: "wasm32-unknown-unknown", rustflags: ""}
with: {toolchain: "nightly-2025-04-16", components: "rustfmt, clippy", target: "wasm32-unknown-unknown", rustflags: ""}
- name: Install Glib
run: |
sudo apt-get update

View File

@@ -63,6 +63,6 @@ jobs:
sudo apt-get update
sudo apt-get install -y libglib2.0-dev
- name: Checkout
uses: actions/checkout@v5
uses: actions/checkout@v4
- name: Semver Checks
uses: obi1kenobi/cargo-semver-checks-action@v2

View File

@@ -19,7 +19,7 @@ jobs:
matrix: ${{ steps.set-example-changed.outputs.matrix }}
steps:
- name: Checkout
uses: actions/checkout@v5
uses: actions/checkout@v4
with:
fetch-depth: 0
- name: Get example files that changed

View File

@@ -17,7 +17,7 @@ jobs:
EXCLUDED_EXAMPLES: cargo-make
steps:
- name: Checkout
uses: actions/checkout@v5
uses: actions/checkout@v4
- name: Install jq
run: sudo apt-get install jq
- name: Set Matrix

View File

@@ -13,7 +13,7 @@ jobs:
leptos_changed: ${{ steps.set-source-changed.outputs.leptos_changed }}
steps:
- name: Checkout
uses: actions/checkout@v5
uses: actions/checkout@v4
with:
fetch-depth: 0
- name: Get source files that changed

View File

@@ -13,7 +13,7 @@ jobs:
matrix: ${{ steps.set-matrix.outputs.matrix }}
steps:
- name: Checkout
uses: actions/checkout@v5
uses: actions/checkout@v4
- name: Install jq
run: sudo apt-get install jq
- name: Set Matrix

View File

@@ -12,7 +12,7 @@ jobs:
contents: write # To push a branch
pull-requests: write # To create a PR from that branch
steps:
- uses: actions/checkout@v5
- uses: actions/checkout@v4
with:
fetch-depth: 0
- name: Install mdbook

View File

@@ -18,7 +18,7 @@ jobs:
runs-on: ubuntu-latest
strategy:
matrix:
toolchain: [stable, nightly-2025-07-16]
toolchain: [stable, nightly-2025-04-16]
erased_mode: [true, false]
steps:
- name: Free Disk Space
@@ -53,7 +53,7 @@ jobs:
run: |
sudo apt-get update
sudo apt-get install -y libglib2.0-dev
- uses: actions/checkout@v5
- uses: actions/checkout@v4
- name: Setup Rust
uses: dtolnay/rust-toolchain@master
with:
@@ -169,9 +169,7 @@ jobs:
cd '${{ inputs.directory }}'
cargo make --no-workspace --profile=github-actions ci
# check the direct-minimal-versions on release
COMMIT_MSG=$(git log -1 --pretty=format:'%s')
# Supports: v1.2.3, v1.2.3-alpha, v1.2.3-beta1, v1.2.3-rc.1, etc.
if [[ "$COMMIT_MSG" =~ ^v[0-9]+\.[0-9]+\.[0-9]+(-[a-zA-Z0-9]+(\.?[0-9]+)?)?$ ]]; then
if [[ "${{ github.ref_name }}" =~ ^v[0-9]+\.[0-9]+\.[0-9]+$ ]]; then
cargo make --no-workspace --profile=github-actions check-minimal-versions
fi
# Check if the counter_isomorphic can be built with leptos_debuginfo cfg flag in release mode

1238
Cargo.lock generated

File diff suppressed because it is too large Load Diff

View File

@@ -40,49 +40,47 @@ members = [
exclude = ["benchmarks", "examples", "projects"]
[workspace.package]
version = "0.8.2"
edition = "2021"
rust-version = "1.88"
rust-version = "1.80"
[workspace.dependencies]
# members
throw_error = { path = "./any_error/", version = "0.3.0" }
any_spawner = { path = "./any_spawner/", version = "0.3.0" }
const_str_slice_concat = { path = "./const_str_slice_concat", version = "0.1" }
either_of = { path = "./either_of/", version = "0.1.6" }
either_of = { path = "./either_of/", version = "0.1.5" }
hydration_context = { path = "./hydration_context", version = "0.3.0" }
leptos = { path = "./leptos", version = "0.8.9" }
leptos_config = { path = "./leptos_config", version = "0.8.7" }
leptos_dom = { path = "./leptos_dom", version = "0.8.6" }
leptos_hot_reload = { path = "./leptos_hot_reload", version = "0.8.5" }
leptos_integration_utils = { path = "./integrations/utils", version = "0.8.5" }
leptos_macro = { path = "./leptos_macro", version = "0.8.8" }
leptos_router = { path = "./router", version = "0.8.7" }
leptos_router_macro = { path = "./router_macro", version = "0.8.5" }
leptos_server = { path = "./leptos_server", version = "0.8.5" }
leptos_meta = { path = "./meta", version = "0.8.5" }
leptos = { path = "./leptos", version = "0.8.2" }
leptos_config = { path = "./leptos_config", version = "0.8.2" }
leptos_dom = { path = "./leptos_dom", version = "0.8.2" }
leptos_hot_reload = { path = "./leptos_hot_reload", version = "0.8.2" }
leptos_integration_utils = { path = "./integrations/utils", version = "0.8.2" }
leptos_macro = { path = "./leptos_macro", version = "0.8.2" }
leptos_router = { path = "./router", version = "0.8.2" }
leptos_router_macro = { path = "./router_macro", version = "0.8.2" }
leptos_server = { path = "./leptos_server", version = "0.8.2" }
leptos_meta = { path = "./meta", version = "0.8.2" }
next_tuple = { path = "./next_tuple", version = "0.1.0" }
oco_ref = { path = "./oco", version = "0.2.1" }
oco_ref = { path = "./oco", version = "0.2.0" }
or_poisoned = { path = "./or_poisoned", version = "0.1.0" }
reactive_graph = { path = "./reactive_graph", version = "0.2.7" }
reactive_stores = { path = "./reactive_stores", version = "0.2.5" }
reactive_stores_macro = { path = "./reactive_stores_macro", version = "0.2.6" }
server_fn = { path = "./server_fn", version = "0.8.7" }
server_fn_macro = { path = "./server_fn_macro", version = "0.8.7" }
server_fn_macro_default = { path = "./server_fn/server_fn_macro_default", version = "0.8.5" }
tachys = { path = "./tachys", version = "0.2.8" }
wasm_split_helpers = { path = "./wasm_split", version = "0.1.2" }
wasm_split_macros = { path = "./wasm_split_macros", version = "0.1.3" }
reactive_graph = { path = "./reactive_graph", version = "0.2.0" }
reactive_stores = { path = "./reactive_stores", version = "0.2.0" }
reactive_stores_macro = { path = "./reactive_stores_macro", version = "0.2.0" }
server_fn = { path = "./server_fn", version = "0.8.2" }
server_fn_macro = { path = "./server_fn_macro", version = "0.8.2" }
server_fn_macro_default = { path = "./server_fn/server_fn_macro_default", version = "0.8.2" }
tachys = { path = "./tachys", version = "0.2.0" }
# members deps
async-once-cell = { default-features = false, version = "0.5.3" }
itertools = { default-features = false, version = "0.14.0" }
convert_case = { default-features = false, version = "0.8.0" }
serde_json = { default-features = false, version = "1.0.143" }
trybuild = { default-features = false, version = "1.0.110" }
typed-builder = { default-features = false, version = "0.21.2" }
thiserror = { default-features = false, version = "2.0.16" }
serde_json = { default-features = false, version = "1.0.140" }
trybuild = { default-features = false, version = "1.0.105" }
typed-builder = { default-features = false, version = "0.21.0" }
thiserror = { default-features = false, version = "2.0.12" }
wasm-bindgen = { default-features = false, version = "0.2.100" }
indexmap = { default-features = false, version = "2.11.0" }
indexmap = { default-features = false, version = "2.9.0" }
rstml = { default-features = false, version = "0.12.1" }
rustc_version = { default-features = false, version = "0.4.1" }
guardian = { default-features = false, version = "1.3.0" }
@@ -100,17 +98,17 @@ proc-macro-error2 = { default-features = false, version = "2.0.1" }
const_format = { default-features = false, version = "0.2.34" }
gloo-net = { default-features = false, version = "0.6.0" }
url = { default-features = false, version = "2.5.4" }
tokio = { default-features = false, version = "1.47.1" }
tokio = { default-features = false, version = "1.45.1" }
base64 = { default-features = false, version = "0.22.1" }
cfg-if = { default-features = false, version = "1.0.3" }
cfg-if = { default-features = false, version = "1.0.0" }
wasm-bindgen-futures = { default-features = false, version = "0.4.50" }
tower = { default-features = false, version = "0.5.2" }
proc-macro2 = { default-features = false, version = "1.0.101" }
proc-macro2 = { default-features = false, version = "1.0.95" }
serde = { default-features = false, version = "1.0.219" }
parking_lot = { default-features = false, version = "0.12.4" }
axum = { default-features = false, version = "0.8.4" }
serde_qs = { default-features = false, version = "0.15.0" }
syn = { default-features = false, version = "2.0.106" }
syn = { default-features = false, version = "2.0.101" }
xxhash-rust = { default-features = false, version = "0.8.15" }
paste = { default-features = false, version = "1.0.15" }
quote = { default-features = false, version = "1.0.40" }
@@ -118,61 +116,55 @@ web-sys = { default-features = false, version = "0.3.77" }
js-sys = { default-features = false, version = "0.3.77" }
rand = { default-features = false, version = "0.9.1" }
serde-lite = { default-features = false, version = "0.5.0" }
tokio-tungstenite = { default-features = false, version = "0.27.0" }
tokio-tungstenite = { default-features = false, version = "0.26.2" }
serial_test = { default-features = false, version = "3.2.0" }
erased = { default-features = false, version = "0.1.2" }
glib = { default-features = false, version = "0.20.12" }
async-trait = { default-features = false, version = "0.1.89" }
glib = { default-features = false, version = "0.20.10" }
async-trait = { default-features = false, version = "0.1.88" }
typed-builder-macro = { default-features = false, version = "0.21.0" }
linear-map = { default-features = false, version = "1.2.0" }
anyhow = { default-features = false, version = "1.0.99" }
anyhow = { default-features = false, version = "1.0.98" }
walkdir = { default-features = false, version = "2.5.0" }
actix-ws = { default-features = false, version = "0.3.0" }
tower-http = { default-features = false, version = "0.6.4" }
prettyplease = { default-features = false, version = "0.2.37" }
inventory = { default-features = false, version = "0.3.21" }
config = { default-features = false, version = "0.15.14" }
camino = { default-features = false, version = "1.1.11" }
prettyplease = { default-features = false, version = "0.2.33" }
inventory = { default-features = false, version = "0.3.20" }
config = { default-features = false, version = "0.15.11" }
camino = { default-features = false, version = "1.1.9" }
ciborium = { default-features = false, version = "0.2.2" }
multer = { default-features = false, version = "3.1.0" }
leptos-spin-macro = { default-features = false, version = "0.2.0" }
sledgehammer_utils = { default-features = false, version = "0.3.1" }
sledgehammer_bindgen = { default-features = false, version = "0.6.0" }
wasm-streams = { default-features = false, version = "0.4.2" }
rkyv = { default-features = false, version = "0.8.11" }
rkyv = { default-features = false, version = "0.8.10" }
temp-env = { default-features = false, version = "0.3.6" }
uuid = { default-features = false, version = "1.18.0" }
uuid = { default-features = false, version = "1.17.0" }
bytes = { default-features = false, version = "1.10.1" }
http = { default-features = false, version = "1.3.1" }
regex = { default-features = false, version = "1.11.2" }
regex = { default-features = false, version = "1.11.1" }
drain_filter_polyfill = { default-features = false, version = "0.1.3" }
tempfile = { default-features = false, version = "3.21.0" }
futures-lite = { default-features = false, version = "2.6.1" }
tempfile = { default-features = false, version = "3.20.0" }
futures-lite = { default-features = false, version = "2.6.0" }
log = { default-features = false, version = "0.4.27" }
percent-encoding = { default-features = false, version = "2.3.2" }
percent-encoding = { default-features = false, version = "2.3.1" }
async-executor = { default-features = false, version = "1.13.2" }
const-str = { default-features = false, version = "0.6.4" }
const-str = { default-features = false, version = "0.6.2" }
http-body-util = { default-features = false, version = "0.1.3" }
hyper = { default-features = false, version = "1.7.0" }
postcard = { default-features = false, version = "1.1.3" }
hyper = { default-features = false, version = "1.6.0" }
postcard = { default-features = false, version = "1.1.1" }
rmp-serde = { default-features = false, version = "1.3.0" }
reqwest = { default-features = false, version = "0.12.23" }
reqwest = { default-features = false, version = "0.12.18" }
tower-layer = { default-features = false, version = "0.3.3" }
attribute-derive = { default-features = false, version = "0.10.3" }
insta = { default-features = false, version = "1.43.1" }
codee = { default-features = false, version = "0.3.0" }
actix-http = { default-features = false, version = "3.11.1" }
actix-http = { default-features = false, version = "3.11.0" }
wasm-bindgen-test = { default-features = false, version = "0.3.50" }
rustversion = { default-features = false, version = "1.0.22" }
rustversion = { default-features = false, version = "1.0.21" }
getrandom = { default-features = false, version = "0.3.3" }
actix-files = { default-features = false, version = "0.6.6" }
async-lock = { default-features = false, version = "3.4.1" }
base16 = { default-features = false, version = "0.2.1" }
digest = { default-features = false, version = "0.10.7" }
sha2 = { default-features = false, version = "0.10.8" }
subsecond = { default-features = false, git = "https://github.com/dioxuslabs/dioxus" }
dioxus-cli-config = { default-features = false, git = "https://github.com/dioxuslabs/dioxus" }
dioxus-devtools = { default-features = false, git = "https://github.com/dioxuslabs/dioxus" }
async-lock = { default-features = false, version = "3.4.0" }
[profile.release]
codegen-units = 1

View File

@@ -90,13 +90,35 @@ Here are some resources for learning more about Leptos:
- [API Documentation](https://docs.rs/leptos/latest/leptos/)
- [Common Bugs](https://github.com/leptos-rs/leptos/tree/main/docs/COMMON_BUGS.md) (and how to fix them!)
## `nightly` Note
Most of the examples assume youre using `nightly` version of Rust and the `nightly` feature of Leptos. To use `nightly` Rust, you can either set your toolchain globally or on per-project basis.
To set `nightly` as a default toolchain for all projects (and add the ability to compile Rust to WebAssembly, if you havent already):
```
rustup toolchain install nightly
rustup default nightly
rustup target add wasm32-unknown-unknown
```
If you'd like to use `nightly` only in your Leptos project however, add [`rust-toolchain.toml`](https://rust-lang.github.io/rustup/overrides.html#the-toolchain-file) file with the following content:
```toml
[toolchain]
channel = "nightly"
targets = ["wasm32-unknown-unknown"]
```
The `nightly` feature enables the function call syntax for accessing and setting signals, as opposed to `.get()` and `.set()`. This leads to a consistent mental model in which accessing a reactive value of any kind (a signal, memo, or derived signal) is always represented as a function call. This is only possible with nightly Rust and the `nightly` feature.
## `cargo-leptos`
[`cargo-leptos`](https://github.com/leptos-rs/cargo-leptos) is a build tool that's designed to make it easy to build apps that run on both the client and the server, with seamless integration. The best way to get started with a real Leptos project right now is to use `cargo-leptos` and our starter templates for [Actix](https://github.com/leptos-rs/start) or [Axum](https://github.com/leptos-rs/start-axum).
```bash
cargo install cargo-leptos
cargo leptos new --git https://github.com/leptos-rs/start-axum
cargo leptos new --git https://github.com/leptos-rs/start
cd [your project name]
cargo leptos watch
```
@@ -125,7 +147,7 @@ Yes, Im sure there are. You can see from the state of our issue tracker over
This may be the big one: “production ready” implies a certain orientation to a library: that you can basically use it, without any special knowledge of its internals or ability to contribute. Everyone has this at some level in their stack: for example I (@gbj) dont have the capacity or knowledge to contribute to something like `wasm-bindgen` at this point: I simply rely on it to work.
There are several people in the community using Leptos right now for many websites at work, who have also become significant contributors. There may be missing features that you need, and you may end up building them! But, if you're willing to contribute a few missing pieces along the way, the framework is most definitely usable for production applications, especially given the ecosystem of libraries that have sprung up around it.
There are several people in the community using Leptos right now for internal apps at work, who have also become significant contributors. I think this is the right level of production use for now. There may be missing features that you need, and you may end up building them! But for internal apps, if youre willing to build and contribute missing pieces along the way, the framework is definitely usable right now.
### Can I use this for native GUI?

View File

@@ -2,6 +2,8 @@
name = "benchmarks"
version = "0.1.0"
edition = "2021"
# std::sync::LazyLock is stabilized in Rust version 1.80.0
rust-version = "1.80.0"
[dependencies]
l0410 = { package = "leptos", version = "0.4.10", features = [

View File

@@ -19,7 +19,7 @@ leptos_meta = { path = "../../meta" }
leptos_axum = { path = "../../integrations/axum", optional = true }
leptos_router = { path = "../../router" }
serde = { version = "1.0", features = ["derive"] }
thiserror = "2.0.12"
thiserror = "1.0"
tokio = { version = "1.39", features = [
"rt-multi-thread",
"macros",

View File

@@ -1,11 +0,0 @@
extend = [
{ path = "./cargo-leptos.toml" },
{ path = "../cargo-make/webdriver.toml" },
]
[tasks.integration-test]
dependencies = [
"install-cargo-leptos",
"start-webdriver",
"cargo-leptos-e2e-split",
]

View File

@@ -11,10 +11,6 @@ args = ["--locked"]
command = "cargo"
args = ["leptos", "end-to-end"]
[tasks.cargo-leptos-e2e-split]
command = "cargo"
args = ["leptos", "end-to-end", "--split"]
[tasks.build]
clear = true
command = "cargo"

View File

@@ -2,6 +2,8 @@
name = "counter_isomorphic"
version = "0.1.0"
edition = "2021"
# std::sync::LazyLock is stabilized in Rust version 1.80.0
rust-version = "1.80.0"
[lib]
crate-type = ["cdylib", "rlib"]

View File

@@ -18,7 +18,7 @@ tower = { version = "0.4.13", optional = true }
tower-http = { version = "0.5.2", features = ["fs"], optional = true }
tokio = { version = "1.39", features = ["full"], optional = true }
http = { version = "1.1" }
thiserror = "2.0.12"
thiserror = "1.0"
wasm-bindgen = "0.2.93"
[features]

View File

@@ -15,7 +15,7 @@ serde = { version = "1.0", features = ["derive"] }
log = "0.4.22"
console_log = "1.0"
console_error_panic_hook = "0.1.7"
thiserror = "2.0.12"
thiserror = "1.0"
tracing = "0.1.40"
tracing-subscriber = "0.3.18"
tracing-subscriber-wasm = "0.1.0"

View File

@@ -4,7 +4,7 @@ mod routes;
use leptos_meta::{provide_meta_context, Link, Meta, MetaTags, Stylesheet};
use leptos_router::{
components::{FlatRoutes, Route, Router, RoutingProgress},
Lazy, OptionalParamSegment, ParamSegment, StaticSegment,
OptionalParamSegment, ParamSegment, StaticSegment,
};
use routes::{nav::*, stories::*, story::*, users::*};
use std::time::Duration;
@@ -44,8 +44,8 @@ pub fn App() -> impl IntoView {
<Nav />
<main>
<FlatRoutes fallback=|| "Not found.">
<Route path=(StaticSegment("users"), ParamSegment("id")) view={Lazy::<UserRoute>::new()}/>
<Route path=(StaticSegment("stories"), ParamSegment("id")) view={Lazy::<StoryRoute>::new()}/>
<Route path=(StaticSegment("users"), ParamSegment("id")) view=User/>
<Route path=(StaticSegment("stories"), ParamSegment("id")) view=Story/>
<Route path=OptionalParamSegment("stories") view=Stories/>
</FlatRoutes>
</main>

View File

@@ -1,38 +1,24 @@
use crate::api::{self, Story};
use crate::api;
use leptos::{either::Either, prelude::*};
use leptos_meta::Meta;
use leptos_router::{
components::A, hooks::use_params_map, lazy_route, LazyRoute,
};
use leptos_router::{components::A, hooks::use_params_map};
#[derive(Debug)]
pub struct StoryRoute {
story: Resource<Option<Story>>,
}
#[lazy_route]
impl LazyRoute for StoryRoute {
fn data() -> Self {
let params = use_params_map();
let story = Resource::new_blocking(
move || params.read().get("id").unwrap_or_default(),
move |id| async move {
if id.is_empty() {
None
} else {
api::fetch_api::<api::Story>(&api::story(&format!(
"item/{id}"
)))
#[component]
pub fn Story() -> impl IntoView {
let params = use_params_map();
let story = Resource::new_blocking(
move || params.read().get("id").unwrap_or_default(),
move |id| async move {
if id.is_empty() {
None
} else {
api::fetch_api::<api::Story>(&api::story(&format!("item/{id}")))
.await
}
},
);
Self { story }
}
}
},
);
fn view(this: Self) -> AnyView {
let StoryRoute { story } = this;
Suspense(SuspenseProps::builder().fallback(|| "Loading...").children(ToChildren::to_children(move || Suspend::new(async move {
Suspense(SuspenseProps::builder().fallback(|| "Loading...").children(ToChildren::to_children(move || Suspend::new(async move {
match story.await.clone() {
None => Either::Left("Story not found."),
Some(story) => {
@@ -75,8 +61,7 @@ impl LazyRoute for StoryRoute {
})
}
}
}))).build()).into_any()
}
}))).build())
}
#[component]

View File

@@ -1,58 +1,46 @@
use crate::api::{self, User};
use leptos::{either::Either, prelude::*, server::Resource};
use leptos_router::{hooks::use_params_map, lazy_route, LazyRoute};
use leptos_router::hooks::use_params_map;
#[derive(Debug)]
pub struct UserRoute {
user: Resource<Option<User>>,
}
#[lazy_route]
impl LazyRoute for UserRoute {
fn data() -> Self {
let params = use_params_map();
let user = Resource::new(
move || params.read().get("id").unwrap_or_default(),
move |id| async move {
if id.is_empty() {
None
} else {
api::fetch_api::<User>(&api::user(&id)).await
}
},
);
UserRoute { user }
}
fn view(this: Self) -> AnyView {
let UserRoute { user } = this;
view! {
<div class="user-view">
<Suspense fallback=|| view! { "Loading..." }>
{move || Suspend::new(async move { match user.await.clone() {
None => Either::Left(view! { <h1>"User not found."</h1> }),
Some(user) => Either::Right(view! {
<div>
<h1>"User: " {user.id.clone()}</h1>
<ul class="meta">
<li>
<span class="label">"Created: "</span> {user.created}
</li>
<li>
<span class="label">"Karma: "</span> {user.karma}
</li>
<li inner_html={user.about} class="about"></li>
</ul>
<p class="links">
<a href=format!("https://news.ycombinator.com/submitted?id={}", user.id)>"submissions"</a>
" | "
<a href=format!("https://news.ycombinator.com/threads?id={}", user.id)>"comments"</a>
</p>
</div>
})
}})}
</Suspense>
</div>
}.into_any()
#[component]
pub fn User() -> impl IntoView {
let params = use_params_map();
let user = Resource::new(
move || params.read().get("id").unwrap_or_default(),
move |id| async move {
if id.is_empty() {
None
} else {
api::fetch_api::<User>(&api::user(&id)).await
}
},
);
view! {
<div class="user-view">
<Suspense fallback=|| view! { "Loading..." }>
{move || Suspend::new(async move { match user.await.clone() {
None => Either::Left(view! { <h1>"User not found."</h1> }),
Some(user) => Either::Right(view! {
<div>
<h1>"User: " {user.id.clone()}</h1>
<ul class="meta">
<li>
<span class="label">"Created: "</span> {user.created}
</li>
<li>
<span class="label">"Karma: "</span> {user.karma}
</li>
<li inner_html={user.about} class="about"></li>
</ul>
<p class="links">
<a href=format!("https://news.ycombinator.com/submitted?id={}", user.id)>"submissions"</a>
" | "
<a href=format!("https://news.ycombinator.com/threads?id={}", user.id)>"comments"</a>
</p>
</div>
})
}})}
</Suspense>
</div>
}
}

View File

@@ -1,95 +0,0 @@
[package]
name = "lazy_routes"
version = "0.1.0"
edition = "2021"
[lib]
crate-type = ["cdylib", "rlib"]
[dependencies]
axum = { version = "0.8.1", optional = true }
console_error_panic_hook = "0.1.7"
console_log = "1.0"
leptos = { path = "../../leptos", features = ["tracing"] }
leptos_meta = { path = "../../meta" }
leptos_axum = { path = "../../integrations/axum", optional = true }
leptos_router = { path = "../../router" }
serde = { version = "1.0", features = ["derive"] }
thiserror = "1.0"
tokio = { version = "1.39", features = [
"rt-multi-thread",
"macros",
"time",
], optional = true }
wasm-bindgen = "0.2.92"
futures = "0.3.31"
serde_json = "1.0.140"
gloo-timers = { version = "0.3", features = ["futures"] }
[features]
hydrate = ["leptos/hydrate"]
ssr = [
"dep:axum",
"dep:tokio",
"leptos/ssr",
"leptos_meta/ssr",
"dep:leptos_axum",
"leptos_router/ssr",
]
[profile.release]
panic = "abort"
[profile.wasm-release]
inherits = "release"
opt-level = 'z'
lto = true
codegen-units = 1
panic = "abort"
[package.metadata.cargo-all-features]
denylist = ["axum", "tower", "tower-http", "tokio", "sqlx", "leptos_axum"]
skip_feature_sets = [["ssr", "hydrate"]]
[package.metadata.leptos]
# The name used by wasm-bindgen/cargo-leptos for the JS/WASM bundle. Defaults to the crate name
output-name = "regression"
# The site root folder is where cargo-leptos generate all output. WARNING: all content of this folder will be erased on a rebuild. Use it in your server setup.
site-root = "target/site"
# The site-root relative folder where all compiled output (JS, WASM and CSS) is written
# Defaults to pkg
site-pkg-dir = "pkg"
# The IP and port (ex: 127.0.0.1:3000) where the server serves the content. Use it in your server setup.
site-addr = "127.0.0.1:3000"
# The port to use for automatic reload monitoring
reload-port = 3001
# [Optional] Command to use when running end2end tests. It will run in the end2end dir.
# [Windows] for non-WSL use "npx.cmd playwright test"
# This binary name can be checked in Powershell with Get-Command npx
end2end-cmd = "cargo make test-ui"
end2end-dir = "e2e"
# The browserlist query used for optimizing the CSS.
browserquery = "defaults"
# Set by cargo-leptos watch when building with that tool. Controls whether autoreload JS will be included in the head
watch = false
# The environment Leptos will run in, usually either "DEV" or "PROD"
env = "DEV"
# The features to use when compiling the bin target
#
# Optional. Can be over-ridden with the command line parameter --bin-features
bin-features = ["ssr"]
# If the --no-default-features flag should be used when compiling the bin target
#
# Optional. Defaults to false.
bin-default-features = false
# The features to use when compiling the lib target
#
# Optional. Can be over-ridden with the command line parameter --lib-features
lib-features = ["hydrate"]
# If the --no-default-features flag should be used when compiling the lib target
#
# Optional. Defaults to false.
lib-default-features = false

View File

@@ -1,21 +0,0 @@
MIT License
Copyright (c) 2025 Leptos
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in all
copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
SOFTWARE.

View File

@@ -1,8 +0,0 @@
extend = [
{ path = "../cargo-make/main.toml" },
{ path = "../cargo-make/cargo-leptos-split-webdriver-test.toml" },
]
[env]
CLIENT_PROCESS_NAME = "regression"

View File

@@ -1,8 +0,0 @@
# Regression Tests
This example functions as a catch-all for all current and future regression
test cases that typically happens at integration.
## Quick Start
Run `cargo leptos watch` to run this example.

Binary file not shown.

Before

Width:  |  Height:  |  Size: 15 KiB

View File

@@ -1,18 +0,0 @@
[package]
name = "lazy_routes_e2e"
version = "0.1.0"
edition = "2021"
[dev-dependencies]
anyhow = "1.0"
async-trait = "0.1.81"
cucumber = "0.21.1"
fantoccini = "0.21.1"
pretty_assertions = "1.4"
serde_json = "1.0"
tokio = { version = "1.39", features = ["macros", "rt-multi-thread", "time"] }
url = "2.5"
[[test]]
name = "app_suite"
harness = false # Allow Cucumber to print output instead of libtest

View File

@@ -1,20 +0,0 @@
extend = { path = "../../cargo-make/main.toml" }
[tasks.test]
env = { RUN_AUTOMATICALLY = false }
condition = { env_true = ["RUN_AUTOMATICALLY"] }
[tasks.ci]
[tasks.test-ui]
command = "cargo"
args = [
"test",
"--test",
"app_suite",
"--",
"--retry",
"2",
"--fail-fast",
"${@}",
]

View File

@@ -1,30 +0,0 @@
# Lazy Routes
This example demonstrates how to split the WASM bundle that is sent to the client into multiple binaries, which can be lazy-loaded, either independently or in a way that's integrated into the router.
Without code splitting, the entire application is compiled to a monolithic WASM binary, the size of which grows in proportion to the complexity of the application. This means that the time to interactive (TTI) for any page is proportional to the size of the entire application, not only that page.
Code splitting allows you to lazy-load some functions, by splitting off the WASM binary code for certain functions into separate files, which can be downloaded as needed. This minimizes initial TTI for any page, and then amortizes the cost of loading the binary over the lifetime of the application session.
In many cases, this can be done with minimal or no cost.
Lazy loading can be used in two ways, each of which is shown in the example.
## `#[lazy]` macro
`#[lazy]` is an attribute macro that can be used to annotate an `async fn` in order to split its code out into a separate file that will be loaded on demand, when compiled with `cargo leptos --split`.
This has some limitations (for example, it must return concrete types) but can be used for most functions.
## `LazyRoute`
`LazyRoute` is a specialized application of `#[lazy]` that allows you to define an entire route/page of your application as being lazy-loaded.
Creating a lazy route requires you to split the route into two parts:
1. `data()`: A synchronous method that should be used to start loading any async data used by the page, for example by creating a `Resource`
2. `view()`: An async (because lazy-loaded) method that renders the view.
The purpose of splitting these into two parts is to avoid a “waterfall,” in which the browser first waits for a lazy-loaded WASM chunk that defines the page, _then_ makes a second request to the server to load the relevant data. Instead, a `LazyRoute` will begin loading resources created in the `data` method while lazy-loading the component body in the `view`, then render the route.
This means that in many cases, the data loading “hides” the cost of the lazy-loading; i.e., the page needs to wait for the data to load, so the fact that it is waiting concurrently for the lazy-loaded view means that the lazy loading does not cost anything additional in terms of page load time.

View File

@@ -1,33 +0,0 @@
@basic
Feature: Check that each page hydrates correctly
Scenario: Page A is rendered correctly.
Given I see the app
Then I see the page is View A
Scenario: Page A hydrates and allows navigating to page B.
Given I see the app
When I select the link B
Then I see the navigating indicator
When I wait for a second
Then I see the page is View B
Scenario: Page B is rendered correctly.
When I open the app at /b
Then I see the page is View B
Scenario: Page B hydrates and allows navigating to page C.
When I open the app at /b
When I select the link C
Then I see the navigating indicator
When I wait for a second
Then I see the page is View C
Scenario: Page C is rendered correctly.
When I open the app at /c
Then I see the page is View C
Scenario: Page C hydrates and allows navigating to page A.
When I open the app at /c
When I select the link A
Then I see the page is View A

View File

@@ -1,15 +0,0 @@
@duplicate_names
Feature: Lazy functions can share the same name
Scenario: Two functions with the same name both work.
Given I see the app
Then I see the page is View A
When I click the button First
When I wait for a second
Then I see the result is {"a":"First Value","b":1}
When I click the button Second
When I wait for a second
Then I see the result is {"a":"Second Value","b":2}
When I click the button Third
When I wait for a second
Then I see the result is Third value.

View File

@@ -1,9 +0,0 @@
@shared_chunks
Feature: Shared code splitting works correctly
Scenario: Two functions using same serde code both work.
Given I see the app
Then I see the page is View A
When I click the button First
When I wait for a second
Then I see the result is {"a":"First Value","b":1}

View File

@@ -1,30 +0,0 @@
mod fixtures;
use anyhow::Result;
use cucumber::World;
use fixtures::world::AppWorld;
use std::{ffi::OsStr, fs::read_dir};
#[tokio::main]
async fn main() -> Result<()> {
// Normally the below is done, but it's now gotten to the point of
// having a sufficient number of tests where the resource contention
// of the concurrently running browsers will cause failures on CI.
// AppWorld::cucumber()
// .fail_on_skipped()
// .run_and_exit("./features")
// .await;
// Mitigate the issue by manually stepping through each feature,
// rather than letting cucumber glob them and dispatch all at once.
for entry in read_dir("./features")? {
let path = entry?.path();
if path.extension() == Some(OsStr::new("feature")) {
AppWorld::cucumber()
.fail_on_skipped()
.run_and_exit(path)
.await;
}
}
Ok(())
}

View File

@@ -1,23 +0,0 @@
use super::{find, world::HOST};
use anyhow::Result;
use fantoccini::Client;
use std::result::Result::Ok;
pub async fn goto_path(client: &Client, path: &str) -> Result<()> {
let url = format!("{}{}", HOST, path);
client.goto(&url).await?;
Ok(())
}
pub async fn click_link(client: &Client, text: &str) -> Result<()> {
let link = find::link_with_text(&client, &text).await?;
link.click().await?;
Ok(())
}
pub async fn click_button(client: &Client, id: &str) -> Result<()> {
let btn = find::element_by_id(&client, &id).await?;
btn.click().await?;
Ok(())
}

View File

@@ -1,29 +0,0 @@
use crate::fixtures::find;
use anyhow::{Ok, Result};
use fantoccini::Client;
use pretty_assertions::assert_eq;
pub async fn page_name_is(client: &Client, expected_text: &str) -> Result<()> {
let actual = find::text_at_id(client, "page").await?;
assert_eq!(&actual, expected_text);
Ok(())
}
pub async fn result_is(client: &Client, expected_text: &str) -> Result<()> {
let actual = find::text_at_id(client, "result").await?;
assert_eq!(&actual, expected_text);
Ok(())
}
pub async fn navigating_appears(client: &Client) -> Result<()> {
let actual = find::text_at_id(client, "navigating").await?;
assert_eq!(&actual, "Navigating...");
Ok(())
}
pub async fn element_exists(client: &Client, id: &str) -> Result<()> {
find::element_by_id(client, id)
.await
.expect(&format!("could not find element with id `{id}`"));
Ok(())
}

View File

@@ -1,23 +0,0 @@
use anyhow::{Ok, Result};
use fantoccini::{elements::Element, Client, Locator};
pub async fn text_at_id(client: &Client, id: &str) -> Result<String> {
let element = element_by_id(client, id)
.await
.expect(format!("no such element with id `{}`", id).as_str());
let text = element.text().await?;
Ok(text)
}
pub async fn link_with_text(client: &Client, text: &str) -> Result<Element> {
let link = client
.wait()
.for_element(Locator::LinkText(text))
.await
.expect(format!("Link not found by `{}`", text).as_str());
Ok(link)
}
pub async fn element_by_id(client: &Client, id: &str) -> Result<Element> {
Ok(client.wait().for_element(Locator::Id(id)).await?)
}

View File

@@ -1,4 +0,0 @@
pub mod action;
pub mod check;
pub mod find;
pub mod world;

View File

@@ -1,68 +0,0 @@
use crate::fixtures::{action, world::AppWorld};
use anyhow::{Ok, Result};
use cucumber::{gherkin::Step, given, when};
#[given("I see the app")]
#[when("I open the app")]
async fn i_open_the_app(world: &mut AppWorld) -> Result<()> {
let client = &world.client;
action::goto_path(client, "").await?;
Ok(())
}
#[when(regex = "^I open the app at (.*)$")]
async fn i_open_the_app_at(world: &mut AppWorld, url: String) -> Result<()> {
let client = &world.client;
action::goto_path(client, &url).await?;
Ok(())
}
#[when(regex = "^I select the link (.*)$")]
async fn i_select_the_link(world: &mut AppWorld, text: String) -> Result<()> {
let client = &world.client;
action::click_link(client, &text).await?;
Ok(())
}
#[when(regex = "^I click the button (.*)$")]
async fn i_click_the_button(world: &mut AppWorld, id: String) -> Result<()> {
let client = &world.client;
action::click_button(client, &id).await?;
Ok(())
}
#[when(expr = "I select the following links")]
async fn i_select_the_following_links(
world: &mut AppWorld,
step: &Step,
) -> Result<()> {
let client = &world.client;
if let Some(table) = step.table.as_ref() {
for row in table.rows.iter() {
action::click_link(client, &row[0]).await?;
}
}
Ok(())
}
#[when("I wait for a second")]
async fn i_wait_for_a_second(world: &mut AppWorld) -> Result<()> {
tokio::time::sleep(std::time::Duration::from_secs(1)).await;
Ok(())
}
#[given(regex = "^I (refresh|reload) the (browser|page)$")]
#[when(regex = "^I (refresh|reload) the (browser|page)$")]
async fn i_refresh_the_browser(world: &mut AppWorld) -> Result<()> {
let client = &world.client;
client.refresh().await?;
Ok(())
}

View File

@@ -1,31 +0,0 @@
use crate::fixtures::{check, world::AppWorld};
use anyhow::{Ok, Result};
use cucumber::then;
#[then(regex = r"^I see the navigating indicator")]
async fn i_see_the_nav(world: &mut AppWorld) -> Result<()> {
let client = &world.client;
check::navigating_appears(client).await?;
Ok(())
}
#[then(regex = r"^I see the page is (.*)$")]
async fn i_see_the_page_is(world: &mut AppWorld, text: String) -> Result<()> {
let client = &world.client;
check::page_name_is(client, &text).await?;
Ok(())
}
#[then(regex = r"^I see the result is (.*)$")]
async fn i_see_the_result_is(world: &mut AppWorld, text: String) -> Result<()> {
let client = &world.client;
check::result_is(client, &text).await?;
Ok(())
}
#[then(regex = r"^I see the navbar$")]
async fn i_see_the_navbar(world: &mut AppWorld) -> Result<()> {
let client = &world.client;
check::element_exists(client, "nav").await?;
Ok(())
}

View File

@@ -1,39 +0,0 @@
pub mod action_steps;
pub mod check_steps;
use anyhow::Result;
use cucumber::World;
use fantoccini::{
error::NewSessionError, wd::Capabilities, Client, ClientBuilder,
};
pub const HOST: &str = "http://127.0.0.1:3000";
#[derive(Debug, World)]
#[world(init = Self::new)]
pub struct AppWorld {
pub client: Client,
}
impl AppWorld {
async fn new() -> Result<Self, anyhow::Error> {
let webdriver_client = build_client().await?;
Ok(Self {
client: webdriver_client,
})
}
}
async fn build_client() -> Result<Client, NewSessionError> {
let mut cap = Capabilities::new();
let arg = serde_json::from_str("{\"args\": [\"-headless\"]}").unwrap();
cap.insert("goog:chromeOptions".to_string(), arg);
let client = ClientBuilder::native()
.capabilities(cap)
.connect("http://localhost:4444")
.await?;
Ok(client)
}

View File

@@ -1,355 +0,0 @@
use leptos::{prelude::*, task::spawn_local};
use leptos_router::{
components::{Outlet, ParentRoute, Route, Router, Routes},
lazy_route, Lazy, LazyRoute, StaticSegment,
};
use serde::{Deserialize, Serialize};
pub fn shell(options: LeptosOptions) -> impl IntoView {
view! {
<!DOCTYPE html>
<html lang="en">
<head>
<meta charset="utf-8"/>
<meta name="viewport" content="width=device-width, initial-scale=1"/>
<AutoReload options=options.clone()/>
<HydrationScripts options/>
</head>
<body>
<App/>
</body>
</html>
}
}
#[component]
pub fn App() -> impl IntoView {
let count = RwSignal::new(0);
provide_context(count);
let (is_routing, set_is_routing) = signal(false);
view! {
<nav id="nav" style="width: 100%">
<a href="/">"A"</a> " | "
<a href="/b">"B"</a> " | "
<a href="/c">"C"</a> " | "
<a href="/d">"D"</a>
<span style="float: right" id="navigating">
{move || is_routing.get().then_some("Navigating...")}
</span>
</nav>
<Router set_is_routing>
<Routes fallback=|| "Not found.">
<Route path=StaticSegment("") view=ViewA/>
<Route path=StaticSegment("b") view=ViewB/>
<Route path=StaticSegment("c") view={Lazy::<ViewC>::new()}/>
// you can nest lazy routes, and there data and views will all load concurrently
<ParentRoute path=StaticSegment("d") view={Lazy::<ViewD>::new()}>
<Route path=StaticSegment("") view={Lazy::<ViewE>::new()}/>
</ParentRoute>
</Routes>
</Router>
}
}
// View A: A plain old synchronous route, just like they all currently work. The WASM binary code
// for this is shipped as part of the main bundle. Any data-loading code (like resources that run
// in the body of the component) will be shipped as part of the main bundle.
#[component]
pub fn ViewA() -> impl IntoView {
leptos::logging::log!("View A");
let result = RwSignal::new("Click a button to see the result".to_string());
view! {
<p id="page">"View A"</p>
<pre id="result">{result}</pre>
<button id="First" on:click=move |_| spawn_local(async move { result.set(first_value().await); })>"First"</button>
<button id="Second" on:click=move |_| spawn_local(async move { result.set(second_value().await); })>"Second"</button>
// test to make sure duplicate names in different scopes can be used
<button id="Third" on:click=move |_| {
#[lazy]
pub fn second_value() -> String {
"Third value.".to_string()
}
spawn_local(async move {
result.set(second_value().await);
});
}>"Third"</button>
}
}
// View B: lazy-loaded route with lazy-loaded data
#[derive(Debug, Clone, Deserialize)]
pub struct Comment {
#[serde(rename = "postId")]
post_id: usize,
id: usize,
name: String,
email: String,
body: String,
}
#[lazy]
fn deserialize_comments(data: &str) -> Vec<Comment> {
serde_json::from_str(data).unwrap()
}
#[component]
pub fn ViewB() -> impl IntoView {
let data = LocalResource::new(|| async move {
let preload = deserialize_comments("[]");
let (_, data) = futures::future::join(preload, async {
gloo_timers::future::TimeoutFuture::new(500).await;
r#"
[
{
"postId": 1,
"id": 1,
"name": "id labore ex et quam laborum",
"email": "Eliseo@gardner.biz",
"body": "laudantium enim quasi est quidem magnam voluptate ipsam eos\ntempora quo necessitatibus\ndolor quam autem quasi\nreiciendis et nam sapiente accusantium"
},
{
"postId": 1,
"id": 2,
"name": "quo vero reiciendis velit similique earum",
"email": "Jayne_Kuhic@sydney.com",
"body": "est natus enim nihil est dolore omnis voluptatem numquam\net omnis occaecati quod ullam at\nvoluptatem error expedita pariatur\nnihil sint nostrum voluptatem reiciendis et"
},
{
"postId": 1,
"id": 3,
"name": "odio adipisci rerum aut animi",
"email": "Nikita@garfield.biz",
"body": "quia molestiae reprehenderit quasi aspernatur\naut expedita occaecati aliquam eveniet laudantium\nomnis quibusdam delectus saepe quia accusamus maiores nam est\ncum et ducimus et vero voluptates excepturi deleniti ratione"
}
]
"#
})
.await;
deserialize_comments(data).await
});
view! {
<p id="page">"View B"</p>
<Suspense fallback=|| view! { <p id="loading">"Loading..."</p> }>
<ul>
{move || Suspend::new(async move {
let items = data.await;
items.into_iter()
.map(|comment| view! {
<li id=format!("{}-{}", comment.post_id, comment.id)>
<strong>{comment.name}</strong> " (by " {comment.email} ")"<br/>
{comment.body}
</li>
})
.collect_view()
})}
</ul>
</Suspense>
}
.into_any()
}
#[derive(Debug, Clone, Deserialize)]
pub struct Album {
#[serde(rename = "userId")]
user_id: usize,
id: usize,
title: String,
}
// View C: a lazy view, and some data, loaded in parallel when we navigate to /c.
#[derive(Clone)]
pub struct ViewC {
data: LocalResource<Vec<Album>>,
}
// Lazy-loaded routes need to implement the LazyRoute trait. They define a "route data" struct,
// which is created with `::data()`, and then a separate view function which is lazily loaded.
//
// This is important because it allows us to concurrently 1) load the route data, and 2) lazily
// load the component, rather than creating a "waterfall" where we can't start loading the route
// data until we've received the view.
//
// The `#[lazy_route]` macro makes `view` into a lazy-loaded inner function, replacing `self` with
// `this`.
#[lazy_route]
impl LazyRoute for ViewC {
fn data() -> Self {
// the data method itself is synchronous: it typically creates things like Resources,
// which are created synchronously but spawn an async data-loading task
// if you want further code-splitting, however, you can create a lazy function to load the data!
#[lazy]
async fn lazy_data() -> Vec<Album> {
gloo_timers::future::TimeoutFuture::new(250).await;
vec![
Album {
user_id: 1,
id: 1,
title: "quidem molestiae enim".into(),
},
Album {
user_id: 1,
id: 2,
title: "sunt qui excepturi placeat culpa".into(),
},
Album {
user_id: 1,
id: 3,
title: "omnis laborum odio".into(),
},
]
}
Self {
data: LocalResource::new(lazy_data),
}
}
fn view(this: Self) -> AnyView {
let albums = move || {
Suspend::new(async move {
this.data
.await
.into_iter()
.map(|album| {
view! {
<li id=format!("{}-{}", album.user_id, album.id)>
{album.title}
</li>
}
})
.collect::<Vec<_>>()
})
};
view! {
<p id="page">"View C"</p>
<hr/>
<Suspense fallback=|| view! { <p id="loading">"Loading..."</p> }>
<ul>{albums}</ul>
</Suspense>
}
.into_any()
}
}
// When two functions have shared code, that shared code will be split out automatically
// into an additional file. For example, the shared serde code here will be split into a single file,
// and then loaded lazily once when the first of the two functions is called
#[lazy]
pub fn first_value() -> String {
#[derive(Serialize)]
struct FirstValue {
a: String,
b: i32,
}
serde_json::to_string(&FirstValue {
a: "First Value".into(),
b: 1,
})
.unwrap()
}
#[lazy]
pub fn second_value() -> String {
#[derive(Serialize)]
struct SecondValue {
a: String,
b: i32,
}
serde_json::to_string(&SecondValue {
a: "Second Value".into(),
b: 2,
})
.unwrap()
}
struct ViewD {
data: Resource<Result<Vec<i32>, ServerFnError>>,
}
#[lazy_route]
impl LazyRoute for ViewD {
fn data() -> Self {
Self {
data: Resource::new(|| (), |_| d_data()),
}
}
fn view(this: Self) -> AnyView {
let items = move || {
Suspend::new(async move {
this.data
.await
.unwrap_or_default()
.into_iter()
.map(|item| view! { <li>{item}</li> })
.collect::<Vec<_>>()
})
};
view! {
<p id="page">"View D"</p>
<hr/>
<Suspense fallback=|| view! { <p id="loading">"Loading..."</p> }>
<ul>{items}</ul>
</Suspense>
<Outlet/>
}
.into_any()
}
}
// Server functions can be made lazy by combining the two macros,
// with `#[server]` coming first, then `#[lazy]`
#[server]
#[lazy]
async fn d_data() -> Result<Vec<i32>, ServerFnError> {
tokio::time::sleep(std::time::Duration::from_millis(250)).await;
Ok(vec![1, 1, 2, 3, 5, 8, 13])
}
struct ViewE {
data: Resource<Result<Vec<String>, ServerFnError>>,
}
#[lazy_route]
impl LazyRoute for ViewE {
fn data() -> Self {
Self {
data: Resource::new(|| (), |_| e_data()),
}
}
fn view(this: Self) -> AnyView {
let items = move || {
Suspend::new(async move {
this.data
.await
.unwrap_or_default()
.into_iter()
.map(|item| view! { <li>{item}</li> })
.collect::<Vec<_>>()
})
};
view! {
<p id="page">"View E"</p>
<hr/>
<Suspense fallback=|| view! { <p id="loading">"Loading..."</p> }>
<ul>{items}</ul>
</Suspense>
}
.into_any()
}
}
#[server]
async fn e_data() -> Result<Vec<String>, ServerFnError> {
tokio::time::sleep(std::time::Duration::from_millis(250)).await;
Ok(vec!["foo".into(), "bar".into(), "baz".into()])
}

View File

@@ -1,9 +0,0 @@
pub mod app;
#[cfg(feature = "hydrate")]
#[wasm_bindgen::prelude::wasm_bindgen]
pub fn hydrate() {
use app::*;
console_error_panic_hook::set_once();
leptos::mount::hydrate_lazy(App);
}

View File

@@ -1,37 +0,0 @@
#[cfg(feature = "ssr")]
#[tokio::main]
async fn main() {
use axum::Router;
use lazy_routes::app::{shell, App};
use leptos::prelude::*;
use leptos_axum::{generate_route_list, LeptosRoutes};
let conf = get_configuration(None).unwrap();
let addr = conf.leptos_options.site_addr;
let leptos_options = conf.leptos_options;
// Generate the list of routes in your Leptos App
let routes = generate_route_list(App);
let app = Router::new()
.leptos_routes(&leptos_options, routes, {
let leptos_options = leptos_options.clone();
move || shell(leptos_options.clone())
})
.fallback(leptos_axum::file_and_error_handler(shell))
.with_state(leptos_options);
// run our app with hyper
// `axum::Server` is a re-export of `hyper::Server`
println!("listening on http://{}", &addr);
let listener = tokio::net::TcpListener::bind(&addr).await.unwrap();
axum::serve(listener, app.into_make_service())
.await
.unwrap();
}
#[cfg(not(feature = "ssr"))]
pub fn main() {
// no client-side main function
// unless we want this to work with e.g., Trunk for pure client-side testing
// see lib.rs for hydration function instead
}

View File

@@ -1,3 +0,0 @@
body {
font-family: sans-serif;
}

View File

@@ -15,7 +15,7 @@ leptos_meta = { path = "../../meta" }
leptos_axum = { path = "../../integrations/axum", optional = true }
leptos_router = { path = "../../router" }
serde = { version = "1.0", features = ["derive"] }
thiserror = "2.0.12"
thiserror = "1.0"
tokio = { version = "1.39", features = [ "rt-multi-thread", "macros", "time" ], optional = true }
wasm-bindgen = "0.2.92"

View File

@@ -1,7 +0,0 @@
@check_issue_4005
Feature: Check that issue 4005 does not reappear
Scenario: The second item is selected.
Given I see the app
And I can access regression test 4005
Then I see the value of select is 2

View File

@@ -1,20 +0,0 @@
@check_issue_4088
Feature: Check that issue 4088 does not reappear
Scenario: I can see the navbar
Given I see the app
And I can access regression test 4088
Then I see the navbar
Scenario: The user info is shared via context
Given I see the app
And I can access regression test 4088
When I select the link Class 1
Then I see the result is the string Assignments for team of user with id 42
Scenario: The user info is shared via context
Given I see the app
And I can access regression test 4088
When I select the link Class 1
When I refresh the browser
Then I see the result is the string Assignments for team of user with id 42

View File

@@ -1,9 +0,0 @@
@check_issue_4217
Feature: Check that issue 4217 does not reappear
Scenario: All items are selected.
Given I see the app
And I can access regression test 4217
Then I see option1 is selected
And I see option2 is selected
And I see option3 is selected

View File

@@ -1,9 +0,0 @@
@check_issue_4285
Feature: Check that issue 4285 does not reappear
Scenario: Navigating several times to same lazy route does not cause issues.
Given I see the app
And I can access regression test 4285
And I can access regression test 4285
And I can access regression test 4285
Then I see the result is the string 42

View File

@@ -1,18 +0,0 @@
@check_issue_4296
Feature: Check that issue 4296 does not reappear
Scenario: Query param signals created in LazyRoute::data() are reactive in ::view().
Given I see the app
And I can access regression test 4296
Then I see the result is the string None
When I select the link abc
Then I see the result is the string Some("abc")
When I select the link def
Then I see the result is the string Some("def")
Scenario: Loading page with query signal works as well.
Given I see the app
And I can access regression test 4296
When I select the link abc
When I reload the page
Then I see the result is the string Some("abc")

View File

@@ -1,8 +0,0 @@
@check_pr_4015
Feature: Check that PR 4015 does not regress
Scenario: The correct text appears
Given I see the app
And I can access regression test 4015
Then I see the result is the string Some(42)

View File

@@ -24,25 +24,3 @@ Feature: Regression from pull request 4091
| test1 |
| 4091 Home |
Then I see the result is empty
Scenario: I can see the navbar
Given I see the app
And I can access regression test 4091
Then I see the navbar
Scenario: If I navigate to home and back, I can still see the navbar
Given I see the app
And I can access regression test 4091
When I select the following links
| Home |
| 4091 |
Then I see the navbar
Scenario: The signal is not disposed too early
Given I see the app
And I can access regression test 4091
When I select the following links
| test1 |
| Home |
| 4091 |
Then I see the navbar

View File

@@ -11,35 +11,3 @@ pub async fn result_text_is(
assert_eq!(&actual, expected_text);
Ok(())
}
pub async fn element_exists(client: &Client, id: &str) -> Result<()> {
find::element_by_id(client, id)
.await
.expect(&format!("could not find element with id `{id}`"));
Ok(())
}
pub async fn select_option_is_selected(
client: &Client,
id: &str,
) -> Result<()> {
let el = find::element_by_id(client, id)
.await
.expect(&format!("could not find element with id `{id}`"));
let selected = el.prop("selected").await?;
assert_eq!(selected.as_deref(), Some("true"));
Ok(())
}
pub async fn element_value_is(
client: &Client,
id: &str,
expected: &str,
) -> Result<()> {
let el = find::element_by_id(client, id)
.await
.expect(&format!("could not find element with id `{id}`"));
let value = el.prop("value").await?;
assert_eq!(value.as_deref(), Some(expected));
Ok(())
}

View File

@@ -2,7 +2,9 @@ use anyhow::{Ok, Result};
use fantoccini::{elements::Element, Client, Locator};
pub async fn text_at_id(client: &Client, id: &str) -> Result<String> {
let element = element_by_id(client, id)
let element = client
.wait()
.for_element(Locator::Id(id))
.await
.expect(format!("no such element with id `{}`", id).as_str());
let text = element.text().await?;
@@ -17,7 +19,3 @@ pub async fn link_with_text(client: &Client, text: &str) -> Result<Element> {
.expect(format!("Link not found by `{}`", text).as_str());
Ok(link)
}
pub async fn element_by_id(client: &Client, id: &str) -> Result<Element> {
Ok(client.wait().for_element(Locator::Id(id)).await?)
}

View File

@@ -3,7 +3,9 @@ use anyhow::{Ok, Result};
use cucumber::then;
#[then(regex = r"^I see the result is empty$")]
async fn i_see_the_result_is_empty(world: &mut AppWorld) -> Result<()> {
async fn i_see_the_result_is_empty(
world: &mut AppWorld,
) -> Result<()> {
let client = &world.client;
check::result_text_is(client, "").await?;
Ok(())
@@ -18,28 +20,3 @@ async fn i_see_the_result_is_the_string(
check::result_text_is(client, &text).await?;
Ok(())
}
#[then(regex = r"^I see the navbar$")]
async fn i_see_the_navbar(world: &mut AppWorld) -> Result<()> {
let client = &world.client;
check::element_exists(client, "nav").await?;
Ok(())
}
#[then(regex = r"^I see ([\d\w]+) is selected$")]
async fn i_see_the_select(world: &mut AppWorld, id: String) -> Result<()> {
let client = &world.client;
check::select_option_is_selected(client, &id).await?;
Ok(())
}
#[then(regex = r"^I see the value of (\w+) is (.*)$")]
async fn i_see_the_value(
world: &mut AppWorld,
id: String,
value: String,
) -> Result<()> {
let client = &world.client;
check::element_value_is(client, &id, &value).await?;
Ok(())
}

View File

@@ -1,8 +1,4 @@
use crate::{
issue_4005::Routes4005, issue_4088::Routes4088, issue_4217::Routes4217,
issue_4285::Routes4285, issue_4296::Routes4296, pr_4015::Routes4015,
pr_4091::Routes4091,
};
use crate::pr_4091::Routes4091;
use leptos::prelude::*;
use leptos_meta::{MetaTags, *};
use leptos_router::{
@@ -32,21 +28,13 @@ pub fn shell(options: LeptosOptions) -> impl IntoView {
pub fn App() -> impl IntoView {
provide_meta_context();
let fallback = || view! { "Page not found." }.into_view();
let (_, set_is_routing) = signal(false);
view! {
<Stylesheet id="leptos" href="/pkg/regression.css"/>
<Router set_is_routing>
<Router>
<main>
<Routes fallback>
<Route path=path!("") view=HomePage/>
<Routes4091/>
<Routes4015/>
<Routes4088/>
<Routes4217/>
<Routes4005/>
<Routes4285/>
<Routes4296/>
</Routes>
</main>
</Router>
@@ -67,12 +55,6 @@ fn HomePage() -> impl IntoView {
<nav>
<ul>
<li><a href="/4091/">"4091"</a></li>
<li><a href="/4015/">"4015"</a></li>
<li><a href="/4088/">"4088"</a></li>
<li><a href="/4217/">"4217"</a></li>
<li><a href="/4005/">"4005"</a></li>
<li><a href="/4285/">"4285"</a></li>
<li><a href="/4296/">"4296"</a></li>
</ul>
</nav>
}

View File

@@ -1,24 +0,0 @@
use leptos::prelude::*;
#[allow(unused_imports)]
use leptos_router::{
components::Route, path, MatchNestedRoutes, NavigateOptions,
};
#[component]
pub fn Routes4005() -> impl MatchNestedRoutes + Clone {
view! {
<Route path=path!("4005") view=Issue4005/>
}
.into_inner()
}
#[component]
fn Issue4005() -> impl IntoView {
view! {
<select id="select" prop:value="2">
<option value="1">"Option 1"</option>
<option value="2">"Option 2"</option>
<option value="3">"Option 3"</option>
</select>
}
}

View File

@@ -1,119 +0,0 @@
use leptos::{either::Either, prelude::*};
#[allow(unused_imports)]
use leptos_router::{
components::{Outlet, ParentRoute, Redirect, Route},
path, MatchNestedRoutes, NavigateOptions,
};
use serde::{Deserialize, Serialize};
#[component]
pub fn Routes4088() -> impl MatchNestedRoutes + Clone {
view! {
<ParentRoute path=path!("4088") view=|| view!{ <LoggedIn/> }>
<ParentRoute path=path!("") view=||view!{<AssignmentsSelector/>}>
<Route path=path!("/:team_id") view=||view!{<AssignmentsForTeam/>} />
<Route path=path!("") view=||view!{ <p>No class selected</p> }/>
</ParentRoute>
</ParentRoute>
}
.into_inner()
}
#[derive(Clone, Debug, PartialEq, Eq, Serialize, Deserialize)]
pub struct UserInfo {
pub id: usize,
}
#[server]
pub async fn get_user_info() -> Result<Option<UserInfo>, ServerFnError> {
Ok(Some(UserInfo { id: 42 }))
}
#[component]
pub fn LoggedIn() -> impl IntoView {
let user_info_resource =
Resource::new(|| (), move |_| async { get_user_info().await });
view! {
<Transition fallback=move || view!{
"loading"
}
>
{move || {
user_info_resource.get()
.map(|a|
match a {
Ok(Some(a)) => Either::Left(view! {
<LoggedInContent user_info={a} />
}),
_ => Either::Right(view!{
<Redirect path="/not_logged_in"/>
})
})
}}
</Transition>
}
}
#[component]
/// Component which provides UserInfo and renders it's child
/// Can also contain some code to check for specific situations (e.g. privacy policies accepted or not? redirect if needed...)
pub fn LoggedInContent(user_info: UserInfo) -> impl IntoView {
provide_context(user_info.clone());
if user_info.id == 42 {
Either::Left(Outlet())
} else {
Either::Right(
view! { <Redirect path="/somewhere" options={NavigateOptions::default()}/> },
)
}
}
#[component]
/// This component also uses Outlet (so nested Outlet)
fn AssignmentsSelector() -> impl IntoView {
let user_info = use_context::<UserInfo>().expect("user info not provided");
view! {
<p>"Assignments for user with ID: "{user_info.id}</p>
<ul id="nav">
<li><a href="/4088/1">"Class 1"</a></li>
<li><a href="/4088/2">"Class 2"</a></li>
<li><a href="/4088/3">"Class 3"</a></li>
</ul>
<Outlet />
}
}
#[component]
fn AssignmentsForTeam() -> impl IntoView {
// THIS FAILS -> Because of the nested outlet in LoggedInContent > AssignmentsSelector?
// It did not fail when LoggedIn did not use a resource and transition (but a hardcoded UserInfo in the component)
let user_info = use_context::<UserInfo>().expect("user info not provided");
let items = vec!["Assignment 1", "Assignment 2", "Assignment 3"];
view! {
<p id="result">"Assignments for team of user with id " {user_info.id}</p>
<ul>
{
items.into_iter().map(|item| {
view! {
<Assignment name=item.to_string() />
}
}).collect_view()
}
</ul>
}
}
#[component]
fn Assignment(name: String) -> impl IntoView {
let user_info = use_context::<UserInfo>().expect("user info not provided");
view! {
<li>{name}" "{user_info.id}</li>
}
}

View File

@@ -1,24 +0,0 @@
use leptos::prelude::*;
#[allow(unused_imports)]
use leptos_router::{
components::Route, path, MatchNestedRoutes, NavigateOptions,
};
#[component]
pub fn Routes4217() -> impl MatchNestedRoutes + Clone {
view! {
<Route path=path!("4217") view=Issue4217/>
}
.into_inner()
}
#[component]
fn Issue4217() -> impl IntoView {
view! {
<select multiple=true>
<option id="option1" value="1" selected>"Option 1"</option>
<option id="option2" value="2" selected>"Option 2"</option>
<option id="option3" value="3" selected>"Option 3"</option>
</select>
}
}

View File

@@ -1,49 +0,0 @@
use leptos::prelude::*;
use leptos_router::LazyRoute;
#[allow(unused_imports)]
use leptos_router::{
components::Route, path, Lazy, MatchNestedRoutes, NavigateOptions,
};
#[component]
pub fn Routes4285() -> impl MatchNestedRoutes + Clone {
view! {
<Route path=path!("4285") view={Lazy::<Issue4285>::new()}/>
}
.into_inner()
}
struct Issue4285 {
data: Resource<Result<i32, ServerFnError>>,
}
impl LazyRoute for Issue4285 {
fn data() -> Self {
Self {
data: Resource::new(|| (), |_| slow_call()),
}
}
async fn view(this: Self) -> AnyView {
let Issue4285 { data } = this;
view! {
<Suspense>
{move || {
Suspend::new(async move {
let data = data.await;
view! {
<p id="result">{data}</p>
}
})
}}
</Suspense>
}
.into_any()
}
}
#[server]
async fn slow_call() -> Result<i32, ServerFnError> {
tokio::time::sleep(std::time::Duration::from_millis(250)).await;
Ok(42)
}

View File

@@ -1,36 +0,0 @@
use leptos::prelude::*;
#[allow(unused_imports)]
use leptos_router::{
components::Route, path, Lazy, MatchNestedRoutes, NavigateOptions,
};
use leptos_router::{hooks::use_query_map, LazyRoute};
#[component]
pub fn Routes4296() -> impl MatchNestedRoutes + Clone {
view! {
<Route path=path!("4296") view={Lazy::<Issue4296>::new()}/>
}
.into_inner()
}
struct Issue4296 {
query: Signal<Option<String>>,
}
impl LazyRoute for Issue4296 {
fn data() -> Self {
let query = use_query_map();
let query = Signal::derive(move || query.read().get("q"));
Self { query }
}
async fn view(this: Self) -> AnyView {
let Issue4296 { query } = this;
view! {
<a href="?q=abc">"abc"</a>
<a href="?q=def">"def"</a>
<p id="result">{move || format!("{:?}", query.get())}</p>
}
.into_any()
}
}

View File

@@ -1,10 +1,4 @@
pub mod app;
mod issue_4005;
mod issue_4088;
mod issue_4217;
mod issue_4285;
mod issue_4296;
mod pr_4015;
mod pr_4091;
#[cfg(feature = "hydrate")]

View File

@@ -1,29 +0,0 @@
use leptos::{context::Provider, prelude::*};
use leptos_router::{
components::{ParentRoute, Route},
nested_router::Outlet,
path,
};
#[component]
pub fn Routes4015() -> impl leptos_router::MatchNestedRoutes + Clone {
view! {
<ParentRoute path=path!("4015") view=|| view! {
<Provider value=42i32>
<Outlet/>
</Provider>
}>
<Route path=path!("") view=Child/>
</ParentRoute>
}
.into_inner()
}
#[component]
fn Child() -> impl IntoView {
let value = use_context::<i32>();
view! {
<p id="result">{format!("{value:?}")}</p>
}
}

View File

@@ -28,9 +28,8 @@ fn Container() -> impl IntoView {
provide_context(rw_signal);
view! {
<nav id="nav">
<nav>
<ul>
<li><A href="/">"Home"</A></li>
<li><A href="./">"4091 Home"</A></li>
<li><A href="test1">"test1"</A></li>
</ul>

View File

@@ -29,7 +29,7 @@ tower-http = { version = "0.6.2", features = [
"trace",
], optional = true }
tokio = { version = "1.39", features = ["full"], optional = true }
thiserror = "2.0.12"
thiserror = "2.0.11"
wasm-bindgen = "0.2.93"
serde_toml = "0.0.1"
toml = "0.8.19"

View File

@@ -2,6 +2,8 @@
name = "ssr_modes"
version = "0.1.0"
edition = "2021"
# std::sync::LazyLock is stabilized in Rust version 1.80.0
rust-version = "1.80.0"
[lib]
crate-type = ["cdylib", "rlib"]
@@ -17,7 +19,7 @@ leptos_actix = { path = "../../integrations/actix", optional = true }
leptos_router = { path = "../../router" }
log = "0.4.22"
serde = { version = "1.0", features = ["derive"] }
thiserror = "2.0.12"
thiserror = "1.0"
tokio = { version = "1.39", features = ["time"] }
wasm-bindgen = "0.2.93"

View File

@@ -2,6 +2,8 @@
name = "ssr_modes_axum"
version = "0.1.0"
edition = "2021"
# std::sync::LazyLock is stabilized in Rust version 1.80.0
rust-version = "1.80.0"
[lib]
crate-type = ["cdylib", "rlib"]
@@ -17,7 +19,7 @@ leptos_axum = { path = "../../integrations/axum", optional = true }
leptos_router = { path = "../../router" }
log = "0.4.22"
serde = { version = "1.0", features = ["derive"] }
thiserror = "2.0.12"
thiserror = "1.0"
axum = { version = "0.8.1", optional = true }
tower = { version = "0.4.13", optional = true }
tower-http = { version = "0.5.2", features = ["fs"], optional = true }

View File

@@ -17,7 +17,7 @@ leptos_axum = { path = "../../integrations/axum", optional = true }
leptos_router = { path = "../../router" }
log = "0.4.22"
serde = { version = "1.0", features = ["derive"] }
thiserror = "2.0.12"
thiserror = "1.0"
axum = { version = "0.8.1", optional = true }
tower = { version = "0.4.13", optional = true }
tower-http = { version = "0.5.2", features = ["fs"], optional = true }

View File

@@ -159,7 +159,7 @@ fn TodoRow(
view! {
<li style:text-decoration=move || {
if status.done() { "line-through" } else { Default::default() }
status.done().then_some("line-through").unwrap_or_default()
}>
<p

View File

@@ -1,7 +0,0 @@
# Generated by Cargo
# will have compiled files and executables
/target
.DS_Store
# These are backup files generated by rustfmt
**/*.rs.bk

View File

@@ -1,13 +0,0 @@
[package]
name = "subsecond_hot_patch"
version = "0.1.0"
authors = ["Greg Johnston <greg.johnston@gmail.com>"]
edition = "2021"
[dependencies]
leptos = { path = "../../leptos", features = ["csr", "subsecond"] }
leptos_router = { path = "../../router" }
[features]
default = ["web"]
web = []

View File

@@ -1,21 +0,0 @@
[application]
[web.app]
# HTML title tag content
title = "ltest"
# include `assets` in web platform
[web.resource]
# Additional CSS style files
style = []
# Additional JavaScript files
script = []
[web.resource.dev]
# Javascript code file
# serve: [dev-server] only
script = []

View File

@@ -1 +0,0 @@
extend = [{ path = "../cargo-make/main.toml" }]

View File

@@ -1,31 +0,0 @@
# Hot Patching with `dx`
This is an experimental example exploring how to combine Leptos with the binary hot-patching provided by Dioxus's `subsecond` library and `dx` cli.
### Serving Your App
This requires installing the Dioxus CLI version 0.7.0. At the time I'm writing this README, that does not yet have a stable release. Once `dioxus-cli` 0.7.0 has been released, you should use the latest stable release. Until then, I'd suggest installing from git:
```sh
cargo install dioxus-cli --git https://github.com/DioxusLabs/dioxus
```
Then you can run the example with `dx serve --hot-patch --platform web`.
### Hot Patching
Changes to the your application should be reflected in your app without a full rebuild and reload.
### Limitatations
Currently we only support hot-patching for reactive view functions. You probably want to use `AnyView` (via `.into_any()`) on any views that will be hot-patched, so they can be rebuilt correctly despite their types changing when the structure of the view tree changes.
If you are using `leptos_router` this actually works quite well, as every routes view is erased to `AnyView` and the router itself is a reactive view function: in other words, changes inside any route should be hot-patched in any case.
Note that any hot-patch will cause all render effects to run again. This means that some client-side state (like the values of signals) will be wiped out.
### Build Tooling
The preference of the Dioxus team is that all hot-patching work that uses their `subsecond` also use `dioxus-cli`. As this demo shows, it's completely possible to use `dioxus-cli` to build and run a Leptos project. We do not plan to build `subsecond` into our own build tooling at this time.
**This is an experiment/POC. It is being published because members of the community have found it useful and have asked for the support to be merged in its current state. Further development and bugfixes are a relatively low priority at this time.**

Binary file not shown.

Before

Width:  |  Height:  |  Size: 130 KiB

File diff suppressed because one or more lines are too long

Before

Width:  |  Height:  |  Size: 23 KiB

View File

@@ -1,46 +0,0 @@
/* App-wide styling */
body {
background-color: #0f1116;
color: #ffffff;
font-family: 'Segoe UI', Tahoma, Geneva, Verdana, sans-serif;
margin: 20px;
}
#hero {
margin: 0;
display: flex;
flex-direction: column;
justify-content: center;
align-items: center;
}
#links {
width: 400px;
text-align: left;
font-size: x-large;
color: white;
display: flex;
flex-direction: column;
}
#links a {
color: white;
text-decoration: none;
margin-top: 20px;
margin: 10px 0px;
border: white 1px solid;
border-radius: 5px;
padding: 10px;
}
#links a:hover {
background-color: #1f1f1f;
cursor: pointer;
}
#header {
max-width: 1200px;
}

View File

@@ -1,44 +0,0 @@
use leptos::{prelude::*, subsecond::connect_to_hot_patch_messages};
use leptos_router::{
components::{Route, Router, Routes},
path,
};
fn main() {
// connect to DX CLI and patch the WASM binary whenever we receive a message
connect_to_hot_patch_messages();
// wrapping App here in a closure so we can hot-reload it, because we only do that
// for reactive views right now. changing anything will re-run App and update the view
mount_to_body(|| App);
}
#[component]
fn App() -> impl IntoView {
view! {
<nav>
<a href="/">"Home"</a>
<a href="/about">"About"</a>
</nav>
<Router>
<Routes fallback=|| "Not found">
<Route path=path!("/") view=HomePage/>
<Route path=path!("/about") view=About/>
</Routes>
</Router>
}
}
#[component]
fn HomePage() -> impl IntoView {
view! {
<h1>"Home Page"</h1>
}
}
#[component]
fn About() -> impl IntoView {
view! {
<h1>"About"</h1>
}
}

View File

@@ -20,7 +20,7 @@ tokio = { version = "1.39", features = [
tower = { version = "0.4.13", optional = true }
tower-http = { version = "0.5.2", features = ["fs"], optional = true }
wasm-bindgen = "0.2.93"
thiserror = "2.0.12"
thiserror = "1.0"
tracing = { version = "0.1.40", optional = true }
http = "1.1"

View File

@@ -20,7 +20,7 @@ leptos_actix = { path = "../../integrations/actix", optional = true }
log = "0.4.22"
simple_logger = "5.0"
gloo = { git = "https://github.com/rustwasm/gloo" }
sqlx = { version = "0.8.6", features = [
sqlx = { version = "0.8.0", features = [
"runtime-tokio-rustls",
"sqlite",
], optional = true }
@@ -44,12 +44,12 @@ denylist = ["actix-files", "actix-web", "leptos_actix", "sqlx"]
skip_feature_sets = [["csr", "ssr"], ["csr", "hydrate"], ["ssr", "hydrate"], []]
[package.metadata.leptos]
# The name used by wasm-bindgen/cargo-leptos for the JS/WASM bundle. Defaults to the crate name
# The name used by wasm-bindgen/cargo-leptos for the JS/WASM bundle. Defaults to the crate name
output-name = "todo_app_sqlite"
# The site root folder is where cargo-leptos generate all output. WARNING: all content of this folder will be erased on a rebuild. Use it in your server setup.
site-root = "target/site"
# The site-root relative folder where all compiled output (JS, WASM and CSS) is written
# Defaults to pkg
# Defaults to pkg
site-pkg-dir = "pkg"
# [Optional] The source CSS file. If it ends with .sass or .scss then it will be compiled by dart-sass into CSS. The CSS is optimized by Lightning CSS before being written to <site-root>/<site-pkg>/app.css
style-file = "./style.css"

View File

@@ -20,11 +20,11 @@ axum = { version = "0.8.1", optional = true }
tower = { version = "0.4.13", optional = true }
tower-http = { version = "0.5.2", features = ["fs"], optional = true }
tokio = { version = "1.39", features = ["full"], optional = true }
sqlx = { version = "0.8.6", features = [
sqlx = { version = "0.8.0", features = [
"runtime-tokio-rustls",
"sqlite",
], optional = true }
thiserror = "2.0.12"
thiserror = "1.0"
wasm-bindgen = "0.2.93"
[features]

View File

@@ -20,11 +20,11 @@ tower = { version = "0.5.1", features = ["util"], optional = true }
tower-http = { version = "0.6.1", features = ["fs"], optional = true }
tokio = { version = "1.39", features = ["full"], optional = true }
http = { version = "1.1" }
sqlx = { version = "0.8.6", features = [
sqlx = { version = "0.8.0", features = [
"runtime-tokio-rustls",
"sqlite",
], optional = true }
thiserror = "2.0.12"
thiserror = "2.0"
wasm-bindgen = "0.2.93"
[features]

View File

@@ -17,7 +17,7 @@ simple_logger = "5.0"
serde = { version = "1.0", features = ["derive"] }
axum = { version = "0.8.1", optional = true }
tokio = { version = "1.39", features = ["full"], optional = true }
thiserror = "2.0.12"
thiserror = "2.0"
wasm-bindgen = "0.2.100"
[features]

View File

@@ -4,14 +4,14 @@ authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
description = "Actix integrations for the Leptos web framework."
version = "0.8.5"
version = { workspace = true }
rust-version.workspace = true
edition.workspace = true
[dependencies]
actix-http = { workspace = true, default-features = true }
actix-files = { workspace = true, default-features = true }
actix-web = { workspace = true, default-features = false }
actix-web = { workspace = true, default-features = true }
futures = { workspace = true, default-features = true }
any_spawner = { workspace = true, features = ["tokio"] }
hydration_context = { workspace = true }
@@ -20,12 +20,12 @@ leptos_integration_utils = { workspace = true }
leptos_macro = { workspace = true, features = ["actix"] }
leptos_meta = { workspace = true, features = ["nonce"] }
leptos_router = { workspace = true, features = ["ssr"] }
server_fn = { workspace = true, features = ["actix-no-default"] }
server_fn = { workspace = true, features = ["actix"] }
tachys = { workspace = true }
serde_json = { workspace = true, default-features = true }
serde_json = { workspace = true , default-features = true }
parking_lot = { workspace = true, default-features = true }
tracing = { optional = true, workspace = true, default-features = true }
tokio = { features = ["rt", "fs"], workspace = true, default-features = true }
tracing = { optional = true , workspace = true, default-features = true }
tokio = { features = ["rt", "fs"] , workspace = true, default-features = true }
send_wrapper = { workspace = true, default-features = true }
dashmap = { workspace = true, default-features = true }
@@ -33,8 +33,6 @@ dashmap = { workspace = true, default-features = true }
rustdoc-args = ["--generate-link-to-definition"]
[features]
default = ["actix-default"]
actix-default = ["actix-web/default"]
islands-router = ["tachys/islands"]
tracing = ["dep:tracing"]

View File

@@ -282,7 +282,6 @@ pub fn redirect(path: &str) {
/// // call ServerFn::register() for each of the server functions you've defined
/// }
///
/// # #[cfg(feature = "default")]
/// #[actix_web::main]
/// async fn main() -> std::io::Result<()> {
/// // make sure you actually register your server functions
@@ -298,8 +297,6 @@ pub fn redirect(path: &str) {
/// .run()
/// .await
/// }
/// # #[cfg(not(feature = "default"))]
/// # fn main() {}
/// ```
///
/// ## Provided Context Types
@@ -445,7 +442,6 @@ pub fn handle_server_fns_with_context(
/// view! { <main>"Hello, world!"</main> }
/// }
///
/// # #[cfg(feature = "default")]
/// #[actix_web::main]
/// async fn main() -> std::io::Result<()> {
/// let conf = get_configuration(Some("Cargo.toml")).unwrap();
@@ -465,8 +461,6 @@ pub fn handle_server_fns_with_context(
/// .run()
/// .await
/// }
/// # #[cfg(not(feature = "default"))]
/// # fn main() {}
/// ```
///
/// ## Provided Context Types
@@ -505,7 +499,6 @@ where
/// view! { <main>"Hello, world!"</main> }
/// }
///
/// # #[cfg(feature = "default")]
/// #[actix_web::main]
/// async fn main() -> std::io::Result<()> {
/// let conf = get_configuration(Some("Cargo.toml")).unwrap();
@@ -528,9 +521,6 @@ where
/// .run()
/// .await
/// }
///
/// # #[cfg(not(feature = "default"))]
/// # fn main() {}
/// ```
///
/// ## Provided Context Types
@@ -567,7 +557,6 @@ where
/// view! { <main>"Hello, world!"</main> }
/// }
///
/// # #[cfg(feature = "default")]
/// #[actix_web::main]
/// async fn main() -> std::io::Result<()> {
/// let conf = get_configuration(Some("Cargo.toml")).unwrap();
@@ -587,8 +576,6 @@ where
/// .run()
/// .await
/// }
/// # #[cfg(not(feature = "default"))]
/// # fn main() {}
/// ```
///
/// ## Provided Context Types

View File

@@ -4,7 +4,7 @@ authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
description = "Axum integrations for the Leptos web framework."
version = "0.8.6"
version = "0.8.2"
rust-version.workspace = true
edition.workspace = true
@@ -13,7 +13,7 @@ any_spawner = { workspace = true, features = ["tokio"] }
hydration_context = { workspace = true }
axum = { default-features = false, features = [
"matched-path",
], workspace = true }
] , workspace = true }
dashmap = { workspace = true, default-features = true }
futures = { workspace = true, default-features = true }
leptos = { workspace = true, features = ["nonce", "ssr"] }
@@ -24,17 +24,14 @@ leptos_router = { workspace = true, features = ["ssr"] }
leptos_integration_utils = { workspace = true }
tachys = { workspace = true }
parking_lot = { workspace = true, default-features = true }
tokio = { default-features = false, workspace = true }
tower = { features = ["util"], workspace = true, default-features = true }
tokio = { default-features = false , workspace = true }
tower = { features = ["util"] , workspace = true, default-features = true }
tower-http = { workspace = true, default-features = true }
tracing = { optional = true, workspace = true, default-features = true }
tracing = { optional = true , workspace = true, default-features = true }
[dev-dependencies]
axum = { workspace = true, default-features = true }
tokio = { features = [
"net",
"rt-multi-thread",
], workspace = true, default-features = true }
tokio = { features = ["net", "rt-multi-thread"] , workspace = true, default-features = true }
[features]
wasm = []

View File

@@ -1177,7 +1177,7 @@ where
generate_route_list_with_exclusions_and_ssg(app_fn, None).0
}
/// Generates a list of all routes defined in Leptos's Router in your app. We can then use this to automatically
/// Generates a list of all routes defined in Leptos's Router in your app. We can then use t.clone()his to automatically
/// create routes in Axum's Router without having to use wildcard matching or fallbacks. Takes in your root app Element
/// as an argument so it can walk you app tree. This version is tailored to generate Axum compatible paths.
#[cfg_attr(
@@ -2061,12 +2061,10 @@ where
req,
|app, chunks, _supports_ooo| {
Box::pin(async move {
let app = if cfg!(feature = "islands-router") {
app.to_html_stream_in_order_branching()
} else {
app.to_html_stream_in_order()
};
let app = app.collect::<String>().await;
let app = app
.to_html_stream_in_order()
.collect::<String>()
.await;
let chunks = chunks();
Box::pin(once(async move { app }).chain(chunks))
as PinnedStream<String>

View File

@@ -4,7 +4,7 @@ authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
description = "Utilities to help build server integrations for the Leptos web framework."
version = "0.8.5"
version = { workspace = true }
rust-version.workspace = true
edition.workspace = true

View File

@@ -3,14 +3,12 @@
use futures::{stream::once, Stream, StreamExt};
use hydration_context::{SharedContext, SsrSharedContext};
use leptos::{
context::provide_context,
nonce::use_nonce,
prelude::ReadValue,
reactive::owner::{Owner, Sandboxed},
IntoView, PrefetchLazyFn, WasmSplitManifest,
IntoView,
};
use leptos_config::LeptosOptions;
use leptos_meta::{Link, ServerMetaContextOutput};
use leptos_meta::ServerMetaContextOutput;
use std::{future::Future, pin::Pin, sync::Arc};
pub type PinnedStream<T> = Pin<Box<dyn Stream<Item = T> + Send>>;
@@ -43,8 +41,6 @@ pub trait ExtendResponse: Sized {
IV: IntoView + 'static,
{
async move {
let prefetches = PrefetchLazyFn::default();
let (owner, stream) = build_response(
app_fn,
additional_context,
@@ -52,8 +48,6 @@ pub trait ExtendResponse: Sized {
supports_ooo,
);
owner.with(|| provide_context(prefetches.clone()));
let sc = owner.shared_context().unwrap();
let stream = stream.await.ready_chunks(32).map(|n| n.join(""));
@@ -62,40 +56,6 @@ pub trait ExtendResponse: Sized {
pending.await;
}
if !prefetches.0.read_value().is_empty() {
use leptos::prelude::*;
let nonce =
use_nonce().map(|n| n.to_string()).unwrap_or_default();
if let Some(manifest) = use_context::<WasmSplitManifest>() {
let (pkg_path, manifest) = &*manifest.0.read_value();
let prefetches = prefetches.0.read_value();
let all_prefetches = prefetches.iter().flat_map(|key| {
manifest.get(*key).into_iter().flatten()
});
for module in all_prefetches {
// to_html() on leptos_meta components registers them with the meta context,
// rather than returning HTML directly
_ = view! {
<Link
rel="preload"
href=format!("{pkg_path}/{module}.wasm")
as_="fetch"
type_="application/wasm"
crossorigin=nonce.clone()
/>
}
.to_html();
}
_ = view! {
<Link rel="modulepreload" href=format!("{pkg_path}/__wasm_split.js") crossorigin=nonce/>
}
.to_html();
}
}
let mut stream = Box::pin(
meta_context.inject_meta_context(stream).await.then({
let sc = Arc::clone(&sc);

View File

@@ -1,6 +1,6 @@
[package]
name = "leptos"
version = "0.8.9"
version = { workspace = true }
authors = ["Greg Johnston"]
license = "MIT"
repository = "https://github.com/leptos-rs/leptos"
@@ -24,14 +24,14 @@ leptos_hot_reload = { workspace = true }
leptos_macro = { workspace = true }
leptos_server = { workspace = true, features = ["tachys"] }
leptos_config = { workspace = true }
leptos-spin-macro = { optional = true, workspace = true, default-features = true }
leptos-spin-macro = { optional = true , workspace = true, default-features = true }
oco_ref = { workspace = true }
or_poisoned = { workspace = true }
paste = { workspace = true, default-features = true }
rand = { optional = true, workspace = true, default-features = true }
rand = { optional = true , workspace = true, default-features = true }
# NOTE: While not used directly, `getrandom`'s `wasm_js` feature is needed when `rand` is used on WASM to
# avoid a compilation error
getrandom = { optional = true, workspace = true, default-features = true }
getrandom = { optional = true , workspace = true, default-features = true }
reactive_graph = { workspace = true, features = ["serde"] }
rustc-hash = { workspace = true, default-features = true }
tachys = { workspace = true, features = [
@@ -44,7 +44,7 @@ tracing = { optional = true, workspace = true, default-features = true }
typed-builder = { workspace = true, default-features = true }
typed-builder-macro = { workspace = true, default-features = true }
serde = { workspace = true, default-features = true }
serde_json = { workspace = true, default-features = true }
serde_json = { optional = true, workspace = true, default-features = true }
server_fn = { workspace = true, features = ["form-redirects", "browser"] }
web-sys = { features = [
"ShadowRoot",
@@ -52,15 +52,10 @@ web-sys = { features = [
"ShadowRootMode",
], workspace = true, default-features = true }
wasm-bindgen = { workspace = true, default-features = true }
wasm-bindgen-futures = { workspace = true, default-features = true }
serde_qs = { workspace = true, default-features = true }
slotmap = { workspace = true, default-features = true }
futures = { workspace = true, default-features = true }
send_wrapper = { workspace = true, default-features = true }
wasm_split_helpers.workspace = true
subsecond = { workspace = true, default-features = true, optional = true }
dioxus-cli-config = { workspace = true, default-features = true, optional = true }
dioxus-devtools = { workspace = true, default-features = true, optional = true }
[features]
hydration = [
@@ -98,29 +93,16 @@ tracing = [
]
nonce = ["base64", "rand", "dep:getrandom"]
spin = ["leptos-spin-macro"]
islands = ["leptos_macro/islands"]
islands = ["leptos_macro/islands", "dep:serde_json"]
trace-component-props = [
"leptos_macro/trace-component-props",
"leptos_dom/trace-component-props",
]
delegation = ["tachys/delegation"]
islands-router = ["tachys/mark_branches"]
subsecond = [
"reactive_graph/subsecond",
"dep:subsecond",
"dep:dioxus-cli-config",
"dep:dioxus-devtools",
"web-sys/Location",
"web-sys/MessageEvent",
"web-sys/WebSocket",
"web-sys/Window",
]
[dev-dependencies]
tokio = { features = [
"rt-multi-thread",
"macros",
], workspace = true, default-features = true }
tokio = { features = ["rt-multi-thread", "macros"] , workspace = true, default-features = true }
tokio-test = { workspace = true, default-features = true }
any_spawner = { workspace = true, features = ["futures-executor", "tokio"] }

View File

@@ -157,14 +157,6 @@ impl<T: IntoView + 'static, A: Attribute> RenderHtml
self.children.hydrate::<FROM_SERVER>(cursor, position)
}
async fn hydrate_async(
self,
cursor: &leptos::tachys::hydration::Cursor,
position: &leptos::tachys::view::PositionState,
) -> Self::State {
self.children.hydrate_async(cursor, position).await
}
fn into_owned(self) -> Self::Owned {
AttributeInterceptorInner {
children_builder: self.children_builder,

View File

@@ -262,16 +262,6 @@ where
}
}
impl<C> From<View<C>> for ViewFn
where
C: Clone + Send + Sync + 'static,
View<C>: IntoAny,
{
fn from(value: View<C>) -> Self {
Self(Arc::new(move || value.clone().into_any()))
}
}
impl ViewFn {
/// Execute the wrapped function
pub fn run(&self) -> AnyView {
@@ -299,16 +289,6 @@ where
}
}
impl<C> From<View<C>> for ViewFnOnce
where
C: Send + Sync + 'static,
View<C>: IntoAny,
{
fn from(value: View<C>) -> Self {
Self(Box::new(move || value.into_any()))
}
}
impl ViewFnOnce {
/// Execute the wrapped function
pub fn run(self) -> AnyView {

View File

@@ -2,7 +2,6 @@ use crate::{children::TypedChildren, IntoView};
use futures::{channel::oneshot, future::join_all};
use hydration_context::{SerializedDataId, SharedContext};
use leptos_macro::component;
use or_poisoned::OrPoisoned;
use reactive_graph::{
computed::ArcMemo,
effect::RenderEffect,
@@ -11,12 +10,7 @@ use reactive_graph::{
traits::{Get, Update, With, WithUntracked, WriteValue},
};
use rustc_hash::FxHashMap;
use std::{
collections::VecDeque,
fmt::Debug,
mem,
sync::{Arc, Mutex},
};
use std::{collections::VecDeque, fmt::Debug, mem, sync::Arc};
use tachys::{
html::attribute::{any_attribute::AnyAttribute, Attribute},
hydration::Cursor,
@@ -514,79 +508,6 @@ where
)
}
async fn hydrate_async(
self,
cursor: &Cursor,
position: &PositionState,
) -> Self::State {
let mut children = Some(self.children);
let hook = Arc::clone(&self.hook);
let cursor = cursor.to_owned();
let position = position.to_owned();
let fallback_fn = Arc::new(Mutex::new(self.fallback));
let initial = {
let errors_empty = self.errors_empty.clone();
let errors = self.errors.clone();
let fallback_fn = Arc::clone(&fallback_fn);
async move {
let children = children.take().unwrap();
let (children, fallback) = if errors_empty.get() {
(children.hydrate_async(&cursor, &position).await, None)
} else {
let children = children.build();
let fallback =
(fallback_fn.lock().or_poisoned())(errors.clone());
let fallback =
fallback.hydrate_async(&cursor, &position).await;
(children, Some(fallback))
};
ErrorBoundaryViewState { children, fallback }
}
};
RenderEffect::new_with_async_value(
move |prev: Option<
ErrorBoundaryViewState<Chil::State, Fal::State>,
>| {
let _hook = throw_error::set_error_hook(Arc::clone(&hook));
if let Some(mut state) = prev {
match (self.errors_empty.get(), &mut state.fallback) {
// no errors, and was showing fallback
(true, Some(fallback)) => {
fallback.insert_before_this(&mut state.children);
state.fallback.unmount();
state.fallback = None;
}
// yes errors, and was showing children
(false, None) => {
state.fallback = Some(
(fallback_fn.lock().or_poisoned())(
self.errors.clone(),
)
.build(),
);
state
.children
.insert_before_this(&mut state.fallback);
state.children.unmount();
}
// either there were no errors, and we were already showing the children
// or there are errors, but we were already showing the fallback
// in either case, rebuilding doesn't require us to do anything
_ => {}
}
state
} else {
unreachable!()
}
},
initial,
)
.await
}
fn into_owned(self) -> Self::Owned {
self
}

View File

@@ -111,28 +111,39 @@ where
let on_submit = {
move |ev: SubmitEvent| {
if ev.default_prevented() {
return;
}
ev.prevent_default();
match ServFn::from_event(&ev) {
Ok(new_input) => {
action.dispatch(new_input);
// request_animation_frame here schedules this event handler to run slightly later
// this means that this `submit` handler will run *after* any other `submit` handlers
// that have been added by the user. this is useful because it means that the user can
// add an `on:submit` handler and call `ev.prevent_default()` to prevent the form submission
//
// without this delay, this handler will always run before the user's handler (which was added
// later), which means the user can't prevent the form submission in the same way
//
// see https://github.com/leptos-rs/leptos/issues/3872
request_animation_frame(move || {
if ev.default_prevented() {
return;
}
Err(err) => {
crate::logging::error!(
"Error converting form field into server function \
arguments: {err:?}"
);
value.set(Some(Err(ServerFnErrorErr::Serialization(
err.to_string(),
)
.into_app_error())));
version.update(|n| *n += 1);
ev.prevent_default();
match ServFn::from_event(&ev) {
Ok(new_input) => {
action.dispatch(new_input);
}
Err(err) => {
crate::logging::error!(
"Error converting form field into server function \
arguments: {err:?}"
);
value.set(Some(Err(ServerFnErrorErr::Serialization(
err.to_string(),
)
.into_app_error())));
version.update(|n| *n += 1);
}
}
}
});
}
};

View File

@@ -8,49 +8,46 @@
c();
}
}
async function hydrateIslands(rootNode, mod) {
async function traverse(node) {
function hydrateIslands(rootNode, mod) {
function traverse(node) {
if (node.nodeType === Node.ELEMENT_NODE) {
const tag = node.tagName.toLowerCase();
if(tag === 'leptos-island') {
const children = [];
const id = node.dataset.component || null;
await hydrateIsland(node, id, mod);
hydrateIsland(node, id, mod);
for(const child of node.children) {
await traverse(child, children);
traverse(child, children);
}
} else {
if (tag === 'leptos-children') {
MOST_RECENT_CHILDREN_CB.push(node.$$on_hydrate);
for(const child of node.children) {
await traverse(child);
traverse(child);
};
// un-set the "most recent children"
MOST_RECENT_CHILDREN_CB.pop();
} else {
for(const child of node.children) {
await traverse(child);
traverse(child);
};
}
}
}
}
await traverse(rootNode);
traverse(rootNode);
}
async function hydrateIsland(el, id, mod) {
function hydrateIsland(el, id, mod) {
const islandFn = mod[id];
if (islandFn) {
const children_cb = MOST_RECENT_CHILDREN_CB[MOST_RECENT_CHILDREN_CB.length-1];
if (children_cb) {
children_cb();
}
const res = islandFn(el);
if (res && res.then) {
await res;
}
islandFn(el);
} else {
console.warn(`Could not find WASM function for the island ${id}.`);
}

View File

@@ -1,9 +1,8 @@
#![allow(clippy::needless_lifetimes)]
use crate::{prelude::*, WasmSplitManifest};
use crate::prelude::*;
use leptos_config::LeptosOptions;
use leptos_macro::{component, view};
use std::{path::PathBuf, sync::OnceLock};
/// Inserts auto-reloading code used in `cargo-leptos`.
///
@@ -59,29 +58,6 @@ pub fn HydrationScripts(
#[prop(optional, into)]
root: Option<String>,
) -> impl IntoView {
static SPLIT_MANIFEST: OnceLock<Option<WasmSplitManifest>> =
OnceLock::new();
if let Some(splits) = SPLIT_MANIFEST.get_or_init(|| {
let root = root.clone().unwrap_or_default();
let site_dir = &options.site_root;
let pkg_dir = &options.site_pkg_dir;
let path = PathBuf::from(site_dir.to_string());
let path = path
.join(pkg_dir.to_string())
.join("__wasm_split_manifest.json");
let file = std::fs::read_to_string(path).ok()?;
let manifest = WasmSplitManifest(ArcStoredValue::new((
format!("{root}/{pkg_dir}"),
serde_json::from_str(&file).expect("could not read manifest file"),
)));
Some(manifest)
}) {
provide_context(splits.clone());
}
let mut js_file_name = options.output_name.to_string();
let mut wasm_file_name = options.output_name.to_string();
if options.hash_files {
@@ -136,7 +112,7 @@ pub fn HydrationScripts(
let root = root.unwrap_or_default();
view! {
<link rel="modulepreload" href=format!("{root}/{pkg_path}/{js_file_name}.js") crossorigin=nonce.clone()/>
<link rel="modulepreload" href=format!("{root}/{pkg_path}/{js_file_name}.js") nonce=nonce.clone()/>
<link
rel="preload"
href=format!("{root}/{pkg_path}/{wasm_file_name}.wasm")

View File

@@ -1,7 +1,3 @@
if (window.location.protocol === 'https:') {
protocol = 'wss://';
}
let host = window.location.hostname;
let ws = new WebSocket(`${protocol}${host}:${reload_port}/live_reload`);
ws.onmessage = (ev) => {

View File

@@ -90,7 +90,6 @@ impl<T: RenderHtml> RenderHtml for View<T> {
type Owned = View<T::Owned>;
const MIN_LENGTH: usize = <T as RenderHtml>::MIN_LENGTH;
const EXISTS: bool = <T as RenderHtml>::EXISTS;
async fn resolve(self) -> Self::AsyncOutput {
self.inner.resolve().await
@@ -108,14 +107,9 @@ impl<T: RenderHtml> RenderHtml for View<T> {
mark_branches: bool,
extra_attrs: Vec<AnyAttribute>,
) {
#[cfg(debug_assertions)]
let vm = if option_env!("LEPTOS_WATCH").is_some() {
self.view_marker.to_owned()
} else {
None
};
#[cfg(debug_assertions)]
#[cfg(all(debug_assertions, feature = "nightly", rustc_nightly))]
let vm = self.view_marker.to_owned();
#[cfg(all(debug_assertions, feature = "nightly", rustc_nightly))]
if let Some(vm) = vm.as_ref() {
buf.push_str(&format!("<!--hot-reload|{vm}|open-->"));
}
@@ -128,7 +122,7 @@ impl<T: RenderHtml> RenderHtml for View<T> {
extra_attrs,
);
#[cfg(debug_assertions)]
#[cfg(all(debug_assertions, feature = "nightly", rustc_nightly))]
if let Some(vm) = vm.as_ref() {
buf.push_str(&format!("<!--hot-reload|{vm}|close-->"));
}
@@ -144,14 +138,9 @@ impl<T: RenderHtml> RenderHtml for View<T> {
) where
Self: Sized,
{
#[cfg(debug_assertions)]
let vm = if option_env!("LEPTOS_WATCH").is_some() {
self.view_marker.to_owned()
} else {
None
};
#[cfg(debug_assertions)]
#[cfg(all(debug_assertions, feature = "nightly", rustc_nightly))]
let vm = self.view_marker.to_owned();
#[cfg(all(debug_assertions, feature = "nightly", rustc_nightly))]
if let Some(vm) = vm.as_ref() {
buf.push_sync(&format!("<!--hot-reload|{vm}|open-->"));
}
@@ -164,7 +153,7 @@ impl<T: RenderHtml> RenderHtml for View<T> {
extra_attrs,
);
#[cfg(debug_assertions)]
#[cfg(all(debug_assertions, feature = "nightly", rustc_nightly))]
if let Some(vm) = vm.as_ref() {
buf.push_sync(&format!("<!--hot-reload|{vm}|close-->"));
}
@@ -178,14 +167,6 @@ impl<T: RenderHtml> RenderHtml for View<T> {
self.inner.hydrate::<FROM_SERVER>(cursor, position)
}
async fn hydrate_async(
self,
cursor: &Cursor,
position: &PositionState,
) -> Self::State {
self.inner.hydrate_async(cursor, position).await
}
fn into_owned(self) -> Self::Owned {
View {
inner: self.inner.into_owned(),

View File

@@ -1,4 +1,5 @@
#![deny(missing_docs)]
#![forbid(unsafe_code)]
//! # About Leptos
//!
@@ -84,22 +85,12 @@
//! # Feature Flags
//!
//! - **`nightly`**: On `nightly` Rust, enables the function-call syntax for signal getters and setters.
//! Also enables some experimental optimizations that improve the handling of static strings and
//! the performance of the `template! {}` macro.
//! - **`csr`** Client-side rendering: Generate DOM nodes in the browser.
//! - **`ssr`** Server-side rendering: Generate an HTML string (typically on the server).
//! - **`islands`** Activates “islands mode,” in which components are not made interactive on the
//! client unless they use the `#[island]` macro.
//! - **`hydrate`** Hydration: use this to add interactivity to an SSRed Leptos app.
//! - **`nonce`** Adds support for nonces to be added as part of a Content Security Policy.
//! - **`rkyv`** In SSR/hydrate mode, enables using [`rkyv`](https://docs.rs/rkyv/latest/rkyv/) to serialize resources.
//! - **`rkyv`** In SSR/hydrate mode, uses [`rkyv`](https://docs.rs/rkyv/latest/rkyv/) to serialize resources and send them
//! from the server to the client.
//! - **`tracing`** Adds support for [`tracing`](https://docs.rs/tracing/latest/tracing/).
//! - **`trace-component-props`** Adds `tracing` support for component props.
//! - **`delegation`** Uses event delegation rather than the browsers native event handling
//! system. (This improves the performance of creating large numbers of elements simultaneously,
//! in exchange for occasional edge cases in which events behave differently from native browser
//! events.)
//! - **`rustls`** Use `rustls` for server functions.
//!
//! **Important Note:** You must enable one of `csr`, `hydrate`, or `ssr` to tell Leptos
//! which mode your app is operating in. You should only enable one of these per build target,
@@ -224,15 +215,12 @@ pub mod error {
/// Control-flow components like `<Show>`, `<For>`, and `<Await>`.
pub mod control_flow {
pub use crate::{
animated_show::*, await_::*, for_loop::*, show::*, show_let::*,
};
pub use crate::{animated_show::*, await_::*, for_loop::*, show::*};
}
mod animated_show;
mod await_;
mod for_loop;
mod show;
mod show_let;
/// A component that allows rendering a component somewhere else.
pub mod portal;
@@ -305,10 +293,6 @@ pub use tachys::mathml as math;
#[doc(inline)]
pub use tachys::svg;
#[cfg(feature = "subsecond")]
/// Utilities for using binary hot-patching with [`subsecond`].
pub mod subsecond;
/// Utilities for simple isomorphic logging to the console or terminal.
pub mod logging {
pub use leptos_dom::{debug_warn, error, log, warn};
@@ -317,17 +301,12 @@ pub mod logging {
/// Utilities for working with asynchronous tasks.
pub mod task {
use any_spawner::Executor;
use reactive_graph::computed::ScopedFuture;
use std::future::Future;
/// Spawns a thread-safe [`Future`].
///
/// This will be run with the current reactive owner and observer using a [`ScopedFuture`].
#[track_caller]
#[inline(always)]
pub fn spawn(fut: impl Future<Output = ()> + Send + 'static) {
let fut = ScopedFuture::new(fut);
#[cfg(not(target_family = "wasm"))]
Executor::spawn(fut);
@@ -356,6 +335,7 @@ pub mod task {
#[cfg(feature = "islands")]
#[doc(hidden)]
pub use serde;
#[cfg(feature = "islands")]
#[doc(hidden)]
pub use serde_json;
#[cfg(feature = "tracing")]
@@ -363,39 +343,5 @@ pub use serde_json;
pub use tracing;
#[doc(hidden)]
pub use wasm_bindgen;
pub use wasm_split_helpers;
#[doc(hidden)]
pub use web_sys;
#[doc(hidden)]
pub mod __reexports {
pub use send_wrapper;
pub use wasm_bindgen_futures;
}
#[doc(hidden)]
#[derive(Clone, Debug, Default)]
pub struct PrefetchLazyFn(
pub reactive_graph::owner::ArcStoredValue<
std::collections::HashSet<&'static str>,
>,
);
#[doc(hidden)]
pub fn prefetch_lazy_fn_on_server(id: &'static str) {
use crate::context::use_context;
use reactive_graph::traits::WriteValue;
if let Some(prefetches) = use_context::<PrefetchLazyFn>() {
prefetches.0.write_value().insert(id);
}
}
#[doc(hidden)]
#[derive(Clone, Debug, Default)]
pub struct WasmSplitManifest(
pub reactive_graph::owner::ArcStoredValue<(
String,
std::collections::HashMap<String, Vec<String>>,
)>,
);

View File

@@ -29,25 +29,6 @@ where
owner.forget();
}
#[cfg(feature = "hydrate")]
/// Hydrates the app described by the provided function, starting at `<body>`, with support
/// for lazy-loaded routes and components.
pub fn hydrate_lazy<F, N>(f: F)
where
F: FnOnce() -> N + 'static,
N: IntoView,
{
// use wasm-bindgen-futures to drive the reactive system
// we ignore the return value because an Err here just means the wasm-bindgen executor is
// already initialized, which is not an issue
_ = Executor::init_wasm_bindgen();
crate::task::spawn_local(async move {
let owner = hydrate_from_async(body(), f).await;
owner.forget();
})
}
#[cfg(debug_assertions)]
thread_local! {
static FIRST_CALL: Cell<bool> = const { Cell::new(true) };
@@ -102,65 +83,6 @@ where
UnmountHandle { owner, mountable }
}
#[cfg(feature = "hydrate")]
/// Runs the provided closure and mounts the result to the provided element.
pub async fn hydrate_from_async<F, N>(
parent: HtmlElement,
f: F,
) -> UnmountHandle<N::State>
where
F: FnOnce() -> N + 'static,
N: IntoView,
{
use hydration_context::HydrateSharedContext;
use std::sync::Arc;
// use wasm-bindgen-futures to drive the reactive system
// we ignore the return value because an Err here just means the wasm-bindgen executor is
// already initialized, which is not an issue
_ = Executor::init_wasm_bindgen();
#[cfg(debug_assertions)]
{
if !cfg!(feature = "hydrate") && FIRST_CALL.get() {
logging::warn!(
"It seems like you're trying to use Leptos in hydration mode, \
but the `hydrate` feature is not enabled on the `leptos` \
crate. Add `features = [\"hydrate\"]` to your Cargo.toml for \
the crate to work properly.\n\nNote that hydration and \
client-side rendering now use separate functions from \
leptos::mount: you are calling a hydration function."
);
}
FIRST_CALL.set(false);
}
// create a new reactive owner and use it as the root node to run the app
let owner = Owner::new_root(Some(Arc::new(HydrateSharedContext::new())));
let mountable = owner
.with(move || {
use reactive_graph::computed::ScopedFuture;
ScopedFuture::new(async move {
let view = f().into_view();
view.hydrate_async(
&Cursor::new(parent.unchecked_into()),
&PositionState::default(),
)
.await
})
})
.await;
if let Some(sc) = Owner::current_shared_context() {
sc.hydration_complete();
}
// returns a handle that owns the owner
// when this is dropped, it will clean up the reactive system and unmount the view
UnmountHandle { owner, mountable }
}
/// Runs the provided closure and mounts the result to the `<body>`.
pub fn mount_to_body<F, N>(f: F)
where

Some files were not shown because too many files have changed in this diff Show More